|
Name |
Propanoic acid, 2-hydroxy-, (1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl ester, (2S)-
|
| Molecular Formula | C13H24O3 | |
| IUPAC Name* |
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S)-2-hydroxypropanoate
|
|
| SMILES |
C[C@@H]1CC[C@H]([C@@H](C1)OC(=O)[C@H](C)O)C(C)C
|
|
| InChI |
InChI=1S/C13H24O3/c1-8(2)11-6-5-9(3)7-12(11)16-13(15)10(4)14/h8-12,14H,5-7H2,1-4H3/t9-,10+,11+,12-/m1/s1
|
|
| InChIKey |
UJNOLBSYLSYIBM-NOOOWODRSA-N
|
|
| Synonyms |
61597-98-6; l-Menthyl lactate; L-Menthyl l-lactate; L-Menthyl (S)-lactate; Menthyl lactate [Mart.]; L-Menthyl lactate [FHFI]; (1R,2S,5R)-2-Isopropyl-5-methylcyclohexyl (S)-2-Hydroxypropionate; MENTHYL LACTATE; FEMA No. 3748; 2S-(1R,2S,5R)-menthyl lactate; Propanoic acid, 2-hydroxy-, (1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl ester, (2S)-; 2BF9E65L7I; (S)-(1R,2S,5R)-2-Isopropyl-5-methylcyclohexyl 2-hydroxypropanoate; (-)-menthyl lactate; UNII-2BF9E65L7I; EC 612-179-8; SCHEMBL111620; (1R,2S,5R)-2-Isopropyl-5-methylcyclohexyl (R)-2-Hydroxypropionate; MENTHYL LACTATE [INCI]; MENTHYL LACTATE, (-)-; MENTHYL LACTATE [WHO-DD]; DTXSID301036338; 59259-38-0; ZINC4025995; MFCD27977194; [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S)-2-hydroxypropanoate; AS-56902; Propanoic acid, 2-hydroxy-, 5-methyl-2-(1-methylethyl)cyclohexyl ester, (1R-(1alpha(S*),2beta,5alpha))-; CS-0154344; I0889; D91210; Lactic acid (1R,3R,4S)-p-menthane-3-yl ester; Q27254517; (1R,2S,5R)-2-isopropyl-5-methylcyclohexyl (S)-2-hydroxypropanoate; (1R,2S,5R)-5-methyl-2-(propan-2-yl)cyclohexyl (2S)-2-hydroxypropanoate; (S)-2-Hydroxypropionic Acid (1R,2S,5R)-2-Isopropyl-5-methylcyclohexyl Ester; PROPANOIC ACID, 2-HYDROXY-, 5-METHYL-2-(1-METHYLETHYL)CYCLOHEXYL ESTER, (1R-(1.ALPHA.(S*),2.BETA.,5.ALPHA.))-
|
|
| CAS | 61597-98-6 | |
| PubChem CID | 7076215 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 228.33 | ALogp: | 3.3 |
| HBD: | 1 | HBA: | 3 |
| Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 46.5 | Aromatic Rings: | 1 |
| Heavy Atoms: | 16 | QED Weighted: | 0.755 |
| Caco-2 Permeability: | -4.529 | MDCK Permeability: | 0.00001580 |
| Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.17 |
| Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.176 |
| 30% Bioavailability (F30%): | 0.108 |
| Blood-Brain-Barrier Penetration (BBB): | 0.302 | Plasma Protein Binding (PPB): | 93.72% |
| Volume Distribution (VD): | 1.328 | Fu: | 6.00% |
| CYP1A2-inhibitor: | 0.048 | CYP1A2-substrate: | 0.225 |
| CYP2C19-inhibitor: | 0.051 | CYP2C19-substrate: | 0.907 |
| CYP2C9-inhibitor: | 0.185 | CYP2C9-substrate: | 0.301 |
| CYP2D6-inhibitor: | 0.006 | CYP2D6-substrate: | 0.365 |
| CYP3A4-inhibitor: | 0.044 | CYP3A4-substrate: | 0.362 |
| Clearance (CL): | 7.473 | Half-life (T1/2): | 0.805 |
| hERG Blockers: | 0.027 | Human Hepatotoxicity (H-HT): | 0.602 |
| Drug-inuced Liver Injury (DILI): | 0.638 | AMES Toxicity: | 0.022 |
| Rat Oral Acute Toxicity: | 0.038 | Maximum Recommended Daily Dose: | 0.075 |
| Skin Sensitization: | 0.681 | Carcinogencity: | 0.127 |
| Eye Corrosion: | 0.566 | Eye Irritation: | 0.943 |
| Respiratory Toxicity: | 0.781 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC000578 | ![]() |
0.717 | D04CSZ | ![]() |
0.511 | ||
| ENC000950 | ![]() |
0.511 | D06PTA | ![]() |
0.267 | ||
| ENC003125 | ![]() |
0.393 | D0S0AS | ![]() |
0.267 | ||
| ENC004004 | ![]() |
0.343 | D05VQI | ![]() |
0.260 | ||
| ENC003050 | ![]() |
0.338 | D07CNL | ![]() |
0.256 | ||
| ENC000791 | ![]() |
0.320 | D0O5SZ | ![]() |
0.244 | ||
| ENC003087 | ![]() |
0.317 | D06WTZ | ![]() |
0.232 | ||
| ENC001888 | ![]() |
0.315 | D03KYG | ![]() |
0.228 | ||
| ENC005678 | ![]() |
0.304 | D0R7WU | ![]() |
0.226 | ||
| ENC005679 | ![]() |
0.296 | D02RQU | ![]() |
0.218 | ||