|
Name |
Ilicicolin H
|
| Molecular Formula | C27H31NO4 | |
| IUPAC Name* |
3-[(1R,2S,4aS,7S,8aR)-4,7-dimethyl-1-[(E)-prop-1-enyl]-1,2,4a,5,6,7,8,8a-octahydronaphthalene-2-carbonyl]-4-hydroxy-5-(4-hydroxyphenyl)-1H-pyridin-2-one
|
|
| SMILES |
C/C=C/[C@@H]1[C@H]2C[C@H](CC[C@@H]2C(=C[C@H]1C(=O)C3=C(C(=CNC3=O)C4=CC=C(C=C4)O)O)C)C
|
|
| InChI |
InChI=1S/C27H31NO4/c1-4-5-20-21-12-15(2)6-11-19(21)16(3)13-22(20)25(30)24-26(31)23(14-28-27(24)32)17-7-9-18(29)10-8-17/h4-5,7-10,13-15,19-22,29H,6,11-12H2,1-3H3,(H2,28,31,32)/b5-4+/t15-,19+,20+,21-,22+/m0/s1
|
|
| InChIKey |
BYVVOONSAAQMKI-RFKCMYLBSA-N
|
|
| Synonyms |
Ilicicolin H; Illicicolin H; Ilicicolin-H; 12689-26-8; XG38FSS45W; CHEBI:77772; 2(1H)-Pyridinone, 4-hydroxy-5-(4-hydroxyphenyl)-3-(((1R,2S,4aS,7S,8aR)-1,2,4a,5,6,7,8,8a-octahydro-4,7-dimethyl-1-(1E)-1-propen-1-yl-2-naphthalenyl)carbonyl)-; 3-[(1R,2S,4aS,7S,8aR)-4,7-dimethyl-1-[(E)-prop-1-enyl]-1,2,4a,5,6,7,8,8a-octahydronaphthalene-2-carbonyl]-4-hydroxy-5-(4-hydroxyphenyl)-1H-pyridin-2-one; 4-Hydroxy-5-(4-hydroxyphenyl)-3-(((1R,2S,4aS,7S,8aR)-1,2,4a,5,6,7,8,8a-octahydro-4,7-dimethyl-1-(1E)-1-propen-1-yl-2-naphthalenyl)carbonyl)-2(1H)-pyridinone; UNII-XG38FSS45W; CHEMBL2179949; ACon1_001993; ZINC14515798; BRD-K66794435-001-01-7; BRD-K66794435-001-02-5; Q27147370; 3-({(1R,2S,4aS,7S,8aR)-4,7-dimethyl-1-[(1E)-prop-1-en-1-yl]-1,2,4a,5,6,7,8,8a-octahydronaphthalen-2-yl}carbonyl)-4-hydroxy-5-(4-hydroxyphenyl)pyridin-2(1H)-one; 3-[(1R,2S,4aS,7S,8aR)-4,7-dimethyl-1-[(E)-prop-1-enyl]-1,2,4a,5,6,7,8,8a-octahydronaphthalene-2-carbonyl]-2-hydroxy-5-(4-hydroxyphenyl)-1H-pyridin-4-one
|
|
| CAS | 12689-26-8 | |
| PubChem CID | 54704283 | |
| ChEMBL ID | CHEMBL2179949 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 433.5 | ALogp: | 5.0 |
| HBD: | 3 | HBA: | 4 |
| Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 86.6 | Aromatic Rings: | 4 |
| Heavy Atoms: | 32 | QED Weighted: | 0.428 |
| Caco-2 Permeability: | -4.876 | MDCK Permeability: | 0.00000780 |
| Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.003 |
| Human Intestinal Absorption (HIA): | 0.134 | 20% Bioavailability (F20%): | 0.312 |
| 30% Bioavailability (F30%): | 0.11 |
| Blood-Brain-Barrier Penetration (BBB): | 0.022 | Plasma Protein Binding (PPB): | 99.75% |
| Volume Distribution (VD): | 0.309 | Fu: | 1.34% |
| CYP1A2-inhibitor: | 0.901 | CYP1A2-substrate: | 0.273 |
| CYP2C19-inhibitor: | 0.919 | CYP2C19-substrate: | 0.063 |
| CYP2C9-inhibitor: | 0.922 | CYP2C9-substrate: | 0.973 |
| CYP2D6-inhibitor: | 0.846 | CYP2D6-substrate: | 0.296 |
| CYP3A4-inhibitor: | 0.907 | CYP3A4-substrate: | 0.154 |
| Clearance (CL): | 2.435 | Half-life (T1/2): | 0.174 |
| hERG Blockers: | 0.477 | Human Hepatotoxicity (H-HT): | 0.545 |
| Drug-inuced Liver Injury (DILI): | 0.894 | AMES Toxicity: | 0.124 |
| Rat Oral Acute Toxicity: | 0.77 | Maximum Recommended Daily Dose: | 0.949 |
| Skin Sensitization: | 0.909 | Carcinogencity: | 0.302 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.016 |
| Respiratory Toxicity: | 0.961 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005193 | ![]() |
0.390 | D0VA0I | ![]() |
0.280 | ||
| ENC004959 | ![]() |
0.364 | D0R6BI | ![]() |
0.254 | ||
| ENC003476 | ![]() |
0.326 | D0YX4S | ![]() |
0.254 | ||
| ENC003004 | ![]() |
0.326 | D09ZQN | ![]() |
0.239 | ||
| ENC004958 | ![]() |
0.316 | D01XDL | ![]() |
0.238 | ||
| ENC003021 | ![]() |
0.312 | D0X9ZC | ![]() |
0.236 | ||
| ENC005182 | ![]() |
0.295 | D0Y7PG | ![]() |
0.233 | ||
| ENC005181 | ![]() |
0.295 | D01XWG | ![]() |
0.231 | ||
| ENC004543 | ![]() |
0.293 | D01XBA | ![]() |
0.229 | ||
| ENC005323 | ![]() |
0.292 | D0V4WD | ![]() |
0.228 | ||