| 
                    Name | 
                         l-Proline, N-allyloxycarbonyl-, heptadecyl ester 
                     | 
                
| Molecular Formula | C26H47NO4 | |
| IUPAC Name* | 
                         2-O-heptadecyl 1-O-prop-2-enyl pyrrolidine-1,2-dicarboxylate 
                     | 
                |
| SMILES | 
                         CCCCCCCCCCCCCCCCCOC(=O)C1CCCN1C(=O)OCC=C 
                     | 
                |
| InChI | 
                         InChI=1S/C26H47NO4/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23-30-25(28)24-20-19-21-27(24)26(29)31-22-4-2/h4,24H,2-3,5-23H2,1H3 
                     | 
                |
| InChIKey | 
                         UDEKIWFRXKOMMF-UHFFFAOYSA-N 
                     | 
                |
| Synonyms | 
                         l-Proline, N-allyloxycarbonyl-, heptadecyl ester 
                     | 
                |
| CAS | NA | |
| PubChem CID | 6424275 | |
| ChEMBL ID | NA | 
Chemical Classification: | 
                    
                        
  | 
                    
                        
                            
                     | 
                
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | 
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | 
| Molecular Weight: | 437.7 | ALogp: | 9.5 | 
| HBD: | 0 | HBA: | 4 | 
| Rotatable Bonds: | 21 | Lipinski's rule of five: | Rejected | 
| Polar Surface Area: | 55.8 | Aromatic Rings: | 1 | 
| Heavy Atoms: | 31 | QED Weighted: | 0.122 | 
| Caco-2 Permeability: | -4.917 | MDCK Permeability: | 0.00002090 | 
| Pgp-inhibitor: | 0.01 | Pgp-substrate: | 0.003 | 
| Human Intestinal Absorption (HIA): | 0.001 | 20% Bioavailability (F20%): | 0.868 | 
| 30% Bioavailability (F30%): | 0.995 | 
| Blood-Brain-Barrier Penetration (BBB): | 0.101 | Plasma Protein Binding (PPB): | 98.54% | 
| Volume Distribution (VD): | 1.13 | Fu: | 1.63% | 
| CYP1A2-inhibitor: | 0.115 | CYP1A2-substrate: | 0.164 | 
| CYP2C19-inhibitor: | 0.371 | CYP2C19-substrate: | 0.066 | 
| CYP2C9-inhibitor: | 0.161 | CYP2C9-substrate: | 0.901 | 
| CYP2D6-inhibitor: | 0.495 | CYP2D6-substrate: | 0.12 | 
| CYP3A4-inhibitor: | 0.76 | CYP3A4-substrate: | 0.108 | 
| Clearance (CL): | 3.33 | Half-life (T1/2): | 0.049 | 
| hERG Blockers: | 0.43 | Human Hepatotoxicity (H-HT): | 0.216 | 
| Drug-inuced Liver Injury (DILI): | 0.346 | AMES Toxicity: | 0.006 | 
| Rat Oral Acute Toxicity: | 0.046 | Maximum Recommended Daily Dose: | 0.042 | 
| Skin Sensitization: | 0.961 | Carcinogencity: | 0.166 | 
| Eye Corrosion: | 0.014 | Eye Irritation: | 0.064 | 
| Respiratory Toxicity: | 0.643 | 
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003070 | ![]()  | 
                    0.707 | D00FGR | ![]()  | 
                    0.451 | ||
| ENC003069 | ![]()  | 
                    0.616 | D07ILQ | ![]()  | 
                    0.447 | ||
| ENC001243 | ![]()  | 
                    0.566 | D00AOJ | ![]()  | 
                    0.444 | ||
| ENC000424 | ![]()  | 
                    0.553 | D0Z5SM | ![]()  | 
                    0.430 | ||
| ENC000589 | ![]()  | 
                    0.548 | D05ATI | ![]()  | 
                    0.374 | ||
| ENC001163 | ![]()  | 
                    0.544 | D00STJ | ![]()  | 
                    0.362 | ||
| ENC000258 | ![]()  | 
                    0.535 | D0O1PH | ![]()  | 
                    0.360 | ||
| ENC001218 | ![]()  | 
                    0.535 | D00MLW | ![]()  | 
                    0.341 | ||
| ENC003077 | ![]()  | 
                    0.531 | D0T9TJ | ![]()  | 
                    0.336 | ||
| ENC002300 | ![]()  | 
                    0.528 | D03ZJE | ![]()  | 
                    0.298 | ||