![]() |
Name |
Isosafrole glycol
|
Molecular Formula | C10H12O4 | |
IUPAC Name* |
1-(1,3-benzodioxol-5-yl)propane-1,2-diol
|
|
SMILES |
CC(C(C1=CC2=C(C=C1)OCO2)O)O
|
|
InChI |
InChI=1S/C10H12O4/c1-6(11)10(12)7-2-3-8-9(4-7)14-5-13-8/h2-4,6,10-12H,5H2,1H3
|
|
InChIKey |
YIRAEUKOPKEBHB-UHFFFAOYSA-N
|
|
Synonyms |
Isosafrole glycol; 62512-79-2; 1-(1,3-benzodioxol-5-yl)propane-1,2-diol; 1,2-Propanediol, 1-(1,3-benzodioxol-5-yl)-; SCHEMBL10931500; DTXSID60978110; 4-(1,2-dihydroxy-propyl)-1,2-methylenedioxybenzene; 1-(2H-1,3-BENZODIOXOL-5-YL)PROPANE-1,2-DIOL
|
|
CAS | 62512-79-2 | |
PubChem CID | 6454417 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 196.2 | ALogp: | 0.8 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 58.9 | Aromatic Rings: | 2 |
Heavy Atoms: | 14 | QED Weighted: | 0.747 |
Caco-2 Permeability: | -4.574 | MDCK Permeability: | 0.00002220 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.01 |
Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.002 |
30% Bioavailability (F30%): | 0.007 |
Blood-Brain-Barrier Penetration (BBB): | 0.479 | Plasma Protein Binding (PPB): | 67.30% |
Volume Distribution (VD): | 2.233 | Fu: | 37.78% |
CYP1A2-inhibitor: | 0.79 | CYP1A2-substrate: | 0.61 |
CYP2C19-inhibitor: | 0.228 | CYP2C19-substrate: | 0.752 |
CYP2C9-inhibitor: | 0.028 | CYP2C9-substrate: | 0.863 |
CYP2D6-inhibitor: | 0.828 | CYP2D6-substrate: | 0.732 |
CYP3A4-inhibitor: | 0.335 | CYP3A4-substrate: | 0.445 |
Clearance (CL): | 9.37 | Half-life (T1/2): | 0.502 |
hERG Blockers: | 0.026 | Human Hepatotoxicity (H-HT): | 0.045 |
Drug-inuced Liver Injury (DILI): | 0.135 | AMES Toxicity: | 0.051 |
Rat Oral Acute Toxicity: | 0.051 | Maximum Recommended Daily Dose: | 0.019 |
Skin Sensitization: | 0.053 | Carcinogencity: | 0.936 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.063 |
Respiratory Toxicity: | 0.028 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005030 | ![]() |
0.511 | D02XSA | ![]() |
0.458 | ||
ENC004654 | ![]() |
0.381 | D02FCQ | ![]() |
0.421 | ||
ENC001934 | ![]() |
0.380 | D04EYC | ![]() |
0.340 | ||
ENC001960 | ![]() |
0.380 | D08HUC | ![]() |
0.313 | ||
ENC000812 | ![]() |
0.317 | D0I3RO | ![]() |
0.300 | ||
ENC001426 | ![]() |
0.295 | D0I8FI | ![]() |
0.295 | ||
ENC005753 | ![]() |
0.283 | D07UXP | ![]() |
0.278 | ||
ENC000347 | ![]() |
0.283 | D04PHC | ![]() |
0.276 | ||
ENC003650 | ![]() |
0.279 | D07MOX | ![]() |
0.268 | ||
ENC005110 | ![]() |
0.279 | D06GDY | ![]() |
0.264 |