|
Name |
Methyl pyruvate
|
| Molecular Formula | C4H6O3 | |
| IUPAC Name* |
methyl 2-oxopropanoate
|
|
| SMILES |
CC(=O)C(=O)OC
|
|
| InChI |
InChI=1S/C4H6O3/c1-3(5)4(6)7-2/h1-2H3
|
|
| InChIKey |
CWKLZLBVOJRSOM-UHFFFAOYSA-N
|
|
| Synonyms |
METHYL PYRUVATE; 600-22-6; Methyl 2-oxopropanoate; Methyl 2-oxopropionate; Pyruvic acid, methyl ester; Propanoic acid, 2-oxo-, methyl ester; Pyruvic acid methyl ester; Methylglyoxylic acid methyl ester; methyl-Pyruvate; 2-oxo-propionic acid methyl ester; 3KJM65G5XL; 2-oxopropanoic acid methyl ester; CHEBI:51850; NSC-65430; UNII-3KJM65G5XL; C4H6O3; Pyruvic acid methyl; EINECS 209-987-4; MFCD00008754; Propanoic acid, 2-oxo-,methyl ester; Tiapride Intermediates; pyruvic acid methylester; METHYL ACETOFORMATE; METHYL PYRORACEMATE; Methyl 2-oxopropanoate #; DSSTox_CID_29282; DSSTox_RID_83401; DSSTox_GSID_49326; SCHEMBL27432; methyl 2-oxidanylidenepropanoate; QSPL 174; CHEMBL3185405; DTXSID9049326; 2-oxopropionic acid methyl ester; 11-DEOXYPROSTAGLANDINF2BETA; AMY40825; METHYL METHOXYCARBONYL KETONE; NSC65430; ZINC1692440; PYRORACEMIC ACID METHYL ESTER; Tox21_202853; BBL027724; NSC 65430; STL146492; AKOS005721076; CS-W013701; FS-4178; Methyl pyruvate, 90%, technical grade; PYRUVIC ACID METHYL ESTER [MI]; NCGC00260399-01; CAS-600-22-6; FT-0628339; P0580; EN300-21088; E76480; A832576; J-522635; Q27122826; F1905-6998
|
|
| CAS | 600-22-6 | |
| PubChem CID | 11748 | |
| ChEMBL ID | CHEMBL3185405 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 102.09 | ALogp: | 0.0 |
| HBD: | 0 | HBA: | 3 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 43.4 | Aromatic Rings: | 0 |
| Heavy Atoms: | 7 | QED Weighted: | 0.35 |
| Caco-2 Permeability: | -4.384 | MDCK Permeability: | 0.00008760 |
| Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.001 |
| Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.016 |
| 30% Bioavailability (F30%): | 0.941 |
| Blood-Brain-Barrier Penetration (BBB): | 0.985 | Plasma Protein Binding (PPB): | 24.52% |
| Volume Distribution (VD): | 0.388 | Fu: | 70.71% |
| CYP1A2-inhibitor: | 0.538 | CYP1A2-substrate: | 0.832 |
| CYP2C19-inhibitor: | 0.186 | CYP2C19-substrate: | 0.665 |
| CYP2C9-inhibitor: | 0.016 | CYP2C9-substrate: | 0.315 |
| CYP2D6-inhibitor: | 0.008 | CYP2D6-substrate: | 0.367 |
| CYP3A4-inhibitor: | 0.007 | CYP3A4-substrate: | 0.291 |
| Clearance (CL): | 6.725 | Half-life (T1/2): | 0.834 |
| hERG Blockers: | 0.009 | Human Hepatotoxicity (H-HT): | 0.047 |
| Drug-inuced Liver Injury (DILI): | 0.197 | AMES Toxicity: | 0.325 |
| Rat Oral Acute Toxicity: | 0.033 | Maximum Recommended Daily Dose: | 0.017 |
| Skin Sensitization: | 0.843 | Carcinogencity: | 0.027 |
| Eye Corrosion: | 0.988 | Eye Irritation: | 0.989 |
| Respiratory Toxicity: | 0.287 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC000410 | ![]() |
0.542 | D0G4JI | ![]() |
0.429 | ||
| ENC000061 | ![]() |
0.429 | D0Z4NI | ![]() |
0.360 | ||
| ENC005488 | ![]() |
0.360 | D0F1GS | ![]() |
0.360 | ||
| ENC000418 | ![]() |
0.360 | D0A7MY | ![]() |
0.344 | ||
| ENC001036 | ![]() |
0.353 | D0OL6O | ![]() |
0.303 | ||
| ENC000234 | ![]() |
0.344 | D04CRL | ![]() |
0.250 | ||
| ENC001754 | ![]() |
0.343 | D0Z4UY | ![]() |
0.238 | ||
| ENC000735 | ![]() |
0.333 | D0C1PY | ![]() |
0.238 | ||
| ENC001253 | ![]() |
0.314 | D06XGW | ![]() |
0.235 | ||
| ENC000382 | ![]() |
0.308 | D0ZK8H | ![]() |
0.233 | ||