|
Name |
Xanthorrhizol
|
| Molecular Formula | C15H22O | |
| IUPAC Name* |
2-methyl-5-[(2R)-6-methylhept-5-en-2-yl]phenol
|
|
| SMILES |
CC1=C(C=C(C=C1)[C@H](C)CCC=C(C)C)O
|
|
| InChI |
InChI=1S/C15H22O/c1-11(2)6-5-7-12(3)14-9-8-13(4)15(16)10-14/h6,8-10,12,16H,5,7H2,1-4H3/t12-/m1/s1
|
|
| InChIKey |
FKWGCEDRLNNZOZ-GFCCVEGCSA-N
|
|
| Synonyms |
Xanthorrhizol; 30199-26-9; Xanthorrizol; (R)-5-(1,5-Dimethyl-4-hexenyl)-o-cresol; 2-methyl-5-[(2r)-6-methylhept-5-en-2-yl]phenol; 1,3,5,10-Bisabolatetraen-2-ol; Phenol, 5-[(1R)-1,5-dimethyl-4-hexenyl]-2-methyl-; Phenol, 5-[(1R)-1,5-dimethyl-4-hexen-1-yl]-2-methyl-; (-)-5-(1,5-Dimethyl-4-hexenyl)-2-methylphenol; (R)-5-(1-5-Dimethyl-4-hexenyl)-2-methylphenol; (R)-(-)-Xanthorrhizol; o-Cresol, 5-(1,5-dimethyl-4-hexenyl)-, (-)-; EINECS 250-090-2; Phenol, 5-(1,5-dimethyl-4-hexenyl)-2-methyl-, (R)-; (-)-Xanthorrizol; (-)-Xanthorrhizol; (R)-(-)-Xanthorrizol; CHEMBL460033; Phenol, 5-(1,5-dimethyl-4-hexenyl)-2-methyl-, (-)-; SCHEMBL14879579; DTXSID20184290; CHEBI:184290; ZINC2507487; BDBM50548726; HB4127; MFCD03453037; SMP1_000318; HY-112657; CS-0059020; 5-(1,5-Dimethyl-4-hexenyl)-2-methylphenol #; EN300-6736093; (R)-2-Methyl-5-(6-methylhept-5-en-2-yl)phenol; 5-[(1R)-1,5-dimethylhex-4-enyl]-2-methyl-phenol; 5-[(1R)-1,5-dimethyl-4-hexen-1-yl]-2-methylphenol; Z1513804374; Phenol,5-[(1R)-1,5-dimethyl-4-hexen-1-yl]-2-methyl-
|
|
| CAS | 30199-26-9 | |
| PubChem CID | 93135 | |
| ChEMBL ID | CHEMBL460033 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 218.33 | ALogp: | 5.1 |
| HBD: | 1 | HBA: | 1 |
| Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 20.2 | Aromatic Rings: | 1 |
| Heavy Atoms: | 16 | QED Weighted: | 0.703 |
| Caco-2 Permeability: | -4.591 | MDCK Permeability: | 0.00001550 |
| Pgp-inhibitor: | 0.646 | Pgp-substrate: | 0.003 |
| Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.976 |
| 30% Bioavailability (F30%): | 0.964 |
| Blood-Brain-Barrier Penetration (BBB): | 0.373 | Plasma Protein Binding (PPB): | 98.89% |
| Volume Distribution (VD): | 6.396 | Fu: | 3.40% |
| CYP1A2-inhibitor: | 0.965 | CYP1A2-substrate: | 0.874 |
| CYP2C19-inhibitor: | 0.904 | CYP2C19-substrate: | 0.616 |
| CYP2C9-inhibitor: | 0.775 | CYP2C9-substrate: | 0.939 |
| CYP2D6-inhibitor: | 0.859 | CYP2D6-substrate: | 0.835 |
| CYP3A4-inhibitor: | 0.633 | CYP3A4-substrate: | 0.382 |
| Clearance (CL): | 13.225 | Half-life (T1/2): | 0.246 |
| hERG Blockers: | 0.022 | Human Hepatotoxicity (H-HT): | 0.592 |
| Drug-inuced Liver Injury (DILI): | 0.053 | AMES Toxicity: | 0.014 |
| Rat Oral Acute Toxicity: | 0.026 | Maximum Recommended Daily Dose: | 0.755 |
| Skin Sensitization: | 0.661 | Carcinogencity: | 0.088 |
| Eye Corrosion: | 0.452 | Eye Irritation: | 0.987 |
| Respiratory Toxicity: | 0.346 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC000796 | ![]() |
0.615 | D0M1PQ | ![]() |
0.380 | ||
| ENC000347 | ![]() |
0.532 | D06GIP | ![]() |
0.333 | ||
| ENC002218 | ![]() |
0.448 | D0I8FI | ![]() |
0.317 | ||
| ENC002786 | ![]() |
0.413 | D08HUC | ![]() |
0.313 | ||
| ENC004988 | ![]() |
0.373 | D04PHC | ![]() |
0.300 | ||
| ENC004349 | ![]() |
0.365 | D0W6DG | ![]() |
0.295 | ||
| ENC004196 | ![]() |
0.362 | D0K5CB | ![]() |
0.294 | ||
| ENC004195 | ![]() |
0.362 | D02ZJI | ![]() |
0.294 | ||
| ENC001090 | ![]() |
0.361 | D07MOX | ![]() |
0.293 | ||
| ENC004987 | ![]() |
0.361 | D0K4MH | ![]() |
0.284 | ||