|
Name |
cyclo(L-Phe-trans-4-hydroxy-L-Pro)
|
| Molecular Formula | C14H16N2O3 | |
| IUPAC Name* |
(3S,7R,8aS)-3-benzyl-7-hydroxy-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione
|
|
| SMILES |
C1[C@H](CN2[C@@H]1C(=O)N[C@H](C2=O)CC3=CC=CC=C3)O
|
|
| InChI |
InChI=1S/C14H16N2O3/c17-10-7-12-13(18)15-11(14(19)16(12)8-10)6-9-4-2-1-3-5-9/h1-5,10-12,17H,6-8H2,(H,15,18)/t10-,11+,12+/m1/s1
|
|
| InChIKey |
PYQJYHACQOBZLF-WOPDTQHZSA-N
|
|
| Synonyms |
cyclo(L-Phe-trans-4-hydroxy-L-Pro); 118477-06-8; Cyclo(L-phenylalanyl-trans-4-hydroxy-L-proline); (3S,7R,8aS)-3-benzyl-7-hydroxy-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione; L-Phe-trans-4-hydroxy-L-Pro; CHEMBL3740025; SCHEMBL13657922; BDBM163707; ZINC82047600; AKOS032948256; (4R)-4-Hydroxycyclo(L-Pro-L-Phe-); Cyclo L-OH-Pro-L-Phe (Fr. 1-4); Cyclo-(L-phenylalanyl-4R-hydroxy-L-proline)
|
|
| CAS | NA | |
| PubChem CID | 10467786 | |
| ChEMBL ID | CHEMBL3740025 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 260.29 | ALogp: | 0.4 |
| HBD: | 2 | HBA: | 3 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 69.6 | Aromatic Rings: | 3 |
| Heavy Atoms: | 19 | QED Weighted: | 0.793 |
| Caco-2 Permeability: | -5.209 | MDCK Permeability: | 0.00001710 |
| Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.195 |
| Human Intestinal Absorption (HIA): | 0.09 | 20% Bioavailability (F20%): | 0.747 |
| 30% Bioavailability (F30%): | 0.937 |
| Blood-Brain-Barrier Penetration (BBB): | 0.242 | Plasma Protein Binding (PPB): | 21.57% |
| Volume Distribution (VD): | 0.614 | Fu: | 68.09% |
| CYP1A2-inhibitor: | 0.026 | CYP1A2-substrate: | 0.073 |
| CYP2C19-inhibitor: | 0.088 | CYP2C19-substrate: | 0.556 |
| CYP2C9-inhibitor: | 0.062 | CYP2C9-substrate: | 0.521 |
| CYP2D6-inhibitor: | 0.007 | CYP2D6-substrate: | 0.267 |
| CYP3A4-inhibitor: | 0.076 | CYP3A4-substrate: | 0.381 |
| Clearance (CL): | 4.012 | Half-life (T1/2): | 0.619 |
| hERG Blockers: | 0.037 | Human Hepatotoxicity (H-HT): | 0.935 |
| Drug-inuced Liver Injury (DILI): | 0.695 | AMES Toxicity: | 0.025 |
| Rat Oral Acute Toxicity: | 0.298 | Maximum Recommended Daily Dose: | 0.934 |
| Skin Sensitization: | 0.162 | Carcinogencity: | 0.177 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.019 |
| Respiratory Toxicity: | 0.119 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005847 | ![]() |
1.000 | D05EPM | ![]() |
0.371 | ||
| ENC005969 | ![]() |
0.706 | D06BYV | ![]() |
0.348 | ||
| ENC005971 | ![]() |
0.683 | D05OIS | ![]() |
0.328 | ||
| ENC005484 | ![]() |
0.683 | D03RZV | ![]() |
0.324 | ||
| ENC005481 | ![]() |
0.532 | D0Z9NZ | ![]() |
0.320 | ||
| ENC005972 | ![]() |
0.516 | D0R1BD | ![]() |
0.315 | ||
| ENC005846 | ![]() |
0.516 | D07RGW | ![]() |
0.307 | ||
| ENC001910 | ![]() |
0.516 | D0U5RT | ![]() |
0.303 | ||
| ENC003591 | ![]() |
0.500 | D08EOD | ![]() |
0.301 | ||
| ENC005997 | ![]() |
0.494 | D07HOF | ![]() |
0.300 | ||