|
Name |
(R,Z)-2-Methyl-6-(4-methylcyclohexa-1,4-dien-1-yl)hept-2-en-1-ol
|
| Molecular Formula | C15H24O | |
| IUPAC Name* |
(Z,6R)-2-methyl-6-(4-methylcyclohexa-1,4-dien-1-yl)hept-2-en-1-ol
|
|
| SMILES |
CC1=CCC(=CC1)[C@H](C)CC/C=C(/C)\CO
|
|
| InChI |
InChI=1S/C15H24O/c1-12-7-9-15(10-8-12)14(3)6-4-5-13(2)11-16/h5,7,10,14,16H,4,6,8-9,11H2,1-3H3/b13-5-/t14-/m1/s1
|
|
| InChIKey |
ZHWZEHFYKZGQFR-MECSIWFOSA-N
|
|
| Synonyms |
(Z)-beta-Curcumene-12-ol; (Z)-.beta.-Curcumen-12-ol; .beta.-(Z)-Curcumen-12-ol; (R,Z)-2-Methyl-6-(4-methylcyclohexa-1,4-dien-1-yl)hept-2-en-1-ol; 2-Hepten-1-ol, 2-methyl-6-(4-methyl-1,4-cyclohexadien-1-yl)-, (2Z,6R)-
|
|
| CAS | NA | |
| PubChem CID | 91710638 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 220.35 | ALogp: | 3.5 |
| HBD: | 1 | HBA: | 1 |
| Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 20.2 | Aromatic Rings: | 1 |
| Heavy Atoms: | 16 | QED Weighted: | 0.669 |
| Caco-2 Permeability: | -4.486 | MDCK Permeability: | 0.00001930 |
| Pgp-inhibitor: | 0.084 | Pgp-substrate: | 0.001 |
| Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.999 |
| 30% Bioavailability (F30%): | 1 |
| Blood-Brain-Barrier Penetration (BBB): | 0.591 | Plasma Protein Binding (PPB): | 95.51% |
| Volume Distribution (VD): | 3.376 | Fu: | 3.31% |
| CYP1A2-inhibitor: | 0.665 | CYP1A2-substrate: | 0.235 |
| CYP2C19-inhibitor: | 0.142 | CYP2C19-substrate: | 0.445 |
| CYP2C9-inhibitor: | 0.077 | CYP2C9-substrate: | 0.53 |
| CYP2D6-inhibitor: | 0.24 | CYP2D6-substrate: | 0.72 |
| CYP3A4-inhibitor: | 0.272 | CYP3A4-substrate: | 0.242 |
| Clearance (CL): | 9.647 | Half-life (T1/2): | 0.888 |
| hERG Blockers: | 0.006 | Human Hepatotoxicity (H-HT): | 0.133 |
| Drug-inuced Liver Injury (DILI): | 0.187 | AMES Toxicity: | 0.004 |
| Rat Oral Acute Toxicity: | 0.014 | Maximum Recommended Daily Dose: | 0.643 |
| Skin Sensitization: | 0.914 | Carcinogencity: | 0.877 |
| Eye Corrosion: | 0.059 | Eye Irritation: | 0.955 |
| Respiratory Toxicity: | 0.087 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC000197 | ![]() |
0.479 | D0M1PQ | ![]() |
0.250 | ||
| ENC002218 | ![]() |
0.441 | D03VFL | ![]() |
0.196 | ||
| ENC002339 | ![]() |
0.375 | D0O1UZ | ![]() |
0.189 | ||
| ENC005805 | ![]() |
0.361 | D05XQE | ![]() |
0.182 | ||
| ENC001868 | ![]() |
0.361 | D0U5CE | ![]() |
0.180 | ||
| ENC001869 | ![]() |
0.361 | D03LGG | ![]() |
0.180 | ||
| ENC000804 | ![]() |
0.338 | D06GIP | ![]() |
0.177 | ||
| ENC000796 | ![]() |
0.328 | D0S7WX | ![]() |
0.174 | ||
| ENC001738 | ![]() |
0.313 | D00FSV | ![]() |
0.174 | ||
| ENC002844 | ![]() |
0.308 | D06LYG | ![]() |
0.173 | ||