|
Name |
Cladosporin
|
| Molecular Formula | C16H20O5 | |
| IUPAC Name* |
(3R)-6,8-dihydroxy-3-[[(2R,6S)-6-methyloxan-2-yl]methyl]-3,4-dihydroisochromen-1-one
|
|
| SMILES |
C[C@H]1CCC[C@@H](O1)C[C@H]2CC3=C(C(=CC(=C3)O)O)C(=O)O2
|
|
| InChI |
InChI=1S/C16H20O5/c1-9-3-2-4-12(20-9)8-13-6-10-5-11(17)7-14(18)15(10)16(19)21-13/h5,7,9,12-13,17-18H,2-4,6,8H2,1H3/t9-,12+,13+/m0/s1
|
|
| InChIKey |
WOMKDMUZNBFXKG-ZWKOPEQDSA-N
|
|
| Synonyms |
Cladosporin; Asperentin; 35818-31-6; 81PR0D5FI4; (R)-6,8-Dihydroxy-3-(((2R,6S)-6-methyltetrahydro-2H-pyran-2-yl)methyl)isochroman-1-one; (3r)-3-[[(2r,6s)-6-Methyloxan-2-Yl]methyl]-6,8-Bis(Oxidanyl)-3,4-Dihydroisochromen-1-One; (3R)-6,8-dihydroxy-3-[[(2R,6S)-6-methyloxan-2-yl]methyl]-3,4-dihydroisochromen-1-one; UNII-81PR0D5FI4; KRS; 4pg3; CHEMBL448685; GTPL10247; 1H-2-BENZOPYRAN-1-ONE, 3,4-DIHYDRO-6,8-DIHYDROXY-3-((TETRAHYDRO-6-METHYL-2H-PYRAN-2-YL)METHYL)-, (2R-(2.ALPHA.(R*),6.BETA.))-; BDBM50434379; 3,4-Dihydro-6,8-dihydroxy-3-(tetrahydro-6-methyl-2H-pyran-2-yl)methylisocoumarin; HY-136767; CS-0133554; Q27269262; (3R)-3,4-DIHYDRO-6,8-DIHYDROXY-3-(((2R,6S)-TETRAHYDRO-6-METHYL-2H-PYRAN-2-YL)METHYL)-1H-2-BENZOPYRAN-1-ONE; (3R)-6,8-dihydroxy-3-{[(2R,6S)-6-methyltetrahydro-2H-pyran-2-yl]methyl}-3,4-dihydro-1H-isochromen-1-one; 1H-2-BENZOPYRAN-1-ONE, 3,4-DIHYDRO-6,8-DIHYDROXY-3-(((2R,6S)-TETRAHYDRO-6-METHYL-2H-PYRAN-2-YL)METHYL)-, (3R)-; 1H-2-Benzopyran-1-one, 3,4-dihydro-6,8-dihydroxy-3-((tetrahydro-6-methyl-2H-pyran-2-yl)methyl)-, (2R-(2-alpha(R*),6-beta))-
|
|
| CAS | 35818-31-6 | |
| PubChem CID | 13990016 | |
| ChEMBL ID | CHEMBL448685 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 292.33 | ALogp: | 3.3 |
| HBD: | 2 | HBA: | 5 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 76.0 | Aromatic Rings: | 3 |
| Heavy Atoms: | 21 | QED Weighted: | 0.818 |
| Caco-2 Permeability: | -4.807 | MDCK Permeability: | 0.00003650 |
| Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.006 |
| Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.015 |
| 30% Bioavailability (F30%): | 0.085 |
| Blood-Brain-Barrier Penetration (BBB): | 0.459 | Plasma Protein Binding (PPB): | 88.53% |
| Volume Distribution (VD): | 1.21 | Fu: | 9.08% |
| CYP1A2-inhibitor: | 0.803 | CYP1A2-substrate: | 0.194 |
| CYP2C19-inhibitor: | 0.286 | CYP2C19-substrate: | 0.132 |
| CYP2C9-inhibitor: | 0.338 | CYP2C9-substrate: | 0.922 |
| CYP2D6-inhibitor: | 0.542 | CYP2D6-substrate: | 0.282 |
| CYP3A4-inhibitor: | 0.487 | CYP3A4-substrate: | 0.142 |
| Clearance (CL): | 13.25 | Half-life (T1/2): | 0.71 |
| hERG Blockers: | 0.02 | Human Hepatotoxicity (H-HT): | 0.799 |
| Drug-inuced Liver Injury (DILI): | 0.871 | AMES Toxicity: | 0.561 |
| Rat Oral Acute Toxicity: | 0.045 | Maximum Recommended Daily Dose: | 0.987 |
| Skin Sensitization: | 0.931 | Carcinogencity: | 0.923 |
| Eye Corrosion: | 0.046 | Eye Irritation: | 0.903 |
| Respiratory Toxicity: | 0.781 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003280 | ![]() |
1.000 | D07MGA | ![]() |
0.290 | ||
| ENC003043 | ![]() |
0.739 | D03YVO | ![]() |
0.267 | ||
| ENC003297 | ![]() |
0.714 | D04JHN | ![]() |
0.266 | ||
| ENC005249 | ![]() |
0.565 | D0PG8O | ![]() |
0.262 | ||
| ENC003870 | ![]() |
0.560 | D00ZFP | ![]() |
0.261 | ||
| ENC003117 | ![]() |
0.538 | D02NSF | ![]() |
0.247 | ||
| ENC003158 | ![]() |
0.519 | D01KQA | ![]() |
0.243 | ||
| ENC005003 | ![]() |
0.513 | D05VIL | ![]() |
0.238 | ||
| ENC005644 | ![]() |
0.506 | D08QMX | ![]() |
0.234 | ||
| ENC003872 | ![]() |
0.500 | D0X3FX | ![]() |
0.233 | ||