|
Name |
Pyripyropene O
|
| Molecular Formula | C29H35NO7 | |
| IUPAC Name* |
[(1R,2S,5S,6R,7R,10R)-5-acetyloxy-2,6,10-trimethyl-16-oxo-14-pyridin-3-yl-11,15-dioxatetracyclo[8.8.0.02,7.012,17]octadeca-12(17),13-dien-6-yl]methyl acetate
|
|
| SMILES |
CC(=O)OC[C@]1([C@@H]2CC[C@@]3([C@@H]([C@]2(CC[C@@H]1OC(=O)C)C)CC4=C(O3)C=C(OC4=O)C5=CN=CC=C5)C)C
|
|
| InChI |
InChI=1S/C29H35NO7/c1-17(31)34-16-28(4)23-8-11-29(5)24(27(23,3)10-9-25(28)35-18(2)32)13-20-22(37-29)14-21(36-26(20)33)19-7-6-12-30-15-19/h6-7,12,14-15,23-25H,8-11,13,16H2,1-5H3/t23-,24-,25+,27+,28+,29-/m1/s1
|
|
| InChIKey |
LNZRIIIDRGIMHV-QXHZFDHFSA-N
|
|
| Synonyms |
Pyripyropene O; [(1R,2S,5S,6R,7R,10R)-5-Acetyloxy-2,6,10-trimethyl-16-oxo-14-pyridin-3-yl-11,15-dioxatetracyclo[8.8.0.02,7.012,17]octadeca-12(17),13-dien-6-yl]methyl acetate
|
|
| CAS | NA | |
| PubChem CID | 10553713 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 509.6 | ALogp: | 4.0 |
| HBD: | 0 | HBA: | 8 |
| Rotatable Bonds: | 6 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 101.0 | Aromatic Rings: | 5 |
| Heavy Atoms: | 37 | QED Weighted: | 0.521 |
| Caco-2 Permeability: | -4.996 | MDCK Permeability: | 0.00001970 |
| Pgp-inhibitor: | 0.998 | Pgp-substrate: | 0.003 |
| Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.335 |
| 30% Bioavailability (F30%): | 0.987 |
| Blood-Brain-Barrier Penetration (BBB): | 0.197 | Plasma Protein Binding (PPB): | 81.04% |
| Volume Distribution (VD): | 1.025 | Fu: | 19.71% |
| CYP1A2-inhibitor: | 0.25 | CYP1A2-substrate: | 0.204 |
| CYP2C19-inhibitor: | 0.207 | CYP2C19-substrate: | 0.519 |
| CYP2C9-inhibitor: | 0.445 | CYP2C9-substrate: | 0.235 |
| CYP2D6-inhibitor: | 0.119 | CYP2D6-substrate: | 0.203 |
| CYP3A4-inhibitor: | 0.81 | CYP3A4-substrate: | 0.491 |
| Clearance (CL): | 2.533 | Half-life (T1/2): | 0.404 |
| hERG Blockers: | 0.449 | Human Hepatotoxicity (H-HT): | 0.819 |
| Drug-inuced Liver Injury (DILI): | 0.834 | AMES Toxicity: | 0.011 |
| Rat Oral Acute Toxicity: | 0.086 | Maximum Recommended Daily Dose: | 0.443 |
| Skin Sensitization: | 0.483 | Carcinogencity: | 0.038 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.01 |
| Respiratory Toxicity: | 0.474 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005020 | ![]() |
0.806 | D06CNP | ![]() |
0.348 | ||
| ENC002192 | ![]() |
0.737 | D02STN | ![]() |
0.281 | ||
| ENC002198 | ![]() |
0.627 | D02CJX | ![]() |
0.271 | ||
| ENC003422 | ![]() |
0.511 | D02CNR | ![]() |
0.268 | ||
| ENC003130 | ![]() |
0.500 | D0X4RS | ![]() |
0.264 | ||
| ENC002118 | ![]() |
0.489 | D09WYX | ![]() |
0.257 | ||
| ENC003423 | ![]() |
0.467 | D08BDT | ![]() |
0.256 | ||
| ENC001980 | ![]() |
0.457 | D0V2JK | ![]() |
0.255 | ||
| ENC002412 | ![]() |
0.434 | D0T6WT | ![]() |
0.252 | ||
| ENC002080 | ![]() |
0.408 | D0W5LS | ![]() |
0.250 | ||