![]() |
Name |
Trichoderone
|
Molecular Formula | C7H10O3 | |
IUPAC Name* |
(4R,5S)-3-ethyl-4,5-dihydroxycyclopent-2-en-1-one
|
|
SMILES |
CCC1=CC(=O)[C@H]([C@@H]1O)O
|
|
InChI |
InChI=1S/C7H10O3/c1-2-4-3-5(8)7(10)6(4)9/h3,6-7,9-10H,2H2,1H3/t6-,7-/m1/s1
|
|
InChIKey |
XROXABYYTCTJTE-RNFRBKRXSA-N
|
|
Synonyms |
Trichoderone
|
|
CAS | NA | |
PubChem CID | 44820524 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 142.15 | ALogp: | -0.8 |
HBD: | 2 | HBA: | 3 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 57.5 | Aromatic Rings: | 1 |
Heavy Atoms: | 10 | QED Weighted: | 0.544 |
Caco-2 Permeability: | -4.454 | MDCK Permeability: | 0.00004500 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.005 |
Human Intestinal Absorption (HIA): | 0.05 | 20% Bioavailability (F20%): | 0.004 |
30% Bioavailability (F30%): | 0.066 |
Blood-Brain-Barrier Penetration (BBB): | 0.993 | Plasma Protein Binding (PPB): | 26.71% |
Volume Distribution (VD): | 0.284 | Fu: | 58.47% |
CYP1A2-inhibitor: | 0.042 | CYP1A2-substrate: | 0.249 |
CYP2C19-inhibitor: | 0.036 | CYP2C19-substrate: | 0.647 |
CYP2C9-inhibitor: | 0.01 | CYP2C9-substrate: | 0.284 |
CYP2D6-inhibitor: | 0.005 | CYP2D6-substrate: | 0.251 |
CYP3A4-inhibitor: | 0.008 | CYP3A4-substrate: | 0.248 |
Clearance (CL): | 7.272 | Half-life (T1/2): | 0.704 |
hERG Blockers: | 0.013 | Human Hepatotoxicity (H-HT): | 0.061 |
Drug-inuced Liver Injury (DILI): | 0.315 | AMES Toxicity: | 0.216 |
Rat Oral Acute Toxicity: | 0.404 | Maximum Recommended Daily Dose: | 0.034 |
Skin Sensitization: | 0.181 | Carcinogencity: | 0.053 |
Eye Corrosion: | 0.213 | Eye Irritation: | 0.967 |
Respiratory Toxicity: | 0.469 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003001 | ![]() |
1.000 | D03KXY | ![]() |
0.203 | ||
ENC001843 | ![]() |
0.486 | D07XSN | ![]() |
0.200 | ||
ENC003046 | ![]() |
0.302 | D0Y7DP | ![]() |
0.200 | ||
ENC002782 | ![]() |
0.276 | D09FAZ | ![]() |
0.200 | ||
ENC005293 | ![]() |
0.263 | D0CL9S | ![]() |
0.200 | ||
ENC001525 | ![]() |
0.261 | D0X5XU | ![]() |
0.186 | ||
ENC005472 | ![]() |
0.261 | D0R2KF | ![]() |
0.185 | ||
ENC004611 | ![]() |
0.261 | D0TS1Z | ![]() |
0.180 | ||
ENC001986 | ![]() |
0.259 | D0S7DV | ![]() |
0.180 | ||
ENC005552 | ![]() |
0.256 | D09PZO | ![]() |
0.180 |