![]() |
Name |
Hymenosetin
|
Molecular Formula | C23H33NO4 | |
IUPAC Name* |
(3E,5S)-3-[[(1S,2R,4aS,6R,8aR)-1,3,6-trimethyl-2-[(E)-prop-1-enyl]-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-hydroxymethylidene]-5-[(1R)-1-hydroxyethyl]pyrrolidine-2,4-dione
|
|
SMILES |
C/C=C/[C@@H]1C(=C[C@@H]2C[C@@H](CC[C@H]2[C@]1(C)/C(=C\3/C(=O)[C@@H](NC3=O)[C@@H](C)O)/O)C)C
|
|
InChI |
InChI=1S/C23H33NO4/c1-6-7-16-13(3)11-15-10-12(2)8-9-17(15)23(16,5)21(27)18-20(26)19(14(4)25)24-22(18)28/h6-7,11-12,14-17,19,25,27H,8-10H2,1-5H3,(H,24,28)/b7-6+,21-18+/t12-,14-,15+,16-,17-,19+,23-/m1/s1
|
|
InChIKey |
SAVBYHHROQZLEY-IONFRVELSA-N
|
|
Synonyms |
Hymenosetin
|
|
CAS | NA | |
PubChem CID | 76900285 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 387.5 | ALogp: | 4.3 |
HBD: | 3 | HBA: | 4 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 86.6 | Aromatic Rings: | 3 |
Heavy Atoms: | 28 | QED Weighted: | 0.293 |
Caco-2 Permeability: | -5.03 | MDCK Permeability: | 0.00000782 |
Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.788 |
Human Intestinal Absorption (HIA): | 0.06 | 20% Bioavailability (F20%): | 0.472 |
30% Bioavailability (F30%): | 0.016 |
Blood-Brain-Barrier Penetration (BBB): | 0.018 | Plasma Protein Binding (PPB): | 98.32% |
Volume Distribution (VD): | 1.446 | Fu: | 4.03% |
CYP1A2-inhibitor: | 0.649 | CYP1A2-substrate: | 0.789 |
CYP2C19-inhibitor: | 0.352 | CYP2C19-substrate: | 0.371 |
CYP2C9-inhibitor: | 0.882 | CYP2C9-substrate: | 0.913 |
CYP2D6-inhibitor: | 0.829 | CYP2D6-substrate: | 0.168 |
CYP3A4-inhibitor: | 0.778 | CYP3A4-substrate: | 0.292 |
Clearance (CL): | 1.911 | Half-life (T1/2): | 0.508 |
hERG Blockers: | 0.01 | Human Hepatotoxicity (H-HT): | 0.718 |
Drug-inuced Liver Injury (DILI): | 0.933 | AMES Toxicity: | 0.005 |
Rat Oral Acute Toxicity: | 0.624 | Maximum Recommended Daily Dose: | 0.321 |
Skin Sensitization: | 0.12 | Carcinogencity: | 0.012 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.013 |
Respiratory Toxicity: | 0.946 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003745 | ![]() |
0.769 | D0W2EK | ![]() |
0.252 | ||
ENC003689 | ![]() |
0.747 | D0E9KA | ![]() |
0.246 | ||
ENC003630 | ![]() |
0.674 | D04SFH | ![]() |
0.243 | ||
ENC002818 | ![]() |
0.608 | D0O5FY | ![]() |
0.241 | ||
ENC005182 | ![]() |
0.561 | D06AEO | ![]() |
0.227 | ||
ENC005181 | ![]() |
0.561 | D04CSZ | ![]() |
0.224 | ||
ENC004028 | ![]() |
0.495 | D0D2TN | ![]() |
0.223 | ||
ENC003491 | ![]() |
0.490 | D0I5DS | ![]() |
0.223 | ||
ENC003602 | ![]() |
0.445 | D04GJN | ![]() |
0.222 | ||
ENC005774 | ![]() |
0.436 | D0I2SD | ![]() |
0.222 |