|
Name |
Isocycloheximide
|
| Molecular Formula | C15H23NO4 | |
| IUPAC Name* |
4-[(2R)-2-[(1R,3R,5S)-3,5-dimethyl-2-oxocyclohexyl]-2-hydroxyethyl]piperidine-2,6-dione
|
|
| SMILES |
C[C@H]1C[C@H](C(=O)[C@H](C1)[C@@H](CC2CC(=O)NC(=O)C2)O)C
|
|
| InChI |
InChI=1S/C15H23NO4/c1-8-3-9(2)15(20)11(4-8)12(17)5-10-6-13(18)16-14(19)7-10/h8-12,17H,3-7H2,1-2H3,(H,16,18,19)/t8-,9+,11+,12+/m0/s1
|
|
| InChIKey |
YPHMISFOHDHNIV-LUTQBAROSA-N
|
|
| Synonyms |
Isocycloheximide; MLS001049073; SMR000386911; 4-[(2R)-2-[(1R,3R,5S)-3,5-dimethyl-2-oxocyclohexyl]-2-hydroxyethyl]piperidine-2,6-dione; 6746-42-5; 4-((R)-2-((1R,3R,5S)-3,5-Dimethyl-2-oxocyclohexyl)-2-hydroxyethyl)piperidine-2,6-dione; CAS-66-81-9; CHEMBL1358722; DTXSID8058453; BDBM63645; cid_6604199; CHEBI:182607; HMS2271P07; KUC105878N; ZINC4073970; KSC-8-223-6; NCGC00016297-01; 4-[(2R)-2-Hydroxy-2-[(1R,3R,5S)-2-oxo-3,5-dimethylcyclohexyl]ethyl]piperidine-2,6-dione; 4-[(2R)-2-[(1R,3R,5S)-3,5-dimethyl-2-oxidanylidene-cyclohexyl]-2-oxidanyl-ethyl]piperidine-2,6-dione; 4-[(2R)-2-hydroxy-2-[(1R,3R,5S)-2-keto-3,5-dimethyl-cyclohexyl]ethyl]piperidine-2,6-quinone
|
|
| CAS | 6746-42-5 | |
| PubChem CID | 6604199 | |
| ChEMBL ID | CHEMBL1358722 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 281.35 | ALogp: | 0.5 |
| HBD: | 2 | HBA: | 4 |
| Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 83.5 | Aromatic Rings: | 2 |
| Heavy Atoms: | 20 | QED Weighted: | 0.768 |
| Caco-2 Permeability: | -4.805 | MDCK Permeability: | 0.00003510 |
| Pgp-inhibitor: | 0.013 | Pgp-substrate: | 0.128 |
| Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.009 |
| 30% Bioavailability (F30%): | 0.003 |
| Blood-Brain-Barrier Penetration (BBB): | 0.991 | Plasma Protein Binding (PPB): | 25.16% |
| Volume Distribution (VD): | 0.548 | Fu: | 67.77% |
| CYP1A2-inhibitor: | 0.018 | CYP1A2-substrate: | 0.237 |
| CYP2C19-inhibitor: | 0.066 | CYP2C19-substrate: | 0.768 |
| CYP2C9-inhibitor: | 0.016 | CYP2C9-substrate: | 0.515 |
| CYP2D6-inhibitor: | 0.01 | CYP2D6-substrate: | 0.114 |
| CYP3A4-inhibitor: | 0.04 | CYP3A4-substrate: | 0.203 |
| Clearance (CL): | 10.625 | Half-life (T1/2): | 0.896 |
| hERG Blockers: | 0.021 | Human Hepatotoxicity (H-HT): | 0.726 |
| Drug-inuced Liver Injury (DILI): | 0.663 | AMES Toxicity: | 0.009 |
| Rat Oral Acute Toxicity: | 0.979 | Maximum Recommended Daily Dose: | 0.138 |
| Skin Sensitization: | 0.238 | Carcinogencity: | 0.297 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.071 |
| Respiratory Toxicity: | 0.041 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC000131 | ![]() |
1.000 | D07XVN | ![]() |
0.247 | ||
| ENC000869 | ![]() |
1.000 | D0WB9V | ![]() |
0.219 | ||
| ENC005740 | ![]() |
0.536 | D03QWT | ![]() |
0.212 | ||
| ENC005741 | ![]() |
0.536 | D0I5DS | ![]() |
0.210 | ||
| ENC001024 | ![]() |
0.333 | D0R2KF | ![]() |
0.207 | ||
| ENC005972 | ![]() |
0.244 | D0O5FY | ![]() |
0.206 | ||
| ENC005846 | ![]() |
0.244 | D00ETS | ![]() |
0.205 | ||
| ENC003132 | ![]() |
0.242 | D06WTZ | ![]() |
0.196 | ||
| ENC002048 | ![]() |
0.240 | D0S8LV | ![]() |
0.196 | ||
| ENC004874 | ![]() |
0.237 | D03WAJ | ![]() |
0.195 | ||