|
Name |
Menthyl acetate
|
| Molecular Formula | C12H22O2 | |
| IUPAC Name* |
(5-methyl-2-propan-2-ylcyclohexyl) acetate
|
|
| SMILES |
CC1CCC(C(C1)OC(=O)C)C(C)C
|
|
| InChI |
InChI=1S/C12H22O2/c1-8(2)11-6-5-9(3)7-12(11)14-10(4)13/h8-9,11-12H,5-7H2,1-4H3
|
|
| InChIKey |
XHXUANMFYXWVNG-UHFFFAOYSA-N
|
|
| Synonyms |
Menthyl acetate; 16409-45-3; Menthol, acetate; 89-48-5; Menthyl acetate racemic; Cyclohexanol, 5-methyl-2-(1-methylethyl)-, acetate; 29066-34-0; (5-methyl-2-propan-2-ylcyclohexyl) acetate; 2623-23-6; (+/-)-Menthyl acetate; 2230-87-7; 2-Isopropyl-5-methylcyclohexyl acetate; (+)-Neomenthyl acetate; d-Neomenthyl acetate; L-Menthyl acetate;(-)-Menthyl acetate; 5-Methyl-2-(1-methylethyl)cyclohexanol acetate; Neomenthol acetate; FEMA Number 2668; HSDB 824; (.+/-.)-Menthol acetate; EINECS 240-459-6; Acetic acid, p-menth-3-yl ester, dl-; AI3-36197; Menthanyl acetate; Cyclohexanol, 5-methyl-2-(1-methylethyl)-, acetate, (1R,2R,5R)-rel-; Menthol, neo-; CYCLOHEXANOL, 5-METHYL-2-(1-METHYLETHYL)-, ACETATE, (1.ALPHA.,2.BETA.,5.ALPHA.)-; 20777-36-0; EINECS 218-767-7; (5R)-2-Isopropyl-5-methylcyclohexyl acetate; starbld0011430; Menthyl acetate, 97%; MENTHYLACETATE97; (2-isopropyl-5-methyl-cyclohexyl) acetate; acetic acid menthyl ester; SCHEMBL57396; CHEMBL254585; 2-Isopropyl-5-methylcyclohexyl acetate, (1.alpha.,2.beta.,5.alpha.)-; DTXSID20859153; NSC7350; Acetic acid, p-menth-3-yl ester; CHEBI:191550; (1S)-(+)-MENTHYLACETATE; NSC-7350; DL-Menthyl acetate, >=97%, FG; NSC122112; AKOS015837885; cis-1,3,trans-1,4- menthol acetate; NSC 122112; NSC-122112; SB44841; SB46743; AS-83629; DB-063670; DB-071375; FT-0604526; FT-0604554; FT-0628207; FT-0631427; FT-0690234; FT-0694110; W-100373; Cyclohexanol, acetate, (1.alpha.,2.alpha.,5.beta.)-; Menthyl acetate, primary pharmaceutical reference standard; Cyclohexanol, acetate, [1S-(1.alpha.,2.alpha.,5.beta.)]-; Cyclohexanol, 5-methyl-2-(1-methylethyl)-, acetate, (1alpha,2alpha,5beta)-; Cyclohexanol, 5-methyl-2-(1-methylethyl)-, acetate, (1.alpha.,2.beta.,5.alpha.)-(.+/-.)-
|
|
| CAS | 16409-45-3 | |
| PubChem CID | 27867 | |
| ChEMBL ID | CHEMBL254585 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 198.3 | ALogp: | 3.6 |
| HBD: | 0 | HBA: | 2 |
| Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 26.3 | Aromatic Rings: | 1 |
| Heavy Atoms: | 14 | QED Weighted: | 0.631 |
| Caco-2 Permeability: | -4.441 | MDCK Permeability: | 0.00002240 |
| Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.002 |
| Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.07 |
| 30% Bioavailability (F30%): | 0.625 |
| Blood-Brain-Barrier Penetration (BBB): | 0.81 | Plasma Protein Binding (PPB): | 87.27% |
| Volume Distribution (VD): | 1.037 | Fu: | 10.30% |
| CYP1A2-inhibitor: | 0.117 | CYP1A2-substrate: | 0.121 |
| CYP2C19-inhibitor: | 0.028 | CYP2C19-substrate: | 0.919 |
| CYP2C9-inhibitor: | 0.139 | CYP2C9-substrate: | 0.718 |
| CYP2D6-inhibitor: | 0.006 | CYP2D6-substrate: | 0.15 |
| CYP3A4-inhibitor: | 0.13 | CYP3A4-substrate: | 0.395 |
| Clearance (CL): | 6.67 | Half-life (T1/2): | 0.318 |
| hERG Blockers: | 0.012 | Human Hepatotoxicity (H-HT): | 0.25 |
| Drug-inuced Liver Injury (DILI): | 0.78 | AMES Toxicity: | 0.023 |
| Rat Oral Acute Toxicity: | 0.015 | Maximum Recommended Daily Dose: | 0.022 |
| Skin Sensitization: | 0.697 | Carcinogencity: | 0.193 |
| Eye Corrosion: | 0.571 | Eye Irritation: | 0.893 |
| Respiratory Toxicity: | 0.078 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001908 | ![]() |
0.717 | D04CSZ | ![]() |
0.535 | ||
| ENC000950 | ![]() |
0.535 | D0R7WU | ![]() |
0.340 | ||
| ENC000828 | ![]() |
0.417 | D07CNL | ![]() |
0.257 | ||
| ENC003125 | ![]() |
0.404 | D0ZK8H | ![]() |
0.239 | ||
| ENC001166 | ![]() |
0.396 | D0S0AS | ![]() |
0.238 | ||
| ENC003050 | ![]() |
0.367 | D06PTA | ![]() |
0.238 | ||
| ENC000791 | ![]() |
0.356 | D04MWJ | ![]() |
0.231 | ||
| ENC004004 | ![]() |
0.349 | D05VQI | ![]() |
0.227 | ||
| ENC001888 | ![]() |
0.347 | D02DKD | ![]() |
0.219 | ||
| ENC002662 | ![]() |
0.345 | D0O5SZ | ![]() |
0.213 | ||