|
Name |
3-hydroxy-6'-O-desmethylterphenyllin
|
| Molecular Formula | C19H16O6 | |
| IUPAC Name* |
2-(3,4-dihydroxyphenyl)-5-(4-hydroxyphenyl)-4-methoxybenzene-1,3-diol
|
|
| SMILES |
COC1=C(C(=C(C=C1C2=CC=C(C=C2)O)O)C3=CC(=C(C=C3)O)O)O
|
|
| InChI |
InChI=1S/C19H16O6/c1-25-19-13(10-2-5-12(20)6-3-10)9-16(23)17(18(19)24)11-4-7-14(21)15(22)8-11/h2-9,20-24H,1H3
|
|
| InChIKey |
ATMBBZRMOGOHOQ-UHFFFAOYSA-N
|
|
| Synonyms |
CHEMBL1801783; CHEBI:67400; 3-hydroxy-6'-O-desmethylterphenyllin; 3''-Hydroxy-5'-O-desmethylterphenyllin; DTXSID201210321; BDBM50347540; Q27135862; 3'-Methoxy-1,1':4',1''-terphenyl-2',3,4,4'',6'-pentol; 3'-Methoxy[1,1':4',1''-terphenyl]-2',3,4,4'',6'-pentol; 1299485-91-8
|
|
| CAS | 1299485-91-8 | |
| PubChem CID | 53262758 | |
| ChEMBL ID | CHEMBL1801783 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 340.3 | ALogp: | 3.4 |
| HBD: | 5 | HBA: | 6 |
| Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 110.0 | Aromatic Rings: | 3 |
| Heavy Atoms: | 25 | QED Weighted: | 0.455 |
| Caco-2 Permeability: | -5.228 | MDCK Permeability: | 0.00000852 |
| Pgp-inhibitor: | 0.015 | Pgp-substrate: | 0.012 |
| Human Intestinal Absorption (HIA): | 0.014 | 20% Bioavailability (F20%): | 0.958 |
| 30% Bioavailability (F30%): | 0.988 |
| Blood-Brain-Barrier Penetration (BBB): | 0.007 | Plasma Protein Binding (PPB): | 99.40% |
| Volume Distribution (VD): | 0.537 | Fu: | 1.69% |
| CYP1A2-inhibitor: | 0.924 | CYP1A2-substrate: | 0.375 |
| CYP2C19-inhibitor: | 0.315 | CYP2C19-substrate: | 0.048 |
| CYP2C9-inhibitor: | 0.64 | CYP2C9-substrate: | 0.817 |
| CYP2D6-inhibitor: | 0.443 | CYP2D6-substrate: | 0.797 |
| CYP3A4-inhibitor: | 0.295 | CYP3A4-substrate: | 0.182 |
| Clearance (CL): | 11.635 | Half-life (T1/2): | 0.844 |
| hERG Blockers: | 0.223 | Human Hepatotoxicity (H-HT): | 0.042 |
| Drug-inuced Liver Injury (DILI): | 0.933 | AMES Toxicity: | 0.665 |
| Rat Oral Acute Toxicity: | 0.205 | Maximum Recommended Daily Dose: | 0.044 |
| Skin Sensitization: | 0.93 | Carcinogencity: | 0.1 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.923 |
| Respiratory Toxicity: | 0.084 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005039 | ![]() |
0.808 | D0K8KX | ![]() |
0.449 | ||
| ENC001998 | ![]() |
0.750 | D04AIT | ![]() |
0.411 | ||
| ENC002755 | ![]() |
0.744 | D0J7RK | ![]() |
0.365 | ||
| ENC005040 | ![]() |
0.663 | D06KYN | ![]() |
0.354 | ||
| ENC002452 | ![]() |
0.600 | D0U3YB | ![]() |
0.344 | ||
| ENC000826 | ![]() |
0.598 | D0AZ8C | ![]() |
0.336 | ||
| ENC002759 | ![]() |
0.598 | D07MGA | ![]() |
0.327 | ||
| ENC002757 | ![]() |
0.598 | D06GCK | ![]() |
0.314 | ||
| ENC002776 | ![]() |
0.567 | D06TJJ | ![]() |
0.306 | ||
| ENC005038 | ![]() |
0.563 | D04XEG | ![]() |
0.300 | ||