![]() |
Name |
(-)-Epicedrol
|
Molecular Formula | C15H26O | |
IUPAC Name* |
(1S,2R,5S,7R,8S)-2,6,6,8-tetramethyltricyclo[5.3.1.01,5]undecan-8-ol
|
|
SMILES |
C[C@@H]1CC[C@@H]2[C@]13CC[C@]([C@H](C3)C2(C)C)(C)O
|
|
InChI |
InChI=1S/C15H26O/c1-10-5-6-11-13(2,3)12-9-15(10,11)8-7-14(12,4)16/h10-12,16H,5-9H2,1-4H3/t10-,11+,12-,14+,15+/m1/s1
|
|
InChIKey |
SVURIXNDRWRAFU-MIBAYGRRSA-N
|
|
Synonyms |
(-)-Epicedrol; 19903-73-2; epi-Cedrol; 8-epicedrol; (1S,2R,5S,7R,8S)-2,6,6,8-tetramethyltricyclo[5.3.1.01,5]undecan-8-ol; (3R,3aS,6S,7R,8aS)-3,6,8,8-tetramethyloctahydro-1H-3a,7-methanoazulen-6-ol; Isocedranol; (+)-pseudocedrol; NCIMech_000347; SCHEMBL6510353; CHEBI:52226; DTXSID90425147; CCG-35709; CCG-36437; MFCD00077758; ZINC34173127; LMPR0103690005; Q27123312
|
|
CAS | 19903-73-2 | |
PubChem CID | 6713078 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 222.37 | ALogp: | 3.9 |
HBD: | 1 | HBA: | 1 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 20.2 | Aromatic Rings: | 3 |
Heavy Atoms: | 16 | QED Weighted: | 0.647 |
Caco-2 Permeability: | -4.719 | MDCK Permeability: | 0.00001980 |
Pgp-inhibitor: | 0.043 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.037 |
30% Bioavailability (F30%): | 0.982 |
Blood-Brain-Barrier Penetration (BBB): | 0.148 | Plasma Protein Binding (PPB): | 91.04% |
Volume Distribution (VD): | 1.071 | Fu: | 10.54% |
CYP1A2-inhibitor: | 0.097 | CYP1A2-substrate: | 0.42 |
CYP2C19-inhibitor: | 0.153 | CYP2C19-substrate: | 0.874 |
CYP2C9-inhibitor: | 0.14 | CYP2C9-substrate: | 0.145 |
CYP2D6-inhibitor: | 0.017 | CYP2D6-substrate: | 0.332 |
CYP3A4-inhibitor: | 0.54 | CYP3A4-substrate: | 0.346 |
Clearance (CL): | 13.068 | Half-life (T1/2): | 0.222 |
hERG Blockers: | 0.018 | Human Hepatotoxicity (H-HT): | 0.234 |
Drug-inuced Liver Injury (DILI): | 0.042 | AMES Toxicity: | 0.002 |
Rat Oral Acute Toxicity: | 0.237 | Maximum Recommended Daily Dose: | 0.623 |
Skin Sensitization: | 0.394 | Carcinogencity: | 0.096 |
Eye Corrosion: | 0.983 | Eye Irritation: | 0.96 |
Respiratory Toxicity: | 0.964 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001172 | ![]() |
0.623 | D0L2LS | ![]() |
0.286 | ||
ENC002267 | ![]() |
0.571 | D0U3GL | ![]() |
0.284 | ||
ENC002110 | ![]() |
0.527 | D0Z1XD | ![]() |
0.284 | ||
ENC003109 | ![]() |
0.527 | D0I2SD | ![]() |
0.276 | ||
ENC003097 | ![]() |
0.474 | D0V8HA | ![]() |
0.271 | ||
ENC001831 | ![]() |
0.474 | D07QKN | ![]() |
0.271 | ||
ENC002998 | ![]() |
0.474 | D0Q6NZ | ![]() |
0.267 | ||
ENC004227 | ![]() |
0.471 | D04GJN | ![]() |
0.261 | ||
ENC006063 | ![]() |
0.471 | D08QKJ | ![]() |
0.261 | ||
ENC003477 | ![]() |
0.458 | D04SFH | ![]() |
0.247 |