![]() |
Name |
Monacolin L
|
Molecular Formula | C19H28O3 | |
IUPAC Name* |
(4R,6R)-6-[2-[(1S,2S,6R,8aR)-2,6-dimethyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl]-4-hydroxyoxan-2-one
|
|
SMILES |
C[C@@H]1CC[C@@H]2[C@H]([C@H](C=CC2=C1)C)CC[C@@H]3C[C@H](CC(=O)O3)O
|
|
InChI |
InChI=1S/C19H28O3/c1-12-3-7-18-14(9-12)5-4-13(2)17(18)8-6-16-10-15(20)11-19(21)22-16/h4-5,9,12-13,15-18,20H,3,6-8,10-11H2,1-2H3/t12-,13+,15-,16-,17+,18+/m1/s1
|
|
InChIKey |
BKZPCUPKVCPRQW-MHMDBQTNSA-N
|
|
Synonyms |
Monacolin L; monacolin L lactone; (4R,6R)-6-{2-[(1S,2S,6R,8aR)-2,6-dimethyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl}-4-hydroxyoxan-2-one; (4R,6R)-6-{2-[(1S,2S,6R,8aR)-2,6-dimethyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl}-4-hydroxytetrahydro-2H-pyran-2-one; monakolin l; (4R,6R)-6-[2-[(1S,2S,6R,8aR)-2,6-dimethyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl]-4-hydroxyoxan-2-one; SCHEMBL10038917; CHEBI:50130; Q27104751
|
|
CAS | 79394-47-1 | |
PubChem CID | 15294098 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 304.4 | ALogp: | 3.6 |
HBD: | 1 | HBA: | 3 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 46.5 | Aromatic Rings: | 3 |
Heavy Atoms: | 22 | QED Weighted: | 0.789 |
Caco-2 Permeability: | -4.726 | MDCK Permeability: | 0.00002390 |
Pgp-inhibitor: | 0.994 | Pgp-substrate: | 0.411 |
Human Intestinal Absorption (HIA): | 0.026 | 20% Bioavailability (F20%): | 0.996 |
30% Bioavailability (F30%): | 0.98 |
Blood-Brain-Barrier Penetration (BBB): | 0.192 | Plasma Protein Binding (PPB): | 97.24% |
Volume Distribution (VD): | 1.059 | Fu: | 1.96% |
CYP1A2-inhibitor: | 0.146 | CYP1A2-substrate: | 0.072 |
CYP2C19-inhibitor: | 0.042 | CYP2C19-substrate: | 0.828 |
CYP2C9-inhibitor: | 0.167 | CYP2C9-substrate: | 0.117 |
CYP2D6-inhibitor: | 0.006 | CYP2D6-substrate: | 0.081 |
CYP3A4-inhibitor: | 0.84 | CYP3A4-substrate: | 0.789 |
Clearance (CL): | 12.292 | Half-life (T1/2): | 0.644 |
hERG Blockers: | 0.721 | Human Hepatotoxicity (H-HT): | 0.969 |
Drug-inuced Liver Injury (DILI): | 0.113 | AMES Toxicity: | 0.332 |
Rat Oral Acute Toxicity: | 0.044 | Maximum Recommended Daily Dose: | 0.995 |
Skin Sensitization: | 0.977 | Carcinogencity: | 0.314 |
Eye Corrosion: | 0.017 | Eye Irritation: | 0.498 |
Respiratory Toxicity: | 0.952 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001935 | ![]() |
0.703 | D06WTZ | ![]() |
0.578 | ||
ENC002580 | ![]() |
0.578 | D0H0ND | ![]() |
0.565 | ||
ENC000662 | ![]() |
0.556 | D02RQU | ![]() |
0.254 | ||
ENC006007 | ![]() |
0.474 | D04QNO | ![]() |
0.233 | ||
ENC006008 | ![]() |
0.438 | D0Y7IU | ![]() |
0.233 | ||
ENC004384 | ![]() |
0.420 | D08PIQ | ![]() |
0.227 | ||
ENC004385 | ![]() |
0.420 | D0CZ1Q | ![]() |
0.227 | ||
ENC002912 | ![]() |
0.400 | D0D2TN | ![]() |
0.227 | ||
ENC001414 | ![]() |
0.333 | D0F1EX | ![]() |
0.223 | ||
ENC003241 | ![]() |
0.309 | D0V9DZ | ![]() |
0.216 |