![]() |
Name |
Ophiobolin T
|
Molecular Formula | C25H34O3 | |
IUPAC Name* |
(1R,3S,7R,8E,11S,12S)-12-[(1R)-1-(5,5-dimethyl-2H-furan-2-yl)ethyl]-1,4-dimethyl-6-oxotricyclo[9.3.0.03,7]tetradeca-4,8-diene-8-carbaldehyde
|
|
SMILES |
CC1=CC(=O)[C@@H]/2[C@@H]1C[C@]3(CC[C@@H]([C@@H]3C/C=C2/C=O)[C@@H](C)C4C=CC(O4)(C)C)C
|
|
InChI |
InChI=1S/C25H34O3/c1-15-12-21(27)23-17(14-26)6-7-20-18(8-11-25(20,5)13-19(15)23)16(2)22-9-10-24(3,4)28-22/h6,9-10,12,14,16,18-20,22-23H,7-8,11,13H2,1-5H3/b17-6-/t16-,18-,19-,20+,22?,23+,25-/m1/s1
|
|
InChIKey |
MVOQGQWZPKEXTB-YGMUAOAQSA-N
|
|
Synonyms |
Ophiobolin T
|
|
CAS | NA | |
PubChem CID | 73386897 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 382.5 | ALogp: | 4.4 |
HBD: | 0 | HBA: | 3 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 43.4 | Aromatic Rings: | 4 |
Heavy Atoms: | 28 | QED Weighted: | 0.485 |
Caco-2 Permeability: | -4.72 | MDCK Permeability: | 0.00003390 |
Pgp-inhibitor: | 0.928 | Pgp-substrate: | 0.077 |
Human Intestinal Absorption (HIA): | 0.576 | 20% Bioavailability (F20%): | 0.436 |
30% Bioavailability (F30%): | 0.004 |
Blood-Brain-Barrier Penetration (BBB): | 0.459 | Plasma Protein Binding (PPB): | 93.50% |
Volume Distribution (VD): | 2.362 | Fu: | 2.98% |
CYP1A2-inhibitor: | 0.028 | CYP1A2-substrate: | 0.574 |
CYP2C19-inhibitor: | 0.522 | CYP2C19-substrate: | 0.9 |
CYP2C9-inhibitor: | 0.359 | CYP2C9-substrate: | 0.289 |
CYP2D6-inhibitor: | 0.008 | CYP2D6-substrate: | 0.405 |
CYP3A4-inhibitor: | 0.9 | CYP3A4-substrate: | 0.664 |
Clearance (CL): | 3.263 | Half-life (T1/2): | 0.138 |
hERG Blockers: | 0.007 | Human Hepatotoxicity (H-HT): | 0.048 |
Drug-inuced Liver Injury (DILI): | 0.231 | AMES Toxicity: | 0.036 |
Rat Oral Acute Toxicity: | 0.15 | Maximum Recommended Daily Dose: | 0.542 |
Skin Sensitization: | 0.748 | Carcinogencity: | 0.784 |
Eye Corrosion: | 0.554 | Eye Irritation: | 0.04 |
Respiratory Toxicity: | 0.984 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003251 | ![]() |
0.606 | D0D2TN | ![]() |
0.271 | ||
ENC002981 | ![]() |
0.582 | D02JNM | ![]() |
0.262 | ||
ENC003777 | ![]() |
0.564 | D06AEO | ![]() |
0.254 | ||
ENC005803 | ![]() |
0.480 | D0C7JF | ![]() |
0.252 | ||
ENC005044 | ![]() |
0.471 | D0P0HT | ![]() |
0.252 | ||
ENC005045 | ![]() |
0.458 | D09WYX | ![]() |
0.250 | ||
ENC002000 | ![]() |
0.430 | D08PIQ | ![]() |
0.250 | ||
ENC003783 | ![]() |
0.430 | D0F1UL | ![]() |
0.248 | ||
ENC003687 | ![]() |
0.404 | D0D2VS | ![]() |
0.243 | ||
ENC002271 | ![]() |
0.387 | D0CZ1Q | ![]() |
0.240 |