|
Name |
Dihydroagarofuran
|
| Molecular Formula | C15H26O | |
| IUPAC Name* |
(2S,6R,9S)-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodecane
|
|
| SMILES |
C[C@H]1CCC[C@]2(C13C[C@H](CC2)C(O3)(C)C)C
|
|
| InChI |
InChI=1S/C15H26O/c1-11-6-5-8-14(4)9-7-12-10-15(11,14)16-13(12,2)3/h11-12H,5-10H2,1-4H3/t11-,12-,14+,15?/m0/s1
|
|
| InChIKey |
HVAVUZLEYSAYGE-KFUGQBAVSA-N
|
|
| Synonyms |
Dihydroagarofuran; trans-Dihydroagarofuran; Deoxybaimuxino; .beta.-Dihydroagarofuran; .beta.-dihydro-agarofuran; Dihydro-.beta.-agarofuran; .beta.-Agarofuran, dihydro-; 2H-3,9a-Methano-1-benzoxepin, octahydro-2,2,5a,9-tetramethyl-; (2S,6R,9S)-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodecane; (3R,5aS,9R,9aS)-2,2,5a,9-Tetramethyloctahydro-2H-3,9a-methanobenzo[b]oxepine; 2H-3,9a-Methano-1-benzoxepin, octahydro-2,2,5a,9-tetramethyl-, (3R,5aS,9R,9aS)-; 2H-3,9a-Methano-1-benzoxepin, octahydro-2,2,5a,9-tetramethyl-, [3R-(3.alpha.,5a.alpha.,9.alpha.,9a.alpha.)]-
|
|
| CAS | NA | |
| PubChem CID | 6427117 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 222.37 | ALogp: | 3.9 |
| HBD: | 0 | HBA: | 1 |
| Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 9.2 | Aromatic Rings: | 3 |
| Heavy Atoms: | 16 | QED Weighted: | 0.575 |
| Caco-2 Permeability: | -4.578 | MDCK Permeability: | 0.00001490 |
| Pgp-inhibitor: | 0.232 | Pgp-substrate: | 0 |
| Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.603 |
| 30% Bioavailability (F30%): | 0.698 |
| Blood-Brain-Barrier Penetration (BBB): | 0.358 | Plasma Protein Binding (PPB): | 95.73% |
| Volume Distribution (VD): | 1.814 | Fu: | 3.49% |
| CYP1A2-inhibitor: | 0.113 | CYP1A2-substrate: | 0.468 |
| CYP2C19-inhibitor: | 0.359 | CYP2C19-substrate: | 0.921 |
| CYP2C9-inhibitor: | 0.324 | CYP2C9-substrate: | 0.453 |
| CYP2D6-inhibitor: | 0.036 | CYP2D6-substrate: | 0.764 |
| CYP3A4-inhibitor: | 0.302 | CYP3A4-substrate: | 0.307 |
| Clearance (CL): | 9.135 | Half-life (T1/2): | 0.108 |
| hERG Blockers: | 0.049 | Human Hepatotoxicity (H-HT): | 0.658 |
| Drug-inuced Liver Injury (DILI): | 0.049 | AMES Toxicity: | 0.019 |
| Rat Oral Acute Toxicity: | 0.039 | Maximum Recommended Daily Dose: | 0.718 |
| Skin Sensitization: | 0.532 | Carcinogencity: | 0.503 |
| Eye Corrosion: | 0.387 | Eye Irritation: | 0.878 |
| Respiratory Toxicity: | 0.956 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003049 | ![]() |
1.000 | D0V8HA | ![]() |
0.288 | ||
| ENC002337 | ![]() |
0.544 | D0H1QY | ![]() |
0.281 | ||
| ENC002074 | ![]() |
0.492 | D0U3GL | ![]() |
0.280 | ||
| ENC000085 | ![]() |
0.451 | D0L2LS | ![]() |
0.253 | ||
| ENC005519 | ![]() |
0.451 | D0Z1XD | ![]() |
0.250 | ||
| ENC001322 | ![]() |
0.403 | D0Q6NZ | ![]() |
0.250 | ||
| ENC002262 | ![]() |
0.381 | D08QKJ | ![]() |
0.244 | ||
| ENC001893 | ![]() |
0.381 | D0I2SD | ![]() |
0.244 | ||
| ENC001172 | ![]() |
0.381 | D09NNA | ![]() |
0.234 | ||
| ENC000592 | ![]() |
0.379 | D03XOC | ![]() |
0.233 | ||