![]() |
Name |
Salimyxin B
|
Molecular Formula | C21H32O4 | |
IUPAC Name* |
(3aS,5aR,6R,8aR)-3a-hydroxy-6-[(E,2R,5S)-6-hydroxy-5,6-dimethylhept-3-en-2-yl]-5a-methyl-4,5,6,7,8,8a-hexahydrocyclopenta[e][1]benzofuran-2-one
|
|
SMILES |
C[C@H](/C=C/[C@H](C)C(C)(C)O)[C@H]1CC[C@@H]2[C@@]1(CC[C@]3(C2=CC(=O)O3)O)C
|
|
InChI |
InChI=1S/C21H32O4/c1-13(6-7-14(2)19(3,4)23)15-8-9-16-17-12-18(22)25-21(17,24)11-10-20(15,16)5/h6-7,12-16,23-24H,8-11H2,1-5H3/b7-6+/t13-,14+,15-,16+,20-,21+/m1/s1
|
|
InChIKey |
SHUNDKCHHXBLQQ-FVAQLPKLSA-N
|
|
Synonyms |
Salimyxin B
|
|
CAS | NA | |
PubChem CID | 72163794 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 348.5 | ALogp: | 3.2 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 66.8 | Aromatic Rings: | 3 |
Heavy Atoms: | 25 | QED Weighted: | 0.587 |
Caco-2 Permeability: | -4.637 | MDCK Permeability: | 0.00003810 |
Pgp-inhibitor: | 0.004 | Pgp-substrate: | 0.011 |
Human Intestinal Absorption (HIA): | 0.029 | 20% Bioavailability (F20%): | 0.01 |
30% Bioavailability (F30%): | 0.722 |
Blood-Brain-Barrier Penetration (BBB): | 0.34 | Plasma Protein Binding (PPB): | 81.03% |
Volume Distribution (VD): | 0.905 | Fu: | 2.30% |
CYP1A2-inhibitor: | 0.021 | CYP1A2-substrate: | 0.255 |
CYP2C19-inhibitor: | 0.041 | CYP2C19-substrate: | 0.824 |
CYP2C9-inhibitor: | 0.065 | CYP2C9-substrate: | 0.114 |
CYP2D6-inhibitor: | 0.005 | CYP2D6-substrate: | 0.09 |
CYP3A4-inhibitor: | 0.437 | CYP3A4-substrate: | 0.839 |
Clearance (CL): | 4.513 | Half-life (T1/2): | 0.158 |
hERG Blockers: | 0.011 | Human Hepatotoxicity (H-HT): | 0.189 |
Drug-inuced Liver Injury (DILI): | 0.371 | AMES Toxicity: | 0.07 |
Rat Oral Acute Toxicity: | 0.772 | Maximum Recommended Daily Dose: | 0.97 |
Skin Sensitization: | 0.442 | Carcinogencity: | 0.166 |
Eye Corrosion: | 0.023 | Eye Irritation: | 0.311 |
Respiratory Toxicity: | 0.926 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004677 | ![]() |
0.760 | D0N1TP | ![]() |
0.461 | ||
ENC002324 | ![]() |
0.760 | D0G5CF | ![]() |
0.342 | ||
ENC006037 | ![]() |
0.688 | D06JPB | ![]() |
0.336 | ||
ENC003739 | ![]() |
0.461 | D0G8OC | ![]() |
0.336 | ||
ENC006035 | ![]() |
0.457 | D02ZGI | ![]() |
0.307 | ||
ENC004864 | ![]() |
0.457 | D01QUS | ![]() |
0.293 | ||
ENC003053 | ![]() |
0.457 | D02VPX | ![]() |
0.289 | ||
ENC005610 | ![]() |
0.457 | D05BTM | ![]() |
0.284 | ||
ENC004366 | ![]() |
0.417 | D0T2PL | ![]() |
0.284 | ||
ENC004906 | ![]() |
0.407 | D07QKN | ![]() |
0.269 |