![]() |
Name |
(1R,2S,12R,15S)-12-(2-hydroxypropan-2-yl)-7-methoxy-10,13,19-triazapentacyclo[11.7.0.03,11.04,9.015,19]icosa-3(11),4(9),5,7-tetraene-1,2-diol
|
Molecular Formula | C21H29N3O4 | |
IUPAC Name* |
(1R,2S,12R,15S)-12-(2-hydroxypropan-2-yl)-7-methoxy-10,13,19-triazapentacyclo[11.7.0.03,11.04,9.015,19]icosa-3(11),4(9),5,7-tetraene-1,2-diol
|
|
SMILES |
CC(C)([C@H]1C2=C([C@@H]([C@]3(N1C[C@@H]4CCCN4C3)O)O)C5=C(N2)C=C(C=C5)OC)O
|
|
InChI |
InChI=1S/C21H29N3O4/c1-20(2,26)18-17-16(14-7-6-13(28-3)9-15(14)22-17)19(25)21(27)11-23-8-4-5-12(23)10-24(18)21/h6-7,9,12,18-19,22,25-27H,4-5,8,10-11H2,1-3H3/t12-,18+,19-,21+/m0/s1
|
|
InChIKey |
RIXDFYAJYWMUMR-SFMXACBGSA-N
|
|
Synonyms |
CHEMBL1090129
|
|
CAS | NA | |
PubChem CID | 46885581 | |
ChEMBL ID | CHEMBL1090129 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 387.5 | ALogp: | 0.4 |
HBD: | 4 | HBA: | 6 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 92.2 | Aromatic Rings: | 5 |
Heavy Atoms: | 28 | QED Weighted: | 0.63 |
Caco-2 Permeability: | -5.309 | MDCK Permeability: | 0.00001030 |
Pgp-inhibitor: | 0.496 | Pgp-substrate: | 0.992 |
Human Intestinal Absorption (HIA): | 0.047 | 20% Bioavailability (F20%): | 0.717 |
30% Bioavailability (F30%): | 0.682 |
Blood-Brain-Barrier Penetration (BBB): | 0.403 | Plasma Protein Binding (PPB): | 49.56% |
Volume Distribution (VD): | 3.031 | Fu: | 50.22% |
CYP1A2-inhibitor: | 0.017 | CYP1A2-substrate: | 0.104 |
CYP2C19-inhibitor: | 0.055 | CYP2C19-substrate: | 0.889 |
CYP2C9-inhibitor: | 0.021 | CYP2C9-substrate: | 0.317 |
CYP2D6-inhibitor: | 0.135 | CYP2D6-substrate: | 0.662 |
CYP3A4-inhibitor: | 0.031 | CYP3A4-substrate: | 0.913 |
Clearance (CL): | 7.201 | Half-life (T1/2): | 0.524 |
hERG Blockers: | 0.534 | Human Hepatotoxicity (H-HT): | 0.915 |
Drug-inuced Liver Injury (DILI): | 0.061 | AMES Toxicity: | 0.131 |
Rat Oral Acute Toxicity: | 0.937 | Maximum Recommended Daily Dose: | 0.993 |
Skin Sensitization: | 0.116 | Carcinogencity: | 0.843 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.009 |
Respiratory Toxicity: | 0.978 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003013 | ![]() |
0.523 | D09OBB | ![]() |
0.283 | ||
ENC003264 | ![]() |
0.464 | D03DDR | ![]() |
0.278 | ||
ENC001958 | ![]() |
0.464 | D0H4JM | ![]() |
0.275 | ||
ENC002846 | ![]() |
0.456 | D0J1ML | ![]() |
0.265 | ||
ENC003265 | ![]() |
0.402 | D0J4JM | ![]() |
0.263 | ||
ENC001060 | ![]() |
0.377 | D05GKD | ![]() |
0.260 | ||
ENC002274 | ![]() |
0.377 | D0P0RX | ![]() |
0.256 | ||
ENC002064 | ![]() |
0.333 | D01JGV | ![]() |
0.254 | ||
ENC001941 | ![]() |
0.319 | D0U7GP | ![]() |
0.254 | ||
ENC000837 | ![]() |
0.318 | D0G8NJ | ![]() |
0.253 |