|
Name |
(-)-Viriditoxin
|
| Molecular Formula | C34H30O14 | |
| IUPAC Name* |
methyl 2-[(3S)-6-[(3S)-9,10-dihydroxy-7-methoxy-3-(2-methoxy-2-oxoethyl)-1-oxo-3,4-dihydrobenzo[g]isochromen-6-yl]-9,10-dihydroxy-7-methoxy-1-oxo-3,4-dihydrobenzo[g]isochromen-3-yl]acetate
|
|
| SMILES |
COC1=C(C2=C(C(=C1)O)C(=C3C(=C2)C[C@H](OC3=O)CC(=O)OC)O)C4=C(C=C(C5=C4C=C6C[C@H](OC(=O)C6=C5O)CC(=O)OC)O)OC
|
|
| InChI |
InChI=1S/C34H30O14/c1-43-21-11-19(35)27-17(7-13-5-15(9-23(37)45-3)47-33(41)25(13)31(27)39)29(21)30-18-8-14-6-16(10-24(38)46-4)48-34(42)26(14)32(40)28(18)20(36)12-22(30)44-2/h7-8,11-12,15-16,35-36,39-40H,5-6,9-10H2,1-4H3/t15-,16-/m0/s1
|
|
| InChIKey |
GMCZVCXZGZGZPX-HOTGVXAUSA-N
|
|
| Synonyms |
(-)-Viriditoxin; 1381782-08-6; 6TAK972FMC; methyl 2-[(3S)-6-[(3S)-9,10-dihydroxy-7-methoxy-3-(2-methoxy-2-oxoethyl)-1-oxo-3,4-dihydrobenzo[g]isochromen-6-yl]-9,10-dihydroxy-7-methoxy-1-oxo-3,4-dihydrobenzo[g]isochromen-3-yl]acetate; (M)-viriditoxin; (P)-viriditoxin; (?)-Viriditoxin; Viriditoxin (Aspergillus); UNII-6TAK972FMC; VIRIDITOXIN, (-)-; CHEMBL4649449; SCHEMBL23370274; CHEBI:146007; CHEBI:146016; Q27265492; (8,8'-Bi-1H-naphtho(2,3-c)pyran)-3,3'-diacetic acid, 3,3',4,4'-tetrahydro- 9,9',10,10'-tetrahydroxy-7,7'-dimethoxy-1,1'-dioxo-, dimethyl ester; (8,8'-BI-1H-NAPHTHO(2,3-C)PYRAN)-3,3'-DIACETIC ACID, 3,3',4,4'-TETRAHYDRO-9,9',10,10'-TETRAHYDROXY-7,7'-DIMETHOXY-1,1'-DIOXO-, 3,3'-DIMETHYL ESTER, (S,S')-; 3,3',4,4'-Tetrahydro-9,9',10,10'-tetrahydroxy-7,7'-dimethoxy-1,1'-dioxo(8,8'-bi-1H-naphtho(2,3-c)pyran)-3,3'-diacetic acid, dimethyl ester; dimethyl 2,2'-[(3S,3'S,6Ra)-9,9',10,10'-tetrahydroxy-7,7'-dimethoxy-1,1'-dioxo-3,3',4,4'-tetrahydro-1H,1'H-[6,6'-binaphtho[2,3-c]pyran]-3,3'-diyl]diacetate; dimethyl 2,2'-[(3S,3'S,6Sa)-9,9',10,10'-tetrahydroxy-7,7'-dimethoxy-1,1'-dioxo-3,3',4,4'-tetrahydro-1H,1'H-[6,6'-binaphtho[2,3-c]pyran]-3,3'-diyl]diacetate
|
|
| CAS | 35483-50-2 | |
| PubChem CID | 53343291 | |
| ChEMBL ID | CHEMBL4649449 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 662.6 | ALogp: | 5.2 |
| HBD: | 4 | HBA: | 14 |
| Rotatable Bonds: | 9 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 205.0 | Aromatic Rings: | 6 |
| Heavy Atoms: | 48 | QED Weighted: | 0.159 |
| Caco-2 Permeability: | -5.359 | MDCK Permeability: | 0.00003050 |
| Pgp-inhibitor: | 0.457 | Pgp-substrate: | 0.325 |
| Human Intestinal Absorption (HIA): | 0.665 | 20% Bioavailability (F20%): | 0 |
| 30% Bioavailability (F30%): | 0.744 |
| Blood-Brain-Barrier Penetration (BBB): | 0.004 | Plasma Protein Binding (PPB): | 74.64% |
| Volume Distribution (VD): | 0.63 | Fu: | 57.51% |
| CYP1A2-inhibitor: | 0.183 | CYP1A2-substrate: | 0.536 |
| CYP2C19-inhibitor: | 0.075 | CYP2C19-substrate: | 0.056 |
| CYP2C9-inhibitor: | 0.743 | CYP2C9-substrate: | 0.653 |
| CYP2D6-inhibitor: | 0.158 | CYP2D6-substrate: | 0.184 |
| CYP3A4-inhibitor: | 0.107 | CYP3A4-substrate: | 0.085 |
| Clearance (CL): | 8.583 | Half-life (T1/2): | 0.204 |
| hERG Blockers: | 0.002 | Human Hepatotoxicity (H-HT): | 0.529 |
| Drug-inuced Liver Injury (DILI): | 0.985 | AMES Toxicity: | 0.146 |
| Rat Oral Acute Toxicity: | 0.043 | Maximum Recommended Daily Dose: | 0.966 |
| Skin Sensitization: | 0.081 | Carcinogencity: | 0.22 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.096 |
| Respiratory Toxicity: | 0.135 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002635 | ![]() |
0.411 | D06GCK | ![]() |
0.264 | ||
| ENC005171 | ![]() |
0.395 | D09DHY | ![]() |
0.254 | ||
| ENC000970 | ![]() |
0.392 | D0T5XN | ![]() |
0.251 | ||
| ENC005172 | ![]() |
0.380 | D05HSC | ![]() |
0.250 | ||
| ENC002364 | ![]() |
0.377 | D03RTK | ![]() |
0.247 | ||
| ENC000969 | ![]() |
0.376 | D0S9QA | ![]() |
0.246 | ||
| ENC003048 | ![]() |
0.374 | D07IPB | ![]() |
0.244 | ||
| ENC000984 | ![]() |
0.366 | D01XWG | ![]() |
0.243 | ||
| ENC003149 | ![]() |
0.366 | D07VLY | ![]() |
0.240 | ||
| ENC005173 | ![]() |
0.365 | D0C9XJ | ![]() |
0.240 | ||