![]() |
Name |
Methyl perillate
|
Molecular Formula | C11H16O2 | |
IUPAC Name* |
methyl (4S)-4-prop-1-en-2-ylcyclohexene-1-carboxylate
|
|
SMILES |
CC(=C)[C@H]1CCC(=CC1)C(=O)OC
|
|
InChI |
InChI=1S/C11H16O2/c1-8(2)9-4-6-10(7-5-9)11(12)13-3/h6,9H,1,4-5,7H2,2-3H3/t9-/m1/s1
|
|
InChIKey |
JMMLJZJUVKEVCK-SECBINFHSA-N
|
|
Synonyms |
Methyl perillate; 26460-67-3; methyl (4S)-4-prop-1-en-2-ylcyclohexene-1-carboxylate; SCHEMBL8280195; DTXSID70556781; ZINC4976264; NSC-667675; J-016434; Methyl (4S)-4-(prop-1-en-2-yl)cyclohex-1-ene-1-carboxylate
|
|
CAS | 26460-67-3 | |
PubChem CID | 14159029 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 180.24 | ALogp: | 3.0 |
HBD: | 0 | HBA: | 2 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 26.3 | Aromatic Rings: | 1 |
Heavy Atoms: | 13 | QED Weighted: | 0.481 |
Caco-2 Permeability: | -4.321 | MDCK Permeability: | 0.00002980 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.007 |
30% Bioavailability (F30%): | 0.084 |
Blood-Brain-Barrier Penetration (BBB): | 0.986 | Plasma Protein Binding (PPB): | 28.88% |
Volume Distribution (VD): | 1.055 | Fu: | 68.94% |
CYP1A2-inhibitor: | 0.509 | CYP1A2-substrate: | 0.895 |
CYP2C19-inhibitor: | 0.304 | CYP2C19-substrate: | 0.836 |
CYP2C9-inhibitor: | 0.035 | CYP2C9-substrate: | 0.188 |
CYP2D6-inhibitor: | 0.015 | CYP2D6-substrate: | 0.831 |
CYP3A4-inhibitor: | 0.309 | CYP3A4-substrate: | 0.285 |
Clearance (CL): | 11.452 | Half-life (T1/2): | 0.456 |
hERG Blockers: | 0.014 | Human Hepatotoxicity (H-HT): | 0.127 |
Drug-inuced Liver Injury (DILI): | 0.183 | AMES Toxicity: | 0.04 |
Rat Oral Acute Toxicity: | 0.297 | Maximum Recommended Daily Dose: | 0.198 |
Skin Sensitization: | 0.17 | Carcinogencity: | 0.3 |
Eye Corrosion: | 0.419 | Eye Irritation: | 0.639 |
Respiratory Toxicity: | 0.913 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001066 | ![]() |
0.550 | D03KEK | ![]() |
0.224 | ||
ENC000555 | ![]() |
0.550 | D04XPW | ![]() |
0.213 | ||
ENC000369 | ![]() |
0.477 | D02PPN | ![]() |
0.200 | ||
ENC000194 | ![]() |
0.391 | D02QCD | ![]() |
0.197 | ||
ENC001439 | ![]() |
0.389 | D0Z8SF | ![]() |
0.192 | ||
ENC002219 | ![]() |
0.378 | D0R7WU | ![]() |
0.190 | ||
ENC001829 | ![]() |
0.357 | D0U7GP | ![]() |
0.183 | ||
ENC001981 | ![]() |
0.357 | D01JGV | ![]() |
0.183 | ||
ENC001437 | ![]() |
0.357 | D02CNR | ![]() |
0.179 | ||
ENC002339 | ![]() |
0.339 | D0B4RU | ![]() |
0.179 |