|
Name |
Lasiodiplodin
|
| Molecular Formula | C17H24O4 | |
| IUPAC Name* |
(4S)-14-hydroxy-16-methoxy-4-methyl-3-oxabicyclo[10.4.0]hexadeca-1(12),13,15-trien-2-one
|
|
| SMILES |
C[C@H]1CCCCCCCC2=C(C(=CC(=C2)O)OC)C(=O)O1
|
|
| InChI |
InChI=1S/C17H24O4/c1-12-8-6-4-3-5-7-9-13-10-14(18)11-15(20-2)16(13)17(19)21-12/h10-12,18H,3-9H2,1-2H3/t12-/m0/s1
|
|
| InChIKey |
OKWRDLQBKAOJNC-LBPRGKRZSA-N
|
|
| Synonyms |
lasiodiplodin; 32885-81-7; (4S)-14-hydroxy-16-methoxy-4-methyl-3-oxabicyclo[10.4.0]hexadeca-1(12),13,15-trien-2-one; (S)-Lasiodiplodin; CHEMBL393258; SCHEMBL23484270; ZINC28875643; AKOS032948907; Q59287150; (3S)-12-hydroxy-14-methoxy-3-methyl-3,4,5,6,7,8,9,10-octahydro-1H-2-benzoxacyclododecin-1-one; (9S)-15-hydroxy-13-methoxy-9-methyl-10-oxabicyclo[10.4.0]hexadeca-1(12),13,15-trien-11-one
|
|
| CAS | NA | |
| PubChem CID | 14562696 | |
| ChEMBL ID | CHEMBL393258 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 292.4 | ALogp: | 4.7 |
| HBD: | 1 | HBA: | 4 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 55.8 | Aromatic Rings: | 2 |
| Heavy Atoms: | 21 | QED Weighted: | 0.774 |
| Caco-2 Permeability: | -4.703 | MDCK Permeability: | 0.00003570 |
| Pgp-inhibitor: | 0.004 | Pgp-substrate: | 0.002 |
| Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.346 |
| 30% Bioavailability (F30%): | 0.014 |
| Blood-Brain-Barrier Penetration (BBB): | 0.717 | Plasma Protein Binding (PPB): | 95.53% |
| Volume Distribution (VD): | 0.723 | Fu: | 2.83% |
| CYP1A2-inhibitor: | 0.963 | CYP1A2-substrate: | 0.613 |
| CYP2C19-inhibitor: | 0.87 | CYP2C19-substrate: | 0.277 |
| CYP2C9-inhibitor: | 0.658 | CYP2C9-substrate: | 0.961 |
| CYP2D6-inhibitor: | 0.898 | CYP2D6-substrate: | 0.828 |
| CYP3A4-inhibitor: | 0.716 | CYP3A4-substrate: | 0.111 |
| Clearance (CL): | 10.386 | Half-life (T1/2): | 0.426 |
| hERG Blockers: | 0.036 | Human Hepatotoxicity (H-HT): | 0.104 |
| Drug-inuced Liver Injury (DILI): | 0.443 | AMES Toxicity: | 0.056 |
| Rat Oral Acute Toxicity: | 0.024 | Maximum Recommended Daily Dose: | 0.631 |
| Skin Sensitization: | 0.896 | Carcinogencity: | 0.131 |
| Eye Corrosion: | 0.163 | Eye Irritation: | 0.94 |
| Respiratory Toxicity: | 0.681 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005004 | ![]() |
1.000 | D07GRH | ![]() |
0.295 | ||
| ENC003318 | ![]() |
0.826 | D0X5KF | ![]() |
0.284 | ||
| ENC002297 | ![]() |
0.769 | D0P6VV | ![]() |
0.279 | ||
| ENC005003 | ![]() |
0.769 | D03SKD | ![]() |
0.278 | ||
| ENC005006 | ![]() |
0.765 | D07MGA | ![]() |
0.277 | ||
| ENC005005 | ![]() |
0.761 | D0L1JW | ![]() |
0.264 | ||
| ENC005001 | ![]() |
0.714 | D00ZFP | ![]() |
0.261 | ||
| ENC003715 | ![]() |
0.714 | D0J4IX | ![]() |
0.260 | ||
| ENC001527 | ![]() |
0.704 | D09OBB | ![]() |
0.258 | ||
| ENC003973 | ![]() |
0.662 | D09PJX | ![]() |
0.255 | ||