![]() |
Name |
Alternatiol
|
Molecular Formula | C16H14O8 | |
IUPAC Name* |
methyl (3S,3aR)-3,6-dihydroxy-8-methoxy-3a-methyl-2,5-dioxocyclopenta[c]isochromene-3-carboxylate
|
|
SMILES |
C[C@@]12C(=CC(=O)[C@@]1(C(=O)OC)O)C3=C(C(=CC(=C3)OC)O)C(=O)O2
|
|
InChI |
InChI=1S/C16H14O8/c1-15-9(6-11(18)16(15,21)14(20)23-3)8-4-7(22-2)5-10(17)12(8)13(19)24-15/h4-6,17,21H,1-3H3/t15-,16+/m1/s1
|
|
InChIKey |
JRDAVVGGFQXOJL-CVEARBPZSA-N
|
|
Synonyms |
Alternatiol
|
|
CAS | NA | |
PubChem CID | 146682681 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 334.28 | ALogp: | 0.6 |
HBD: | 2 | HBA: | 8 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 119.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 24 | QED Weighted: | 0.596 |
Caco-2 Permeability: | -5.274 | MDCK Permeability: | 0.00001780 |
Pgp-inhibitor: | 0.426 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.581 | 20% Bioavailability (F20%): | 0.956 |
30% Bioavailability (F30%): | 0.988 |
Blood-Brain-Barrier Penetration (BBB): | 0.382 | Plasma Protein Binding (PPB): | 76.49% |
Volume Distribution (VD): | 1.247 | Fu: | 19.07% |
CYP1A2-inhibitor: | 0.968 | CYP1A2-substrate: | 0.96 |
CYP2C19-inhibitor: | 0.35 | CYP2C19-substrate: | 0.789 |
CYP2C9-inhibitor: | 0.361 | CYP2C9-substrate: | 0.071 |
CYP2D6-inhibitor: | 0.028 | CYP2D6-substrate: | 0.149 |
CYP3A4-inhibitor: | 0.614 | CYP3A4-substrate: | 0.5 |
Clearance (CL): | 5.698 | Half-life (T1/2): | 0.318 |
hERG Blockers: | 0.021 | Human Hepatotoxicity (H-HT): | 0.524 |
Drug-inuced Liver Injury (DILI): | 0.936 | AMES Toxicity: | 0.849 |
Rat Oral Acute Toxicity: | 0.036 | Maximum Recommended Daily Dose: | 0.375 |
Skin Sensitization: | 0.126 | Carcinogencity: | 0.083 |
Eye Corrosion: | 0.008 | Eye Irritation: | 0.067 |
Respiratory Toxicity: | 0.498 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC006072 | ![]() |
0.579 | D0C1SF | ![]() |
0.265 | ||
ENC002171 | ![]() |
0.551 | D06GCK | ![]() |
0.255 | ||
ENC002311 | ![]() |
0.551 | D07MGA | ![]() |
0.250 | ||
ENC002837 | ![]() |
0.518 | D08NQZ | ![]() |
0.244 | ||
ENC003610 | ![]() |
0.518 | D0J2NK | ![]() |
0.240 | ||
ENC004850 | ![]() |
0.518 | D01XWG | ![]() |
0.237 | ||
ENC003974 | ![]() |
0.518 | D0N1FS | ![]() |
0.234 | ||
ENC003805 | ![]() |
0.518 | D0G4KG | ![]() |
0.232 | ||
ENC003686 | ![]() |
0.518 | D09DHY | ![]() |
0.231 | ||
ENC003769 | ![]() |
0.518 | D0B0AX | ![]() |
0.231 |