|
Name |
Ophiobolin I
|
| Molecular Formula | C25H36O3 | |
| IUPAC Name* |
(1'R,2S,3S,3'S,5R,7'R,8'E,11'R)-8'-(hydroxymethyl)-1',3,4'-trimethyl-5-(2-methylprop-1-enyl)spiro[oxolane-2,12'-tricyclo[9.3.0.03,7]tetradeca-4,8-diene]-6'-one
|
|
| SMILES |
C[C@H]1C[C@@H](O[C@@]12CC[C@]3([C@H]2C/C=C(\[C@H]4[C@H](C3)C(=CC4=O)C)/CO)C)C=C(C)C
|
|
| InChI |
InChI=1S/C25H36O3/c1-15(2)10-19-12-17(4)25(28-19)9-8-24(5)13-20-16(3)11-21(27)23(20)18(14-26)6-7-22(24)25/h6,10-11,17,19-20,22-23,26H,7-9,12-14H2,1-5H3/b18-6-/t17-,19-,20+,22+,23-,24+,25-/m0/s1
|
|
| InChIKey |
PWHAYWTWJLFKJT-MUKMEUIDSA-N
|
|
| Synonyms |
Ophiobolin I; 110013-85-9; CHEMBL469706
|
|
| CAS | NA | |
| PubChem CID | 14035917 | |
| ChEMBL ID | CHEMBL469706 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 384.6 | ALogp: | 3.9 |
| HBD: | 1 | HBA: | 3 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 46.5 | Aromatic Rings: | 4 |
| Heavy Atoms: | 28 | QED Weighted: | 0.653 |
| Caco-2 Permeability: | -4.75 | MDCK Permeability: | 0.00001920 |
| Pgp-inhibitor: | 0.973 | Pgp-substrate: | 0.011 |
| Human Intestinal Absorption (HIA): | 0.034 | 20% Bioavailability (F20%): | 0.787 |
| 30% Bioavailability (F30%): | 0.874 |
| Blood-Brain-Barrier Penetration (BBB): | 0.979 | Plasma Protein Binding (PPB): | 79.51% |
| Volume Distribution (VD): | 2.169 | Fu: | 6.64% |
| CYP1A2-inhibitor: | 0.024 | CYP1A2-substrate: | 0.572 |
| CYP2C19-inhibitor: | 0.073 | CYP2C19-substrate: | 0.807 |
| CYP2C9-inhibitor: | 0.064 | CYP2C9-substrate: | 0.054 |
| CYP2D6-inhibitor: | 0.02 | CYP2D6-substrate: | 0.143 |
| CYP3A4-inhibitor: | 0.927 | CYP3A4-substrate: | 0.535 |
| Clearance (CL): | 14.925 | Half-life (T1/2): | 0.082 |
| hERG Blockers: | 0.021 | Human Hepatotoxicity (H-HT): | 0.927 |
| Drug-inuced Liver Injury (DILI): | 0.276 | AMES Toxicity: | 0.029 |
| Rat Oral Acute Toxicity: | 0.367 | Maximum Recommended Daily Dose: | 0.827 |
| Skin Sensitization: | 0.821 | Carcinogencity: | 0.122 |
| Eye Corrosion: | 0.101 | Eye Irritation: | 0.112 |
| Respiratory Toxicity: | 0.967 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004222 | ![]() |
0.847 | D0E9KA | ![]() |
0.282 | ||
| ENC001559 | ![]() |
0.576 | D06AEO | ![]() |
0.276 | ||
| ENC003209 | ![]() |
0.554 | D04SFH | ![]() |
0.261 | ||
| ENC005803 | ![]() |
0.525 | D0D2TN | ![]() |
0.261 | ||
| ENC005044 | ![]() |
0.457 | D0V2JK | ![]() |
0.258 | ||
| ENC005045 | ![]() |
0.444 | D08PIQ | ![]() |
0.250 | ||
| ENC005046 | ![]() |
0.417 | D0I2SD | ![]() |
0.250 | ||
| ENC003251 | ![]() |
0.398 | D04GJN | ![]() |
0.250 | ||
| ENC002982 | ![]() |
0.387 | D0W2EK | ![]() |
0.248 | ||
| ENC002981 | ![]() |
0.348 | D0Y2YP | ![]() |
0.248 | ||