![]() |
Name |
(2S)-3-{(2R,4Z)-4-[{(1S,2R,4aS,6R,8S,8aR)-2-[(2E)-but-2-en-2-yl]-6,8-dimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl}(hydroxy)methylene]-3,5-dioxopyrrolidin-2-yl}-2-hydroxy-2-methylpropanoic acid
|
Molecular Formula | C25H35NO6 | |
IUPAC Name* |
(2S)-3-[(2R,4Z)-4-[[(1S,2R,4aS,6R,8S,8aR)-2-[(E)-but-2-en-2-yl]-6,8-dimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-hydroxymethylidene]-3,5-dioxopyrrolidin-2-yl]-2-hydroxy-2-methylpropanoic acid
|
|
SMILES |
C/C=C(\C)/[C@@H]1C=C[C@@H]2C[C@@H](C[C@@H]([C@H]2[C@@H]1/C(=C/3\C(=O)[C@H](NC3=O)C[C@@](C)(C(=O)O)O)/O)C)C
|
|
InChI |
InChI=1S/C25H35NO6/c1-6-13(3)16-8-7-15-10-12(2)9-14(4)18(15)19(16)22(28)20-21(27)17(26-23(20)29)11-25(5,32)24(30)31/h6-8,12,14-19,28,32H,9-11H2,1-5H3,(H,26,29)(H,30,31)/b13-6+,22-20-/t12-,14+,15-,16+,17-,18-,19-,25+/m1/s1
|
|
InChIKey |
AVZATKWNGXCSDN-UPZXKQCMSA-N
|
|
Synonyms |
SCH 210971; CHEBI:68748; Q27137161; (2S)-3-[(2R,4Z)-4-[[(1S,2R,4aS,6R,8S,8aR)-6,8-dimethyl-2-[(E)-1-methylprop-1-enyl]-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-hydroxy-methylene]-3,5-dioxo-pyrrolidin-2-yl]-2-hydroxy-2-methyl-propanoic acid; (2S)-3-{(2R,4Z)-4-[{(1S,2R,4aS,6R,8S,8aR)-2-[(2E)-but-2-en-2-yl]-6,8-dimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl}(hydroxy)methylene]-3,5-dioxopyrrolidin-2-yl}-2-hydroxy-2-methylpropanoic acid; 2-Pyrrolidinepropanoic acid, .alpha.-hydroxy-4-[hydroxy[(1S,2R,4aS,6R,8S,8aR)-1,2,4a,5,6,7,8,8a-octahydro-6,8-dimethyl-2-[(1E)-1-methyl-1-propenyl]-1-naphthalenyl]methylene]-.alpha.-methyl-3,5-dioxo-, (.alpha.S,2R,4Z)-
|
|
CAS | NA | |
PubChem CID | 54711812 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 445.5 | ALogp: | 4.5 |
HBD: | 4 | HBA: | 6 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 124.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 32 | QED Weighted: | 0.22 |
Caco-2 Permeability: | -5.66 | MDCK Permeability: | 0.00001440 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.745 |
Human Intestinal Absorption (HIA): | 0.025 | 20% Bioavailability (F20%): | 0.009 |
30% Bioavailability (F30%): | 0.004 |
Blood-Brain-Barrier Penetration (BBB): | 0.255 | Plasma Protein Binding (PPB): | 97.51% |
Volume Distribution (VD): | 1.025 | Fu: | 3.23% |
CYP1A2-inhibitor: | 0.108 | CYP1A2-substrate: | 0.197 |
CYP2C19-inhibitor: | 0.039 | CYP2C19-substrate: | 0.083 |
CYP2C9-inhibitor: | 0.476 | CYP2C9-substrate: | 0.867 |
CYP2D6-inhibitor: | 0.062 | CYP2D6-substrate: | 0.103 |
CYP3A4-inhibitor: | 0.609 | CYP3A4-substrate: | 0.259 |
Clearance (CL): | 1.086 | Half-life (T1/2): | 0.308 |
hERG Blockers: | 0.005 | Human Hepatotoxicity (H-HT): | 0.078 |
Drug-inuced Liver Injury (DILI): | 0.974 | AMES Toxicity: | 0.001 |
Rat Oral Acute Toxicity: | 0.414 | Maximum Recommended Daily Dose: | 0.061 |
Skin Sensitization: | 0.103 | Carcinogencity: | 0.087 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.014 |
Respiratory Toxicity: | 0.854 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003491 | ![]() |
0.357 | D0E9KA | ![]() |
0.246 | ||
ENC003630 | ![]() |
0.323 | D0H0ND | ![]() |
0.237 | ||
ENC002820 | ![]() |
0.313 | D0W2EK | ![]() |
0.226 | ||
ENC004028 | ![]() |
0.306 | D06WTZ | ![]() |
0.213 | ||
ENC003021 | ![]() |
0.301 | D0O5FY | ![]() |
0.213 | ||
ENC006079 | ![]() |
0.297 | D0F7NQ | ![]() |
0.212 | ||
ENC003745 | ![]() |
0.295 | D0Q1MS | ![]() |
0.207 | ||
ENC003166 | ![]() |
0.289 | D0F1EX | ![]() |
0.203 | ||
ENC003119 | ![]() |
0.288 | D00GOS | ![]() |
0.203 | ||
ENC003132 | ![]() |
0.283 | D03IKT | ![]() |
0.203 |