![]() |
Name |
methyl 2-methylbutanoate
|
Molecular Formula | C12H24O4 | |
IUPAC Name* |
methyl 2-methylbutanoate
|
|
SMILES |
CCC(C)C(=O)OC.CCC(C)C(=O)OC
|
|
InChI |
InChI=1S/2C6H12O2/c2*1-4-5(2)6(7)8-3/h2*5H,4H2,1-3H3
|
|
InChIKey |
HXLAMQFYJNPENB-UHFFFAOYSA-N
|
|
Synonyms |
SCHEMBL1869834
|
|
CAS | NA | |
PubChem CID | 87304257 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 232.32 | ALogp: | 2.4 |
HBD: | 0 | HBA: | 4 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 52.6 | Aromatic Rings: | 0 |
Heavy Atoms: | 16 | QED Weighted: | 0.698 |
Caco-2 Permeability: | -4.227 | MDCK Permeability: | 0.00002740 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.036 |
30% Bioavailability (F30%): | 0.73 |
Blood-Brain-Barrier Penetration (BBB): | 0.993 | Plasma Protein Binding (PPB): | 17.84% |
Volume Distribution (VD): | 1.047 | Fu: | 83.60% |
CYP1A2-inhibitor: | 0.722 | CYP1A2-substrate: | 0.826 |
CYP2C19-inhibitor: | 0.192 | CYP2C19-substrate: | 0.875 |
CYP2C9-inhibitor: | 0.023 | CYP2C9-substrate: | 0.223 |
CYP2D6-inhibitor: | 0.012 | CYP2D6-substrate: | 0.439 |
CYP3A4-inhibitor: | 0.021 | CYP3A4-substrate: | 0.374 |
Clearance (CL): | 9.106 | Half-life (T1/2): | 0.779 |
hERG Blockers: | 0.014 | Human Hepatotoxicity (H-HT): | 0.092 |
Drug-inuced Liver Injury (DILI): | 0.153 | AMES Toxicity: | 0.014 |
Rat Oral Acute Toxicity: | 0.054 | Maximum Recommended Daily Dose: | 0.024 |
Skin Sensitization: | 0.353 | Carcinogencity: | 0.058 |
Eye Corrosion: | 0.934 | Eye Irritation: | 0.984 |
Respiratory Toxicity: | 0.414 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000780 | ![]() |
0.477 | D0K3LW | ![]() |
0.286 | ||
ENC001288 | ![]() |
0.388 | D0A7MY | ![]() |
0.269 | ||
ENC000771 | ![]() |
0.348 | D0U9QU | ![]() |
0.266 | ||
ENC004963 | ![]() |
0.333 | D02KBD | ![]() |
0.266 | ||
ENC000819 | ![]() |
0.333 | D05PLH | ![]() |
0.261 | ||
ENC000833 | ![]() |
0.327 | D0ZK8H | ![]() |
0.250 | ||
ENC000382 | ![]() |
0.326 | D0I5HV | ![]() |
0.247 | ||
ENC004217 | ![]() |
0.326 | D0O5NK | ![]() |
0.238 | ||
ENC004961 | ![]() |
0.323 | D0X4FM | ![]() |
0.223 | ||
ENC000234 | ![]() |
0.320 | D0OL6O | ![]() |
0.222 |