![]() |
Name |
Phe-Pro-Lys
|
Molecular Formula | C20H30N4O4 | |
IUPAC Name* |
(2S)-6-amino-2-[[(2S)-1-[(2S)-2-amino-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]hexanoic acid
|
|
SMILES |
C1C[C@H](N(C1)C(=O)[C@H](CC2=CC=CC=C2)N)C(=O)N[C@@H](CCCCN)C(=O)O
|
|
InChI |
InChI=1S/C20H30N4O4/c21-11-5-4-9-16(20(27)28)23-18(25)17-10-6-12-24(17)19(26)15(22)13-14-7-2-1-3-8-14/h1-3,7-8,15-17H,4-6,9-13,21-22H2,(H,23,25)(H,27,28)/t15-,16-,17-/m0/s1
|
|
InChIKey |
ZVRJWDUPIDMHDN-ULQDDVLXSA-N
|
|
Synonyms |
Phe-Pro-Lys; Phenylalanyl-prolyl-lysine; L-Phenylalanyl-L-prolyl-L-lysine; CHEBI:161812; (2S)-6-amino-2-[[(2S)-1-[(2S)-2-amino-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]hexanoic acid
|
|
CAS | NA | |
PubChem CID | 11153522 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 390.5 | ALogp: | -2.8 |
HBD: | 4 | HBA: | 6 |
Rotatable Bonds: | 10 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 139.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 28 | QED Weighted: | 0.433 |
Caco-2 Permeability: | -6.41 | MDCK Permeability: | 0.00049182 |
Pgp-inhibitor: | 0.098 | Pgp-substrate: | 0.009 |
Human Intestinal Absorption (HIA): | 0.966 | 20% Bioavailability (F20%): | 0.013 |
30% Bioavailability (F30%): | 0.253 |
Blood-Brain-Barrier Penetration (BBB): | 0.204 | Plasma Protein Binding (PPB): | 8.18% |
Volume Distribution (VD): | 0.327 | Fu: | 84.04% |
CYP1A2-inhibitor: | 0.007 | CYP1A2-substrate: | 0.039 |
CYP2C19-inhibitor: | 0.042 | CYP2C19-substrate: | 0.059 |
CYP2C9-inhibitor: | 0.025 | CYP2C9-substrate: | 0.145 |
CYP2D6-inhibitor: | 0.01 | CYP2D6-substrate: | 0.217 |
CYP3A4-inhibitor: | 0.034 | CYP3A4-substrate: | 0.056 |
Clearance (CL): | 3.155 | Half-life (T1/2): | 0.849 |
hERG Blockers: | 0.047 | Human Hepatotoxicity (H-HT): | 0.414 |
Drug-inuced Liver Injury (DILI): | 0.017 | AMES Toxicity: | 0.009 |
Rat Oral Acute Toxicity: | 0.134 | Maximum Recommended Daily Dose: | 0.094 |
Skin Sensitization: | 0.136 | Carcinogencity: | 0.04 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.019 |
Respiratory Toxicity: | 0.334 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001906 | ![]() |
0.617 | D07HGR | ![]() |
0.674 | ||
ENC001904 | ![]() |
0.402 | D0X5SJ | ![]() |
0.598 | ||
ENC000717 | ![]() |
0.400 | D0N5HJ | ![]() |
0.547 | ||
ENC003576 | ![]() |
0.389 | D00SEB | ![]() |
0.500 | ||
ENC000130 | ![]() |
0.388 | D00DEF | ![]() |
0.489 | ||
ENC000810 | ![]() |
0.369 | D06PSS | ![]() |
0.420 | ||
ENC000918 | ![]() |
0.362 | D0R1CR | ![]() |
0.388 | ||
ENC000749 | ![]() |
0.333 | D01STB | ![]() |
0.385 | ||
ENC002436 | ![]() |
0.327 | D0RA5Q | ![]() |
0.384 | ||
ENC004716 | ![]() |
0.315 | D0M5OC | ![]() |
0.375 |