|
Name |
Nafuredin
|
| Molecular Formula | C22H32O4 | |
| IUPAC Name* |
(1R,2R,5R,6S)-5-hydroxy-1-methyl-2-[(1E,3E,5R,7E,9E,11S)-5,7,11-trimethyltrideca-1,3,7,9-tetraenyl]-3,7-dioxabicyclo[4.1.0]heptan-4-one
|
|
| SMILES |
CC[C@H](C)/C=C/C=C(\C)/C[C@@H](C)/C=C/C=C/[C@@H]1[C@@]2([C@@H](O2)[C@H](C(=O)O1)O)C
|
|
| InChI |
InChI=1S/C22H32O4/c1-6-15(2)11-9-12-17(4)14-16(3)10-7-8-13-18-22(5)20(26-22)19(23)21(24)25-18/h7-13,15-16,18-20,23H,6,14H2,1-5H3/b10-7+,11-9+,13-8+,17-12+/t15-,16-,18+,19+,20-,22+/m0/s1
|
|
| InChIKey |
NMEGHQQRWKBPQO-IMNRXHEYSA-N
|
|
| Synonyms |
nafuredin; (+)-Nafuredin; 4J6NV9S26K; FT-0554; 224427-79-6; (1R,2R,5R,6S)-5-Hydroxy-1-methyl-2-((1E,3E,5R,7E,9E,11S)-5,7,11-trimethyl-1,3,7,9-tridecatetraen-1-yl)-3,7-dioxabicyclo(4.1.0)heptan-4-one; 3,7-Dioxabicyclo(4.1.0)heptan-4-one, 5-hydroxy-1-methyl-2-((1E,3E,5R,7E,9E,11S)-5,7,11-trimethyl-1,3,7,9-tridecatetraen-1-yl)-, (1R,2R,5R,6S)-; 3,7-Dioxabicyclo(4.1.0)heptan-4-one, 5-hydroxy-1-methyl-2-((1E,3E,5R,7E,9E,11S)-5,7,11-trimethyl-1,3,7,9-tridecatetraenyl)-, (1R,2R,5R,6S)-; UNII-4J6NV9S26K; CHEMBL4162866; (1R,2R,5R,6S)-5-hydroxy-1-methyl-2-[(1E,3E,5R,7E,9E,11S)-5,7,11-trimethyltrideca-1,3,7,9-tetraenyl]-3,7-dioxabicyclo[4.1.0]heptan-4-one
|
|
| CAS | 224427-79-6 | |
| PubChem CID | 10338591 | |
| ChEMBL ID | CHEMBL4162866 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 360.5 | ALogp: | 4.9 |
| HBD: | 1 | HBA: | 4 |
| Rotatable Bonds: | 8 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 59.1 | Aromatic Rings: | 2 |
| Heavy Atoms: | 26 | QED Weighted: | 0.387 |
| Caco-2 Permeability: | -4.705 | MDCK Permeability: | 0.00002260 |
| Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.082 |
| Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.005 |
| 30% Bioavailability (F30%): | 0.006 |
| Blood-Brain-Barrier Penetration (BBB): | 0.317 | Plasma Protein Binding (PPB): | 91.95% |
| Volume Distribution (VD): | 0.958 | Fu: | 6.64% |
| CYP1A2-inhibitor: | 0.14 | CYP1A2-substrate: | 0.164 |
| CYP2C19-inhibitor: | 0.284 | CYP2C19-substrate: | 0.809 |
| CYP2C9-inhibitor: | 0.199 | CYP2C9-substrate: | 0.958 |
| CYP2D6-inhibitor: | 0.69 | CYP2D6-substrate: | 0.899 |
| CYP3A4-inhibitor: | 0.844 | CYP3A4-substrate: | 0.264 |
| Clearance (CL): | 3.536 | Half-life (T1/2): | 0.177 |
| hERG Blockers: | 0.126 | Human Hepatotoxicity (H-HT): | 0.973 |
| Drug-inuced Liver Injury (DILI): | 0.933 | AMES Toxicity: | 0.083 |
| Rat Oral Acute Toxicity: | 0.05 | Maximum Recommended Daily Dose: | 0.219 |
| Skin Sensitization: | 0.258 | Carcinogencity: | 0.038 |
| Eye Corrosion: | 0.004 | Eye Irritation: | 0.018 |
| Respiratory Toxicity: | 0.936 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003160 | ![]() |
0.314 | D0FG6M | ![]() |
0.209 | ||
| ENC004902 | ![]() |
0.264 | D0N3NO | ![]() |
0.189 | ||
| ENC005399 | ![]() |
0.262 | D0S7WX | ![]() |
0.185 | ||
| ENC002137 | ![]() |
0.260 | D0G3PI | ![]() |
0.182 | ||
| ENC004901 | ![]() |
0.255 | D02DGU | ![]() |
0.182 | ||
| ENC005400 | ![]() |
0.246 | D00DKK | ![]() |
0.182 | ||
| ENC005574 | ![]() |
0.246 | D0G8OC | ![]() |
0.180 | ||
| ENC004111 | ![]() |
0.245 | D06JPB | ![]() |
0.180 | ||
| ENC005422 | ![]() |
0.245 | D0N1TP | ![]() |
0.177 | ||
| ENC001850 | ![]() |
0.244 | D0G5CF | ![]() |
0.177 | ||