| 
                    Name | 
                         l-Leucine, N-cyclopropylcarbonyl-, hexadecyl ester 
                     | 
                
| Molecular Formula | C26H49NO3 | |
| IUPAC Name* | 
                         hexadecyl 2-(cyclopropanecarbonylamino)-4-methylpentanoate 
                     | 
                |
| SMILES | 
                         CCCCCCCCCCCCCCCCOC(=O)C(CC(C)C)NC(=O)C1CC1 
                     | 
                |
| InChI | 
                         InChI=1S/C26H49NO3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-30-26(29)24(21-22(2)3)27-25(28)23-18-19-23/h22-24H,4-21H2,1-3H3,(H,27,28) 
                     | 
                |
| InChIKey | 
                         LZBWPYUZOKAADA-UHFFFAOYSA-N 
                     | 
                |
| Synonyms | 
                         l-Leucine, N-cyclopropylcarbonyl-, hexadecyl ester 
                     | 
                |
| CAS | NA | |
| PubChem CID | 91721477 | |
| ChEMBL ID | NA | 
Chemical Classification: | 
                    
                        
  | 
                    
                        
                            
                     | 
                
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | 
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | 
| Molecular Weight: | 423.7 | ALogp: | 9.4 | 
| HBD: | 1 | HBA: | 3 | 
| Rotatable Bonds: | 21 | Lipinski's rule of five: | Rejected | 
| Polar Surface Area: | 55.4 | Aromatic Rings: | 1 | 
| Heavy Atoms: | 30 | QED Weighted: | 0.171 | 
| Caco-2 Permeability: | -4.88 | MDCK Permeability: | 0.00001780 | 
| Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.001 | 
| Human Intestinal Absorption (HIA): | 0.001 | 20% Bioavailability (F20%): | 0.915 | 
| 30% Bioavailability (F30%): | 0.996 | 
| Blood-Brain-Barrier Penetration (BBB): | 0.044 | Plasma Protein Binding (PPB): | 97.23% | 
| Volume Distribution (VD): | 0.871 | Fu: | 1.90% | 
| CYP1A2-inhibitor: | 0.064 | CYP1A2-substrate: | 0.235 | 
| CYP2C19-inhibitor: | 0.423 | CYP2C19-substrate: | 0.103 | 
| CYP2C9-inhibitor: | 0.201 | CYP2C9-substrate: | 0.954 | 
| CYP2D6-inhibitor: | 0.321 | CYP2D6-substrate: | 0.105 | 
| CYP3A4-inhibitor: | 0.633 | CYP3A4-substrate: | 0.138 | 
| Clearance (CL): | 3.428 | Half-life (T1/2): | 0.053 | 
| hERG Blockers: | 0.728 | Human Hepatotoxicity (H-HT): | 0.228 | 
| Drug-inuced Liver Injury (DILI): | 0.523 | AMES Toxicity: | 0.008 | 
| Rat Oral Acute Toxicity: | 0.056 | Maximum Recommended Daily Dose: | 0.01 | 
| Skin Sensitization: | 0.933 | Carcinogencity: | 0.048 | 
| Eye Corrosion: | 0.009 | Eye Irritation: | 0.052 | 
| Respiratory Toxicity: | 0.685 | 
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC000424 | ![]()  | 
                    0.602 | D07ILQ | ![]()  | 
                    0.485 | ||
| ENC000488 | ![]()  | 
                    0.568 | D00FGR | ![]()  | 
                    0.472 | ||
| ENC001124 | ![]()  | 
                    0.548 | D0T9TJ | ![]()  | 
                    0.468 | ||
| ENC001234 | ![]()  | 
                    0.548 | D0Z5SM | ![]()  | 
                    0.453 | ||
| ENC000575 | ![]()  | 
                    0.548 | D00AOJ | ![]()  | 
                    0.425 | ||
| ENC003070 | ![]()  | 
                    0.547 | D05ATI | ![]()  | 
                    0.394 | ||
| ENC001243 | ![]()  | 
                    0.546 | D0O1PH | ![]()  | 
                    0.364 | ||
| ENC001218 | ![]()  | 
                    0.546 | D00MLW | ![]()  | 
                    0.355 | ||
| ENC001161 | ![]()  | 
                    0.542 | D00STJ | ![]()  | 
                    0.347 | ||
| ENC000316 | ![]()  | 
                    0.538 | D03ZJE | ![]()  | 
                    0.324 | ||