![]() |
Name |
(14beta,22e)-9,14-Dihydroxyergosta-4,7,22-triene-3,6-dione
|
Molecular Formula | C28H40O4 | |
IUPAC Name* |
(9S,10S,13R,14R,17R)-17-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-9,14-dihydroxy-10,13-dimethyl-2,11,12,15,16,17-hexahydro-1H-cyclopenta[a]phenanthrene-3,6-dione
|
|
SMILES |
C[C@H](/C=C/[C@H](C)C(C)C)[C@H]1CC[C@]2([C@@]1(CC[C@]3(C2=CC(=O)C4=CC(=O)CC[C@@]43C)O)C)O
|
|
InChI |
InChI=1S/C28H40O4/c1-17(2)18(3)7-8-19(4)21-10-12-27(31)24-16-23(30)22-15-20(29)9-11-25(22,5)28(24,32)14-13-26(21,27)6/h7-8,15-19,21,31-32H,9-14H2,1-6H3/b8-7+/t18-,19+,21+,25-,26+,27-,28+/m0/s1
|
|
InChIKey |
PPPHAARYIMWGSU-KNUUDLMWSA-N
|
|
Synonyms |
(14beta,22e)-9,14-dihydroxyergosta-4,7,22-triene-3,6-dione
|
|
CAS | NA | |
PubChem CID | 73427209 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 440.6 | ALogp: | 3.6 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 74.6 | Aromatic Rings: | 4 |
Heavy Atoms: | 32 | QED Weighted: | 0.581 |
Caco-2 Permeability: | -4.865 | MDCK Permeability: | 0.00002120 |
Pgp-inhibitor: | 0.976 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.01 | 20% Bioavailability (F20%): | 0.131 |
30% Bioavailability (F30%): | 0.056 |
Blood-Brain-Barrier Penetration (BBB): | 0.131 | Plasma Protein Binding (PPB): | 89.78% |
Volume Distribution (VD): | 1.067 | Fu: | 2.57% |
CYP1A2-inhibitor: | 0.046 | CYP1A2-substrate: | 0.952 |
CYP2C19-inhibitor: | 0.335 | CYP2C19-substrate: | 0.859 |
CYP2C9-inhibitor: | 0.306 | CYP2C9-substrate: | 0.037 |
CYP2D6-inhibitor: | 0.014 | CYP2D6-substrate: | 0.028 |
CYP3A4-inhibitor: | 0.787 | CYP3A4-substrate: | 0.958 |
Clearance (CL): | 1.643 | Half-life (T1/2): | 0.146 |
hERG Blockers: | 0.026 | Human Hepatotoxicity (H-HT): | 0.608 |
Drug-inuced Liver Injury (DILI): | 0.062 | AMES Toxicity: | 0.028 |
Rat Oral Acute Toxicity: | 0.681 | Maximum Recommended Daily Dose: | 0.943 |
Skin Sensitization: | 0.63 | Carcinogencity: | 0.658 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.016 |
Respiratory Toxicity: | 0.971 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002188 | ![]() |
1.000 | D0G5CF | ![]() |
0.333 | ||
ENC004905 | ![]() |
0.700 | D0G8OC | ![]() |
0.328 | ||
ENC001990 | ![]() |
0.650 | D06JPB | ![]() |
0.328 | ||
ENC002984 | ![]() |
0.570 | D04GJN | ![]() |
0.328 | ||
ENC002480 | ![]() |
0.532 | D0L2LS | ![]() |
0.302 | ||
ENC004615 | ![]() |
0.527 | D0I2SD | ![]() |
0.283 | ||
ENC003120 | ![]() |
0.487 | D0R7JT | ![]() |
0.282 | ||
ENC004906 | ![]() |
0.487 | D0Z1XD | ![]() |
0.278 | ||
ENC006035 | ![]() |
0.483 | D0IX6I | ![]() |
0.276 | ||
ENC005610 | ![]() |
0.483 | D0G8BV | ![]() |
0.271 |