|
Name |
Albicanol
|
| Molecular Formula | C15H26O | |
| IUPAC Name* |
[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methanol
|
|
| SMILES |
C[C@]12CCCC([C@@H]1CCC(=C)[C@@H]2CO)(C)C
|
|
| InChI |
InChI=1S/C15H26O/c1-11-6-7-13-14(2,3)8-5-9-15(13,4)12(11)10-16/h12-13,16H,1,5-10H2,2-4H3/t12-,13-,15+/m0/s1
|
|
| InChIKey |
ZPTSRWNMMWXEHX-KCQAQPDRSA-N
|
|
| Synonyms |
Albicanol; 54632-04-1; [(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methanol; (+)-albicanol; 96955-97-4; CCRIS 8459; (8aS)-albicanol; SCHEMBL7760094; DTXSID80969909; CHEBI:155904; (4aalpha)-2-methylene-5,5,8abeta-trimethyldecalin-1beta-methanol; (5,5,8a-Trimethyl-2-methylidenedecahydronaphthalen-1-yl)methanol; (1S,4aalpha)-decahydro-5,5,8abeta-trimethyl-2-methylenenaphthalene-1-methanol; (4aalpha)-decahydro-5,5,8abeta-trimethyl-2-methylenenaphthalene-1beta-methanol; [(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidenedecahydronaphthalen-1-yl]methanol
|
|
| CAS | 54632-04-1 | |
| PubChem CID | 171360 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 222.37 | ALogp: | 4.1 |
| HBD: | 1 | HBA: | 1 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 20.2 | Aromatic Rings: | 2 |
| Heavy Atoms: | 16 | QED Weighted: | 0.65 |
| Caco-2 Permeability: | -4.397 | MDCK Permeability: | 0.00001370 |
| Pgp-inhibitor: | 0.018 | Pgp-substrate: | 0.001 |
| Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.958 |
| 30% Bioavailability (F30%): | 0.043 |
| Blood-Brain-Barrier Penetration (BBB): | 0.844 | Plasma Protein Binding (PPB): | 56.95% |
| Volume Distribution (VD): | 0.948 | Fu: | 48.86% |
| CYP1A2-inhibitor: | 0.186 | CYP1A2-substrate: | 0.277 |
| CYP2C19-inhibitor: | 0.057 | CYP2C19-substrate: | 0.797 |
| CYP2C9-inhibitor: | 0.138 | CYP2C9-substrate: | 0.245 |
| CYP2D6-inhibitor: | 0.014 | CYP2D6-substrate: | 0.63 |
| CYP3A4-inhibitor: | 0.067 | CYP3A4-substrate: | 0.241 |
| Clearance (CL): | 11.917 | Half-life (T1/2): | 0.139 |
| hERG Blockers: | 0.025 | Human Hepatotoxicity (H-HT): | 0.208 |
| Drug-inuced Liver Injury (DILI): | 0.04 | AMES Toxicity: | 0.013 |
| Rat Oral Acute Toxicity: | 0.832 | Maximum Recommended Daily Dose: | 0.239 |
| Skin Sensitization: | 0.45 | Carcinogencity: | 0.721 |
| Eye Corrosion: | 0.795 | Eye Irritation: | 0.871 |
| Respiratory Toxicity: | 0.962 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002141 | ![]() |
0.644 | D04VIS | ![]() |
0.370 | ||
| ENC002543 | ![]() |
0.556 | D0S0NK | ![]() |
0.343 | ||
| ENC003214 | ![]() |
0.548 | D0H1QY | ![]() |
0.263 | ||
| ENC003143 | ![]() |
0.524 | D01CKY | ![]() |
0.258 | ||
| ENC001844 | ![]() |
0.466 | D0U3GL | ![]() |
0.253 | ||
| ENC001070 | ![]() |
0.463 | D0Z1XD | ![]() |
0.253 | ||
| ENC003145 | ![]() |
0.456 | D06XMU | ![]() |
0.244 | ||
| ENC002923 | ![]() |
0.452 | D04DJN | ![]() |
0.244 | ||
| ENC005922 | ![]() |
0.444 | D0L2LS | ![]() |
0.241 | ||
| ENC001452 | ![]() |
0.438 | D0SC8F | ![]() |
0.241 | ||