|
Name |
8,12-Dihydroxy-2,6,6',6',9,13-hexamethyl-16-methylidenespiro[10,14-dioxatetracyclo[7.6.1.01,12.02,7]hexadec-6-ene-5,5'-pyran]-2',11,15-trione
|
| Molecular Formula | C25H30O8 | |
| IUPAC Name* |
8,12-dihydroxy-2,6,6',6',9,13-hexamethyl-16-methylidenespiro[10,14-dioxatetracyclo[7.6.1.01,12.02,7]hexadec-6-ene-5,5'-pyran]-2',11,15-trione
|
|
| SMILES |
CC1C2(C(=O)OC3(C(C4=C(C5(CCC4(C2(C3=C)C(=O)O1)C)C=CC(=O)OC5(C)C)C)O)C)O
|
|
| InChI |
InChI=1S/C25H30O8/c1-12-16-17(27)22(7)13(2)24(18(28)31-14(3)25(24,30)19(29)33-22)21(16,6)10-11-23(12)9-8-15(26)32-20(23,4)5/h8-9,14,17,27,30H,2,10-11H2,1,3-7H3
|
|
| InChIKey |
DNKFADXVMUNRRM-UHFFFAOYSA-N
|
|
| Synonyms |
Austinol
|
|
| CAS | 72040-27-8 | |
| PubChem CID | 73745644 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 458.5 | ALogp: | 0.8 |
| HBD: | 2 | HBA: | 8 |
| Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 119.0 | Aromatic Rings: | 5 |
| Heavy Atoms: | 33 | QED Weighted: | 0.323 |
| Caco-2 Permeability: | -5.364 | MDCK Permeability: | 0.00003080 |
| Pgp-inhibitor: | 0.296 | Pgp-substrate: | 0.037 |
| Human Intestinal Absorption (HIA): | 0.696 | 20% Bioavailability (F20%): | 0.985 |
| 30% Bioavailability (F30%): | 0.717 |
| Blood-Brain-Barrier Penetration (BBB): | 0.559 | Plasma Protein Binding (PPB): | 77.96% |
| Volume Distribution (VD): | 1.541 | Fu: | 22.59% |
| CYP1A2-inhibitor: | 0.004 | CYP1A2-substrate: | 0.962 |
| CYP2C19-inhibitor: | 0.055 | CYP2C19-substrate: | 0.831 |
| CYP2C9-inhibitor: | 0.052 | CYP2C9-substrate: | 0.041 |
| CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.038 |
| CYP3A4-inhibitor: | 0.47 | CYP3A4-substrate: | 0.92 |
| Clearance (CL): | 2.719 | Half-life (T1/2): | 0.014 |
| hERG Blockers: | 0.002 | Human Hepatotoxicity (H-HT): | 0.35 |
| Drug-inuced Liver Injury (DILI): | 0.652 | AMES Toxicity: | 0.876 |
| Rat Oral Acute Toxicity: | 0.308 | Maximum Recommended Daily Dose: | 0.513 |
| Skin Sensitization: | 0.008 | Carcinogencity: | 0.937 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.047 |
| Respiratory Toxicity: | 0.932 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002577 | ![]() |
0.802 | D0K7LU | ![]() |
0.248 | ||
| ENC005317 | ![]() |
0.690 | D0P0HT | ![]() |
0.223 | ||
| ENC005189 | ![]() |
0.690 | D0KR9U | ![]() |
0.223 | ||
| ENC005318 | ![]() |
0.689 | D0G6AB | ![]() |
0.221 | ||
| ENC005188 | ![]() |
0.689 | D02QJH | ![]() |
0.218 | ||
| ENC002849 | ![]() |
0.606 | D02JNM | ![]() |
0.216 | ||
| ENC003309 | ![]() |
0.551 | D03ZZK | ![]() |
0.215 | ||
| ENC005315 | ![]() |
0.516 | D0I5DS | ![]() |
0.212 | ||
| ENC003179 | ![]() |
0.462 | D0F7NQ | ![]() |
0.209 | ||
| ENC003159 | ![]() |
0.462 | D0N0RU | ![]() |
0.208 | ||