|
Name |
Aspernolide B
|
| Molecular Formula | C24H26O8 | |
| IUPAC Name* |
methyl (2R)-4-hydroxy-2-[[4-hydroxy-3-(3-hydroxy-3-methylbutyl)phenyl]methyl]-3-(4-hydroxyphenyl)-5-oxofuran-2-carboxylate
|
|
| SMILES |
CC(C)(CCC1=C(C=CC(=C1)C[C@@]2(C(=C(C(=O)O2)O)C3=CC=C(C=C3)O)C(=O)OC)O)O
|
|
| InChI |
InChI=1S/C24H26O8/c1-23(2,30)11-10-16-12-14(4-9-18(16)26)13-24(22(29)31-3)19(20(27)21(28)32-24)15-5-7-17(25)8-6-15/h4-9,12,25-27,30H,10-11,13H2,1-3H3/t24-/m1/s1
|
|
| InChIKey |
MJCHJLWNXODVGT-XMMPIXPASA-N
|
|
| Synonyms |
Aspernolide B; methyl (2R)-4-hydroxy-2-[[4-hydroxy-3-(3-hydroxy-3-methylbutyl)phenyl]methyl]-3-(4-hydroxyphenyl)-5-oxofuran-2-carboxylate
|
|
| CAS | NA | |
| PubChem CID | 25243208 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 442.5 | ALogp: | 3.0 |
| HBD: | 4 | HBA: | 8 |
| Rotatable Bonds: | 8 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 134.0 | Aromatic Rings: | 3 |
| Heavy Atoms: | 32 | QED Weighted: | 0.478 |
| Caco-2 Permeability: | -5.019 | MDCK Permeability: | 0.00001780 |
| Pgp-inhibitor: | 0.071 | Pgp-substrate: | 0.001 |
| Human Intestinal Absorption (HIA): | 0.03 | 20% Bioavailability (F20%): | 0.204 |
| 30% Bioavailability (F30%): | 0.965 |
| Blood-Brain-Barrier Penetration (BBB): | 0.027 | Plasma Protein Binding (PPB): | 95.27% |
| Volume Distribution (VD): | 0.292 | Fu: | 3.68% |
| CYP1A2-inhibitor: | 0.08 | CYP1A2-substrate: | 0.532 |
| CYP2C19-inhibitor: | 0.879 | CYP2C19-substrate: | 0.17 |
| CYP2C9-inhibitor: | 0.911 | CYP2C9-substrate: | 0.945 |
| CYP2D6-inhibitor: | 0.541 | CYP2D6-substrate: | 0.711 |
| CYP3A4-inhibitor: | 0.891 | CYP3A4-substrate: | 0.389 |
| Clearance (CL): | 12.251 | Half-life (T1/2): | 0.61 |
| hERG Blockers: | 0.028 | Human Hepatotoxicity (H-HT): | 0.183 |
| Drug-inuced Liver Injury (DILI): | 0.45 | AMES Toxicity: | 0.167 |
| Rat Oral Acute Toxicity: | 0.545 | Maximum Recommended Daily Dose: | 0.108 |
| Skin Sensitization: | 0.077 | Carcinogencity: | 0.072 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.054 |
| Respiratory Toxicity: | 0.016 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002705 | ![]() |
0.814 | D0J7RK | ![]() |
0.342 | ||
| ENC002711 | ![]() |
0.814 | D06KYN | ![]() |
0.333 | ||
| ENC002729 | ![]() |
0.755 | D0Q9ON | ![]() |
0.310 | ||
| ENC000875 | ![]() |
0.755 | D04UTT | ![]() |
0.289 | ||
| ENC002376 | ![]() |
0.740 | D04XEG | ![]() |
0.287 | ||
| ENC003721 | ![]() |
0.708 | D07UBG | ![]() |
0.285 | ||
| ENC003493 | ![]() |
0.705 | D04AIT | ![]() |
0.283 | ||
| ENC003497 | ![]() |
0.705 | D06TJJ | ![]() |
0.282 | ||
| ENC002571 | ![]() |
0.656 | D00LFB | ![]() |
0.281 | ||
| ENC003113 | ![]() |
0.636 | D0U3YB | ![]() |
0.278 | ||