![]() |
Name |
Rohitukine
|
Molecular Formula | C16H19NO5 | |
IUPAC Name* |
5,7-dihydroxy-8-(3-hydroxy-1-methylpiperidin-4-yl)-2-methylchromen-4-one
|
|
SMILES |
CC1=CC(=O)C2=C(O1)C(=C(C=C2O)O)C3CCN(CC3O)C
|
|
InChI |
InChI=1S/C16H19NO5/c1-8-5-10(18)15-12(20)6-11(19)14(16(15)22-8)9-3-4-17(2)7-13(9)21/h5-6,9,13,19-21H,3-4,7H2,1-2H3
|
|
InChIKey |
MOCVYVBNJQIVOV-UHFFFAOYSA-N
|
|
Synonyms |
Rohitukine; NSC623611; SCHEMBL16180165; BDBM384315; DTXSID301132897; NSC-623611; US9932327, Compound Rohitukine (1); 5,7-Dihydroxy-8-(3-hydroxy-1-methyl-4-piperidinyl)-2-methyl-4H-1-benzopyran-4-one; 5,7-Dihydroxy-8-(3-hydroxy-1-methyl-4-piperidinyl)-2-methyl-4H-chromen-4-one; 757903-87-0
|
|
CAS | 757903-87-0 | |
PubChem CID | 5387431 | |
ChEMBL ID | CHEMBL1077604 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 305.32 | ALogp: | 1.4 |
HBD: | 3 | HBA: | 6 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 90.2 | Aromatic Rings: | 3 |
Heavy Atoms: | 22 | QED Weighted: | 0.743 |
Caco-2 Permeability: | -5.006 | MDCK Permeability: | 0.00000691 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.969 |
Human Intestinal Absorption (HIA): | 0.306 | 20% Bioavailability (F20%): | 0.029 |
30% Bioavailability (F30%): | 0.81 |
Blood-Brain-Barrier Penetration (BBB): | 0.196 | Plasma Protein Binding (PPB): | 73.94% |
Volume Distribution (VD): | 1.774 | Fu: | 39.13% |
CYP1A2-inhibitor: | 0.344 | CYP1A2-substrate: | 0.896 |
CYP2C19-inhibitor: | 0.018 | CYP2C19-substrate: | 0.613 |
CYP2C9-inhibitor: | 0.015 | CYP2C9-substrate: | 0.634 |
CYP2D6-inhibitor: | 0.047 | CYP2D6-substrate: | 0.626 |
CYP3A4-inhibitor: | 0.006 | CYP3A4-substrate: | 0.737 |
Clearance (CL): | 10.996 | Half-life (T1/2): | 0.48 |
hERG Blockers: | 0.184 | Human Hepatotoxicity (H-HT): | 0.222 |
Drug-inuced Liver Injury (DILI): | 0.831 | AMES Toxicity: | 0.609 |
Rat Oral Acute Toxicity: | 0.295 | Maximum Recommended Daily Dose: | 0.381 |
Skin Sensitization: | 0.663 | Carcinogencity: | 0.337 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.011 |
Respiratory Toxicity: | 0.774 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001622 | ![]() |
0.538 | D0G4KG | ![]() |
0.284 | ||
ENC001940 | ![]() |
0.408 | D04AIT | ![]() |
0.283 | ||
ENC001518 | ![]() |
0.408 | D0FA2O | ![]() |
0.259 | ||
ENC004675 | ![]() |
0.392 | D0O1UZ | ![]() |
0.255 | ||
ENC005717 | ![]() |
0.384 | D0K8KX | ![]() |
0.250 | ||
ENC005716 | ![]() |
0.384 | D0JL2K | ![]() |
0.248 | ||
ENC004786 | ![]() |
0.378 | D07MGA | ![]() |
0.247 | ||
ENC005327 | ![]() |
0.363 | D0H6QU | ![]() |
0.245 | ||
ENC001770 | ![]() |
0.356 | D0L7AS | ![]() |
0.241 | ||
ENC006031 | ![]() |
0.355 | D06GCK | ![]() |
0.240 |