|
Name |
Dehydropachyrrhizone
|
| Molecular Formula | C20H12O7 | |
| IUPAC Name* |
16-methoxy-5,7,11,14,18-pentaoxahexacyclo[11.11.0.02,10.04,8.015,23.017,21]tetracosa-1(13),2,4(8),9,15(23),16,19,21-octaen-24-one
|
|
| SMILES |
COC1=C2C(=CC3=C1OC4=C(C3=O)C5=CC6=C(C=C5OC4)OCO6)C=CO2
|
|
| InChI |
InChI=1S/C20H12O7/c1-22-20-18-9(2-3-23-18)4-11-17(21)16-10-5-13-14(26-8-25-13)6-12(10)24-7-15(16)27-19(11)20/h2-6H,7-8H2,1H3
|
|
| InChIKey |
MSXPSNDSSMJJME-UHFFFAOYSA-N
|
|
| Synonyms |
Dehydropachyrrhizone; 6a,13a-Didehydropachyrrhizone; KBio3_002222; Spectrum3_001391; Spectrum4_001989; BSPBio_003002; KBioGR_002524; SCHEMBL12998405; CHEBI:178335; LMPK12060061; NCGC00178350-01; 16-methoxy-5,7,11,14,18-pentaoxahexacyclo[11.11.0.02,10.04,8.015,23.017,21]tetracosa-1(13),2,4(8),9,15(23),16,19,21-octaen-24-one
|
|
| CAS | NA | |
| PubChem CID | 6710746 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 364.3 | ALogp: | 2.9 |
| HBD: | 0 | HBA: | 7 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 76.4 | Aromatic Rings: | 6 |
| Heavy Atoms: | 27 | QED Weighted: | 0.492 |
| Caco-2 Permeability: | -4.821 | MDCK Permeability: | 0.00005280 |
| Pgp-inhibitor: | 0.133 | Pgp-substrate: | 0.001 |
| Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.002 |
| 30% Bioavailability (F30%): | 0.004 |
| Blood-Brain-Barrier Penetration (BBB): | 0.015 | Plasma Protein Binding (PPB): | 86.47% |
| Volume Distribution (VD): | 0.493 | Fu: | 9.66% |
| CYP1A2-inhibitor: | 0.802 | CYP1A2-substrate: | 0.682 |
| CYP2C19-inhibitor: | 0.869 | CYP2C19-substrate: | 0.103 |
| CYP2C9-inhibitor: | 0.835 | CYP2C9-substrate: | 0.894 |
| CYP2D6-inhibitor: | 0.017 | CYP2D6-substrate: | 0.821 |
| CYP3A4-inhibitor: | 0.712 | CYP3A4-substrate: | 0.123 |
| Clearance (CL): | 9.921 | Half-life (T1/2): | 0.231 |
| hERG Blockers: | 0.022 | Human Hepatotoxicity (H-HT): | 0.972 |
| Drug-inuced Liver Injury (DILI): | 0.985 | AMES Toxicity: | 0.704 |
| Rat Oral Acute Toxicity: | 0.255 | Maximum Recommended Daily Dose: | 0.642 |
| Skin Sensitization: | 0.076 | Carcinogencity: | 0.939 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.057 |
| Respiratory Toxicity: | 0.832 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002624 | ![]() |
0.700 | D08SKH | ![]() |
0.389 | ||
| ENC002626 | ![]() |
0.342 | D0W8WB | ![]() |
0.382 | ||
| ENC000361 | ![]() |
0.323 | D0T3NB | ![]() |
0.342 | ||
| ENC002625 | ![]() |
0.289 | D0L1JW | ![]() |
0.336 | ||
| ENC000078 | ![]() |
0.289 | D0D4HN | ![]() |
0.323 | ||
| ENC002434 | ![]() |
0.270 | D0G4KG | ![]() |
0.320 | ||
| ENC005391 | ![]() |
0.269 | D04TDQ | ![]() |
0.271 | ||
| ENC000812 | ![]() |
0.266 | D07UXP | ![]() |
0.269 | ||
| ENC001505 | ![]() |
0.265 | D01DBQ | ![]() |
0.256 | ||
| ENC002757 | ![]() |
0.263 | D05MQK | ![]() |
0.254 | ||