|
Name |
15-hydroxy-17-methoxy-3-methyl-3,4,5,6,7,8,9,10-octahydro-1H-benzo[c][1]oxacyclotetradecine-1,11(12H)-dione
|
| Molecular Formula | C19H26O5 | |
| IUPAC Name* |
(4R)-16-hydroxy-18-methoxy-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),15,17-triene-2,12-dione
|
|
| SMILES |
C[C@@H]1CCCCCCCC(=O)CC2=C(C(=CC(=C2)O)OC)C(=O)O1
|
|
| InChI |
InChI=1S/C19H26O5/c1-13-8-6-4-3-5-7-9-15(20)10-14-11-16(21)12-17(23-2)18(14)19(22)24-13/h11-13,21H,3-10H2,1-2H3/t13-/m1/s1
|
|
| InChIKey |
OWHJIFBGXNKCCV-CYBMUJFWSA-N
|
|
| Synonyms |
(3R)-14-Hydroxy-16-methoxy-3-methyl-3,4,5,6,7,8,9,10-octahydro-1H-2-benzooxacyclotetradecin-1,11(12H)-dione; 15-hydroxy-17-methoxy-3-methyl-3,4,5,6,7,8,9,10-octahydro-1H-benzo[c ][1]oxacyclotetradecine-1,11(12H)-dione
|
|
| CAS | NA | |
| PubChem CID | 122369885 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 334.4 | ALogp: | 3.9 |
| HBD: | 1 | HBA: | 5 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 72.8 | Aromatic Rings: | 2 |
| Heavy Atoms: | 24 | QED Weighted: | 0.767 |
| Caco-2 Permeability: | -4.7 | MDCK Permeability: | 0.00003230 |
| Pgp-inhibitor: | 0.01 | Pgp-substrate: | 0.014 |
| Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.902 |
| 30% Bioavailability (F30%): | 0.021 |
| Blood-Brain-Barrier Penetration (BBB): | 0.714 | Plasma Protein Binding (PPB): | 91.81% |
| Volume Distribution (VD): | 0.781 | Fu: | 3.18% |
| CYP1A2-inhibitor: | 0.915 | CYP1A2-substrate: | 0.752 |
| CYP2C19-inhibitor: | 0.917 | CYP2C19-substrate: | 0.234 |
| CYP2C9-inhibitor: | 0.805 | CYP2C9-substrate: | 0.972 |
| CYP2D6-inhibitor: | 0.752 | CYP2D6-substrate: | 0.696 |
| CYP3A4-inhibitor: | 0.803 | CYP3A4-substrate: | 0.123 |
| Clearance (CL): | 11.593 | Half-life (T1/2): | 0.851 |
| hERG Blockers: | 0.015 | Human Hepatotoxicity (H-HT): | 0.181 |
| Drug-inuced Liver Injury (DILI): | 0.728 | AMES Toxicity: | 0.041 |
| Rat Oral Acute Toxicity: | 0.227 | Maximum Recommended Daily Dose: | 0.623 |
| Skin Sensitization: | 0.567 | Carcinogencity: | 0.032 |
| Eye Corrosion: | 0.007 | Eye Irritation: | 0.272 |
| Respiratory Toxicity: | 0.544 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002298 | ![]() |
0.826 | D07GRH | ![]() |
0.267 | ||
| ENC005004 | ![]() |
0.826 | D07MGA | ![]() |
0.267 | ||
| ENC005007 | ![]() |
0.795 | D0X5KF | ![]() |
0.262 | ||
| ENC005001 | ![]() |
0.707 | D03SKD | ![]() |
0.257 | ||
| ENC003715 | ![]() |
0.707 | D0L1JW | ![]() |
0.256 | ||
| ENC005006 | ![]() |
0.641 | D0P6VV | ![]() |
0.255 | ||
| ENC005003 | ![]() |
0.640 | D0J4IX | ![]() |
0.252 | ||
| ENC002297 | ![]() |
0.640 | D0P9RF | ![]() |
0.246 | ||
| ENC005005 | ![]() |
0.636 | D0C1SF | ![]() |
0.245 | ||
| ENC001527 | ![]() |
0.613 | D00ZFP | ![]() |
0.240 | ||