|
Name |
Ambuic acid
|
| Molecular Formula | C19H26O6 | |
| IUPAC Name* |
(E)-4-[(1R,5R,6R)-3-[(E)-hept-1-enyl]-5-hydroxy-4-(hydroxymethyl)-2-oxo-7-oxabicyclo[4.1.0]hept-3-en-1-yl]-2-methylbut-2-enoic acid
|
|
| SMILES |
CCCCC/C=C/C1=C([C@H]([C@@H]2[C@](C1=O)(O2)C/C=C(\C)/C(=O)O)O)CO
|
|
| InChI |
InChI=1S/C19H26O6/c1-3-4-5-6-7-8-13-14(11-20)15(21)17-19(25-17,16(13)22)10-9-12(2)18(23)24/h7-9,15,17,20-21H,3-6,10-11H2,1-2H3,(H,23,24)/b8-7+,12-9+/t15-,17-,19+/m1/s1
|
|
| InChIKey |
UDSQZJMGPSRCEM-HDKVZZTHSA-N
|
|
| Synonyms |
Ambuic acid; 340774-69-8; (2E)-4-[(1R,5R,6R)-3-(1E)-1-Hepten-1-yl-5-hydroxy-4-(hydroxymethyl)-2-oxo-7-oxabicyclo[4.1.0]hept-3-en-1-yl]-2-methyl-2-butenoic acid; (+)-Ambuic Acid; (2E)-4-[(1R,5R,6R)-3-(1E)-1-Hepten-1-yl-5-hydroxy-4-(hydroxymethyl)-2-oxo-7-oxabicyclo[4.1.0]hept-3-en-1-yl]-2-methyl-2-butenoicacid; C19H26O6; CHEMBL562502; SCHEMBL5484601; DTXSID101318126; HB3759; AKOS037435228; (2E,5R,6R,7R,8E,10E)-2-Methyl-5,9-carbonyl-5,6-epoxy-7-hydroxy-8-(hydroxymethyl)-2,8,10-hexadecatrienoic acid; (E)-4-[(1R,5R,6R)-3-[(E)-hept-1-enyl]-5-hydroxy-4-(hydroxymethyl)-2-oxo-7-oxabicyclo[4.1.0]hept-3-en-1-yl]-2-methylbut-2-enoic acid
|
|
| CAS | 340774-69-8 | |
| PubChem CID | 11152290 | |
| ChEMBL ID | CHEMBL562502 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 350.4 | ALogp: | 2.0 |
| HBD: | 3 | HBA: | 6 |
| Rotatable Bonds: | 9 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 107.0 | Aromatic Rings: | 2 |
| Heavy Atoms: | 25 | QED Weighted: | 0.335 |
| Caco-2 Permeability: | -4.932 | MDCK Permeability: | 0.00002650 |
| Pgp-inhibitor: | 0 | Pgp-substrate: | 0.002 |
| Human Intestinal Absorption (HIA): | 0.045 | 20% Bioavailability (F20%): | 0.009 |
| 30% Bioavailability (F30%): | 0.003 |
| Blood-Brain-Barrier Penetration (BBB): | 0.647 | Plasma Protein Binding (PPB): | 56.34% |
| Volume Distribution (VD): | 0.83 | Fu: | 35.86% |
| CYP1A2-inhibitor: | 0.01 | CYP1A2-substrate: | 0.542 |
| CYP2C19-inhibitor: | 0.026 | CYP2C19-substrate: | 0.635 |
| CYP2C9-inhibitor: | 0.013 | CYP2C9-substrate: | 0.315 |
| CYP2D6-inhibitor: | 0.006 | CYP2D6-substrate: | 0.088 |
| CYP3A4-inhibitor: | 0.034 | CYP3A4-substrate: | 0.081 |
| Clearance (CL): | 2.035 | Half-life (T1/2): | 0.747 |
| hERG Blockers: | 0.011 | Human Hepatotoxicity (H-HT): | 0.087 |
| Drug-inuced Liver Injury (DILI): | 0.975 | AMES Toxicity: | 0.03 |
| Rat Oral Acute Toxicity: | 0.756 | Maximum Recommended Daily Dose: | 0.01 |
| Skin Sensitization: | 0.538 | Carcinogencity: | 0.185 |
| Eye Corrosion: | 0.984 | Eye Irritation: | 0.617 |
| Respiratory Toxicity: | 0.776 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004331 | ![]() |
0.426 | D06FEA | ![]() |
0.305 | ||
| ENC004326 | ![]() |
0.396 | D0N3NO | ![]() |
0.303 | ||
| ENC002511 | ![]() |
0.396 | D0V0IX | ![]() |
0.266 | ||
| ENC004330 | ![]() |
0.392 | D09SRR | ![]() |
0.265 | ||
| ENC004325 | ![]() |
0.378 | D0I4DQ | ![]() |
0.257 | ||
| ENC004324 | ![]() |
0.371 | D0UE9X | ![]() |
0.250 | ||
| ENC003663 | ![]() |
0.365 | D07PCI | ![]() |
0.242 | ||
| ENC002025 | ![]() |
0.330 | D0O1PH | ![]() |
0.241 | ||
| ENC002292 | ![]() |
0.320 | D0H2YX | ![]() |
0.238 | ||
| ENC004770 | ![]() |
0.315 | D00HCQ | ![]() |
0.236 | ||