NPs Basic Information
|
Name |
Epilovastatin
|
| Molecular Formula | C24H36O5 | |
| IUPAC Name* |
[(1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] (2R)-2-methylbutanoate
|
|
| SMILES |
CC[C@@H](C)C(=O)O[C@H]1C[C@H](C=C2[C@H]1[C@H]([C@H](C=C2)C)CC[C@@H]3C[C@H](CC(=O)O3)O)C
|
|
| InChI |
InChI=1S/C24H36O5/c1-5-15(3)24(27)29-21-11-14(2)10-17-7-6-16(4)20(23(17)21)9-8-19-12-18(25)13-22(26)28-19/h6-7,10,14-16,18-21,23,25H,5,8-9,11-13H2,1-4H3/t14-,15+,16-,18+,19+,20-,21-,23-/m0/s1
|
|
| InChIKey |
PCZOHLXUXFIOCF-YPQFMRJXSA-N
|
|
| Synonyms |
Epilovastatin; Epi Lovastatin; 79952-44-6; S9XFL13C1F; [(1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] (2R)-2-methylbutanoate; CHEMBL4088701; (1S,3R,7S,8S,8aR)-8-(2-((2R,4R)-4-Hydroxy-6-oxotetrahydro-2H-pyran-2-yl)ethyl)-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl (2R)-2-methylbutanoate; Butanoic acid, 2-methyl-, (1S,3R,7S,8S,8aR)-1,2,3,7,8,8a-hexahydro-3,7-dimethyl-8-(2-((2R,4R)-tetrahydro-4-hydroxy-6-oxo-2H-pyran-2-yl)ethyl)-1-naphthalenyl ester, (2R)-; Monacolin K; UNII-S9XFL13C1F; Simvastatin specified impurity F [EP]; Simvastatin impurity, epilovastatin- [USP]; Simvastatin EP Impurity F;; DTXSID401317715; ZINC8681779; BDBM50254788; SIMVASTATIN IMPURITY F [EP IMPURITY]; Q27289098; SIMVASTATIN IMPURITY, EPILOVASTATIN- [USP IMPURITY]; (1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-Hydroxy-6-oxotetrahydro-2H-pyran-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl (2R)-2-Methylbutanoate (Epilovastatin)
|
|
| CAS | 79952-44-6 | |
| PubChem CID | 40785065 | |
| ChEMBL ID | CHEMBL4088701 |
*Note: the IUPAC Name was collected from PubChem.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Physi-Chem Properties
| Molecular Weight: | 404.5 | ALogp: | 4.3 |
| HBD: | 1 | HBA: | 5 |
| Rotatable Bonds: | 7 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 72.8 | Aromatic Rings: | 3 |
| Heavy Atoms: | 29 | QED Weighted: | 0.646 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -4.776 | MDCK Permeability: | 0.00004130 |
| Pgp-inhibitor: | 1 | Pgp-substrate: | 0.194 |
| Human Intestinal Absorption (HIA): | 0.02 | 20% Bioavailability (F20%): | 0.999 |
| 30% Bioavailability (F30%): | 0.993 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.167 | Plasma Protein Binding (PPB): | 94.90% |
| Volume Distribution (VD): | 1.449 | Fu: | 2.58% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.067 | CYP1A2-substrate: | 0.048 |
| CYP2C19-inhibitor: | 0.025 | CYP2C19-substrate: | 0.786 |
| CYP2C9-inhibitor: | 0.109 | CYP2C9-substrate: | 0.063 |
| CYP2D6-inhibitor: | 0.004 | CYP2D6-substrate: | 0.045 |
| CYP3A4-inhibitor: | 0.852 | CYP3A4-substrate: | 0.746 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 13.088 | Half-life (T1/2): | 0.548 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0.768 | Human Hepatotoxicity (H-HT): | 0.981 |
| Drug-inuced Liver Injury (DILI): | 0.559 | AMES Toxicity: | 0.025 |
| Rat Oral Acute Toxicity: | 0.107 | Maximum Recommended Daily Dose: | 0.995 |
| Skin Sensitization: | 0.973 | Carcinogencity: | 0.108 |
| Eye Corrosion: | 0.004 | Eye Irritation: | 0.05 |
| Respiratory Toxicity: | 0.95 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
Showing 1 to 10 of 10 entries