![]() |
Name |
3-Methoxy-5-methyl-4-oxo-2,5-hexadienoic acid
|
Molecular Formula | C8H10O4 | |
IUPAC Name* |
(2E)-3-methoxy-5-methyl-4-oxohexa-2,5-dienoic acid
|
|
SMILES |
CC(=C)C(=O)/C(=C\C(=O)O)/OC
|
|
InChI |
InChI=1S/C8H10O4/c1-5(2)8(11)6(12-3)4-7(9)10/h4H,1H2,2-3H3,(H,9,10)/b6-4+
|
|
InChIKey |
VOUGEZYPVGAPBB-GQCTYLIASA-N
|
|
Synonyms |
penicillic acid; Pencillic acid; 3-Methoxy-5-methyl-4-oxo-2,5-hexadienoic acid; ONL14K3AFD; 90-65-3; Kyselina penicilova; 3-Methoxy-5-methyl-4-oxohexa-2,5-dienoic acid; Kyselina penicilova [Czech]; CCRIS 4941; HSDB 3523; EINECS 202-008-1; UNII-ONL14K3AFD; BRN 1773464; gamma-Keto-beta-methoxy-delta-methylene-delta(sup alpha)-hexenoic acid; PENICILLIC ACID [MI]; 3-03-00-01467 (Beilstein Handbook Reference); SCHEMBL148667; PENICILLIC ACID [HSDB]; PENICILLIC ACID [IARC]; ZINC5260871; 2-Cyano-3-(3-pyridinyl)acrylicacid; C19495
|
|
CAS | 90-65-3 | |
PubChem CID | 5385314 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 170.16 | ALogp: | 0.9 |
HBD: | 1 | HBA: | 4 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 63.6 | Aromatic Rings: | 0 |
Heavy Atoms: | 12 | QED Weighted: | 0.507 |
Caco-2 Permeability: | -4.741 | MDCK Permeability: | 0.00005080 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.003 |
30% Bioavailability (F30%): | 0.347 |
Blood-Brain-Barrier Penetration (BBB): | 0.204 | Plasma Protein Binding (PPB): | 58.35% |
Volume Distribution (VD): | 0.279 | Fu: | 27.39% |
CYP1A2-inhibitor: | 0.104 | CYP1A2-substrate: | 0.428 |
CYP2C19-inhibitor: | 0.049 | CYP2C19-substrate: | 0.055 |
CYP2C9-inhibitor: | 0.21 | CYP2C9-substrate: | 0.121 |
CYP2D6-inhibitor: | 0.113 | CYP2D6-substrate: | 0.12 |
CYP3A4-inhibitor: | 0.013 | CYP3A4-substrate: | 0.138 |
Clearance (CL): | 5.914 | Half-life (T1/2): | 0.859 |
hERG Blockers: | 0.002 | Human Hepatotoxicity (H-HT): | 0.876 |
Drug-inuced Liver Injury (DILI): | 0.96 | AMES Toxicity: | 0.053 |
Rat Oral Acute Toxicity: | 0.29 | Maximum Recommended Daily Dose: | 0.037 |
Skin Sensitization: | 0.88 | Carcinogencity: | 0.295 |
Eye Corrosion: | 0.979 | Eye Irritation: | 0.988 |
Respiratory Toxicity: | 0.94 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005356 | ![]() |
0.386 | D0G4JI | ![]() |
0.303 | ||
ENC000403 | ![]() |
0.343 | D0A7MY | ![]() |
0.273 | ||
ENC003854 | ![]() |
0.317 | D0Z4NI | ![]() |
0.237 | ||
ENC003853 | ![]() |
0.317 | D0F1GS | ![]() |
0.237 | ||
ENC000061 | ![]() |
0.303 | D04CRL | ![]() |
0.226 | ||
ENC005107 | ![]() |
0.293 | D06XGW | ![]() |
0.222 | ||
ENC000735 | ![]() |
0.293 | D0OL6O | ![]() |
0.217 | ||
ENC005010 | ![]() |
0.288 | D0RN2W | ![]() |
0.213 | ||
ENC003261 | ![]() |
0.286 | D05QDC | ![]() |
0.205 | ||
ENC005933 | ![]() |
0.283 | D0GY5Z | ![]() |
0.204 |