|
Name |
Fonsecinone C
|
| Molecular Formula | C32H28O11 | |
| IUPAC Name* |
9-(2,5-dihydroxy-6,8-dimethoxy-2-methyl-4-oxo-3H-benzo[g]chromen-10-yl)-5-hydroxy-8,10-dimethoxy-2-methylbenzo[h]chromen-4-one
|
|
| SMILES |
CC1=CC(=O)C2=C(C=C3C=C(C(=C(C3=C2O1)OC)C4=C5C(=C(C6=C4C=C(C=C6OC)OC)O)C(=O)CC(O5)(C)O)OC)O
|
|
| InChI |
InChI=1S/C32H28O11/c1-13-7-17(33)25-18(34)8-14-9-20(39-4)27(29(41-6)22(14)30(25)42-13)24-16-10-15(38-3)11-21(40-5)23(16)28(36)26-19(35)12-32(2,37)43-31(24)26/h7-11,34,36-37H,12H2,1-6H3
|
|
| InChIKey |
XWHLKURAEUPHAB-UHFFFAOYSA-N
|
|
| Synonyms |
Fonsecinone C; AWI83P9U8Z; 95152-77-5; 2,3-Dihydro-2,5-dihydroxy-10-(5-hydroxy-8,10-dimethoxy-2-methyl-4-oxo-4H-naphtho(1,2-b)pyran-9-yl)-6,8-dimethoxy-2-methyl-4H-naphtho(2,3-b)pyran-4-one; 4H-Naphtho(2,3-b)pyran-4-one, 2,3-dihydro-2,5-dihydroxy-10-(5-hydroxy-8,10-dimethoxy-2-methyl-4-oxo-4H-naphtho(1,2-b)pyran-9-yl)-6,8-dimethoxy-2-methyl-; 2,3-Dihydro-2,5-dihydroxy-10-(5-hydroxy-8,10-dimethoxy-2-methyl-4-oxo-4H-naphtho[1,2-b]pyran-9-yl)-6,8-dimethoxy-2-methyl-4H-naphtho[2,3-b]pyran-4-one; UNII-AWI83P9U8Z; CHEBI:133757; Q27896779; 9-(2,5-dihydroxy-6,8-dimethoxy-2-methyl-4-oxo-3,4-dihydro-2H-naphtho[2,3-b]pyran-10-yl)-5-hydroxy-8,10-dimethoxy-2-methyl-4H-naphtho[1,2-b]pyran-4-one; 9-(2,5-dihydroxy-6,8-dimethoxy-2-methyl-4-oxo-3H-benzo[g]chromen-10-yl)-5-hydroxy-8,10-dimethoxy-2-methyl-benzo[h]chromen-4-one
|
|
| CAS | 95152-77-5 | |
| PubChem CID | 90477754 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 588.6 | ALogp: | 5.4 |
| HBD: | 3 | HBA: | 11 |
| Rotatable Bonds: | 5 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 150.0 | Aromatic Rings: | 6 |
| Heavy Atoms: | 43 | QED Weighted: | 0.224 |
| Caco-2 Permeability: | -5.158 | MDCK Permeability: | 0.00002440 |
| Pgp-inhibitor: | 0.976 | Pgp-substrate: | 0.008 |
| Human Intestinal Absorption (HIA): | 0.393 | 20% Bioavailability (F20%): | 0.001 |
| 30% Bioavailability (F30%): | 0.012 |
| Blood-Brain-Barrier Penetration (BBB): | 0.002 | Plasma Protein Binding (PPB): | 67.47% |
| Volume Distribution (VD): | 0.602 | Fu: | 38.70% |
| CYP1A2-inhibitor: | 0.167 | CYP1A2-substrate: | 0.983 |
| CYP2C19-inhibitor: | 0.163 | CYP2C19-substrate: | 0.589 |
| CYP2C9-inhibitor: | 0.543 | CYP2C9-substrate: | 0.897 |
| CYP2D6-inhibitor: | 0.007 | CYP2D6-substrate: | 0.538 |
| CYP3A4-inhibitor: | 0.139 | CYP3A4-substrate: | 0.309 |
| Clearance (CL): | 3.803 | Half-life (T1/2): | 0.137 |
| hERG Blockers: | 0.003 | Human Hepatotoxicity (H-HT): | 0.149 |
| Drug-inuced Liver Injury (DILI): | 0.978 | AMES Toxicity: | 0.166 |
| Rat Oral Acute Toxicity: | 0.135 | Maximum Recommended Daily Dose: | 0.319 |
| Skin Sensitization: | 0.091 | Carcinogencity: | 0.013 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.075 |
| Respiratory Toxicity: | 0.086 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005173 | ![]() |
0.879 | D06GCK | ![]() |
0.355 | ||
| ENC003149 | ![]() |
0.873 | D02LZB | ![]() |
0.287 | ||
| ENC000984 | ![]() |
0.829 | D09DHY | ![]() |
0.286 | ||
| ENC005776 | ![]() |
0.765 | D0G4KG | ![]() |
0.286 | ||
| ENC003508 | ![]() |
0.765 | D0C1SF | ![]() |
0.271 | ||
| ENC002884 | ![]() |
0.752 | D0V8HJ | ![]() |
0.267 | ||
| ENC005172 | ![]() |
0.739 | D0NJ3V | ![]() |
0.260 | ||
| ENC002002 | ![]() |
0.733 | D03RTK | ![]() |
0.257 | ||
| ENC000970 | ![]() |
0.712 | D0D4HN | ![]() |
0.253 | ||
| ENC002364 | ![]() |
0.688 | D0V6OA | ![]() |
0.249 | ||