|
Name |
Flavasperone
|
| Molecular Formula | C16H14O5 | |
| IUPAC Name* |
5-hydroxy-8,10-dimethoxy-2-methylbenzo[h]chromen-4-one
|
|
| SMILES |
CC1=CC(=O)C2=C(O1)C3=C(C=C(C=C3C=C2O)OC)OC
|
|
| InChI |
InChI=1S/C16H14O5/c1-8-4-11(17)15-12(18)6-9-5-10(19-2)7-13(20-3)14(9)16(15)21-8/h4-7,18H,1-3H3
|
|
| InChIKey |
ARXPDHLVDOYIPX-UHFFFAOYSA-N
|
|
| Synonyms |
Flavasperone; Asperxanthon; ASPERXANTHONE; Flavasperon; 3566-99-2; Antibiotic TMC 256c2; QUS3F7KQ3E; TMC 256c2; 4H-Naphtho(1,2-b)pyran-4-one, 5-hydroxy-8,10-dimethoxy-2-methyl-; 5-hydroxy-8,10-dimethoxy-2-methyl-4H-naphtho[1,2-b]pyran-4-one; 5-HYDROXY-8,10-DIMETHOXY-2-METHYL-4H-NAPHTHO(1,2-B)PYRAN-4-ONE; UNII-QUS3F7KQ3E; TMD256C2; CHEMBL4645135; SCHEMBL16226658; DTXSID40189166; CHEBI:133814; 5-hydroxy-8,10-dimethoxy-2-methyl-4H-benzo[h]chromen-4-one; 5-Hydroxy-8,10-dimethoxy-2-methyl-4H-naphtho[1,2-b]pyran-4-one, 9CI
|
|
| CAS | 3566-99-2 | |
| PubChem CID | 5748546 | |
| ChEMBL ID | CHEMBL4645135 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 286.28 | ALogp: | 3.3 |
| HBD: | 1 | HBA: | 5 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 65.0 | Aromatic Rings: | 3 |
| Heavy Atoms: | 21 | QED Weighted: | 0.726 |
| Caco-2 Permeability: | -4.798 | MDCK Permeability: | 0.00001770 |
| Pgp-inhibitor: | 0.006 | Pgp-substrate: | 0.018 |
| Human Intestinal Absorption (HIA): | 0.019 | 20% Bioavailability (F20%): | 0.004 |
| 30% Bioavailability (F30%): | 0.875 |
| Blood-Brain-Barrier Penetration (BBB): | 0.04 | Plasma Protein Binding (PPB): | 80.29% |
| Volume Distribution (VD): | 0.924 | Fu: | 14.35% |
| CYP1A2-inhibitor: | 0.975 | CYP1A2-substrate: | 0.973 |
| CYP2C19-inhibitor: | 0.624 | CYP2C19-substrate: | 0.533 |
| CYP2C9-inhibitor: | 0.581 | CYP2C9-substrate: | 0.92 |
| CYP2D6-inhibitor: | 0.651 | CYP2D6-substrate: | 0.907 |
| CYP3A4-inhibitor: | 0.417 | CYP3A4-substrate: | 0.238 |
| Clearance (CL): | 8.048 | Half-life (T1/2): | 0.474 |
| hERG Blockers: | 0.005 | Human Hepatotoxicity (H-HT): | 0.231 |
| Drug-inuced Liver Injury (DILI): | 0.946 | AMES Toxicity: | 0.583 |
| Rat Oral Acute Toxicity: | 0.135 | Maximum Recommended Daily Dose: | 0.781 |
| Skin Sensitization: | 0.593 | Carcinogencity: | 0.056 |
| Eye Corrosion: | 0.03 | Eye Irritation: | 0.886 |
| Respiratory Toxicity: | 0.571 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC000962 | ![]() |
0.758 | D0G4KG | ![]() |
0.442 | ||
| ENC003504 | ![]() |
0.662 | D06GCK | ![]() |
0.411 | ||
| ENC002363 | ![]() |
0.608 | D0FA2O | ![]() |
0.346 | ||
| ENC002113 | ![]() |
0.547 | D04AIT | ![]() |
0.318 | ||
| ENC006013 | ![]() |
0.547 | D07MGA | ![]() |
0.293 | ||
| ENC002134 | ![]() |
0.532 | D0D4HN | ![]() |
0.288 | ||
| ENC004845 | ![]() |
0.526 | D0W7JZ | ![]() |
0.284 | ||
| ENC003430 | ![]() |
0.526 | D02LZB | ![]() |
0.279 | ||
| ENC005716 | ![]() |
0.523 | D0B0AX | ![]() |
0.278 | ||
| ENC005717 | ![]() |
0.523 | D09GYT | ![]() |
0.273 | ||