|
Name |
Elsinochrome C
|
| Molecular Formula | C30H28O10 | |
| IUPAC Name* |
9,16-dihydroxy-12,13-bis(1-hydroxyethyl)-5,10,15,20-tetramethoxyhexacyclo[12.8.0.02,11.03,8.04,21.017,22]docosa-1(14),2(11),3(8),4(21),5,9,15,17(22),19-nonaene-7,18-dione
|
|
| SMILES |
CC(C1C(C2=C3C4=C1C(=C(C5=C4C(=C6C3=C(C(=O)C=C6OC)C(=C2OC)O)C(=CC5=O)OC)O)OC)C(C)O)O
|
|
| InChI |
InChI=1S/C30H28O10/c1-9(31)15-16(10(2)32)26-24-22-18(28(36)30(26)40-6)12(34)8-14(38-4)20(22)19-13(37-3)7-11(33)17-21(19)23(24)25(15)29(39-5)27(17)35/h7-10,15-16,31-32,35-36H,1-6H3
|
|
| InChIKey |
ZMNNNJBGHWVPLI-UHFFFAOYSA-N
|
|
| Synonyms |
Elsinochrome C; NSC671197; 24512-87-6; 9,16-dihydroxy-12,13-bis(1-hydroxyethyl)-5,10,15,20-tetramethoxyhexacyclo[12.8.0.02,11.03,8.04,21.017,22]docosa-1(14),2(11),3(8),4(21),5,9,15,17(22),19-nonaene-7,18-dione; CHEMBL1995908; NSC-671197; NCI60_025146; dihydroxy-bis(1-hydroxyethyl)-tetramethoxy-[?]dione; 5,10-Dihydroxy-1,2-bis(1-hydroxyethyl)-3,7,8,12-tetramethoxy-1,2-dihydrobenzo[ghi]perylene-4,11-dione
|
|
| CAS | NA | |
| PubChem CID | 495866 | |
| ChEMBL ID | CHEMBL1995908 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 548.5 | ALogp: | 3.5 |
| HBD: | 4 | HBA: | 10 |
| Rotatable Bonds: | 6 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 152.0 | Aromatic Rings: | 6 |
| Heavy Atoms: | 40 | QED Weighted: | 0.181 |
| Caco-2 Permeability: | -5.363 | MDCK Permeability: | 0.00001030 |
| Pgp-inhibitor: | 0.098 | Pgp-substrate: | 0.752 |
| Human Intestinal Absorption (HIA): | 0.955 | 20% Bioavailability (F20%): | 0 |
| 30% Bioavailability (F30%): | 0.086 |
| Blood-Brain-Barrier Penetration (BBB): | 0.002 | Plasma Protein Binding (PPB): | 73.35% |
| Volume Distribution (VD): | 0.624 | Fu: | 47.36% |
| CYP1A2-inhibitor: | 0.43 | CYP1A2-substrate: | 0.973 |
| CYP2C19-inhibitor: | 0.02 | CYP2C19-substrate: | 0.3 |
| CYP2C9-inhibitor: | 0.196 | CYP2C9-substrate: | 0.866 |
| CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.233 |
| CYP3A4-inhibitor: | 0.015 | CYP3A4-substrate: | 0.076 |
| Clearance (CL): | 0.994 | Half-life (T1/2): | 0.352 |
| hERG Blockers: | 0.023 | Human Hepatotoxicity (H-HT): | 0.017 |
| Drug-inuced Liver Injury (DILI): | 0.858 | AMES Toxicity: | 0.156 |
| Rat Oral Acute Toxicity: | 0.027 | Maximum Recommended Daily Dose: | 0.121 |
| Skin Sensitization: | 0.154 | Carcinogencity: | 0.007 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.797 |
| Respiratory Toxicity: | 0.094 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001117 | ![]() |
0.831 | D06GCK | ![]() |
0.321 | ||
| ENC003190 | ![]() |
0.714 | D02LZB | ![]() |
0.298 | ||
| ENC004029 | ![]() |
0.674 | D09DHY | ![]() |
0.297 | ||
| ENC001454 | ![]() |
0.621 | D03RTK | ![]() |
0.245 | ||
| ENC003042 | ![]() |
0.503 | D01FFA | ![]() |
0.238 | ||
| ENC001491 | ![]() |
0.469 | D04TDQ | ![]() |
0.237 | ||
| ENC001501 | ![]() |
0.409 | D0C1SF | ![]() |
0.236 | ||
| ENC002093 | ![]() |
0.409 | D0V8HJ | ![]() |
0.232 | ||
| ENC002002 | ![]() |
0.400 | D0D4HN | ![]() |
0.229 | ||
| ENC003154 | ![]() |
0.391 | D0Y7TS | ![]() |
0.228 | ||