![]() |
Name |
2H-1-Benzopyran-2-one, 3,5,7-trihydroxy-
|
Molecular Formula | C9H6O5 | |
IUPAC Name* |
3,5,7-trihydroxychromen-2-one
|
|
SMILES |
C1=C(C=C2C(=C1O)C=C(C(=O)O2)O)O
|
|
InChI |
InChI=1S/C9H6O5/c10-4-1-6(11)5-3-7(12)9(13)14-8(5)2-4/h1-3,10-12H
|
|
InChIKey |
UVXDWGJSULDKQU-UHFFFAOYSA-N
|
|
Synonyms |
2H-1-Benzopyran-2-one, 3,5,7-trihydroxy-; 3,5,7-trihydroxychromen-2-one; 22065-07-2; Coumarin, 3,5,7-trihydroxy-; 3,5,7-Trihydroxycoumarin; SCHEMBL5305472; ZINC33846793; 3,5,7-Trihydroxy-2H-chromen-2-one #; DA-08048; FT-0763764
|
|
CAS | NA | |
PubChem CID | 5375352 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 194.14 | ALogp: | 1.1 |
HBD: | 3 | HBA: | 5 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 87.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 14 | QED Weighted: | 0.55 |
Caco-2 Permeability: | -4.858 | MDCK Permeability: | 0.00000848 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.942 |
Human Intestinal Absorption (HIA): | 0.013 | 20% Bioavailability (F20%): | 0.97 |
30% Bioavailability (F30%): | 0.998 |
Blood-Brain-Barrier Penetration (BBB): | 0.033 | Plasma Protein Binding (PPB): | 81.85% |
Volume Distribution (VD): | 0.537 | Fu: | 19.20% |
CYP1A2-inhibitor: | 0.92 | CYP1A2-substrate: | 0.199 |
CYP2C19-inhibitor: | 0.062 | CYP2C19-substrate: | 0.053 |
CYP2C9-inhibitor: | 0.261 | CYP2C9-substrate: | 0.866 |
CYP2D6-inhibitor: | 0.221 | CYP2D6-substrate: | 0.483 |
CYP3A4-inhibitor: | 0.332 | CYP3A4-substrate: | 0.081 |
Clearance (CL): | 13.474 | Half-life (T1/2): | 0.9 |
hERG Blockers: | 0.05 | Human Hepatotoxicity (H-HT): | 0.131 |
Drug-inuced Liver Injury (DILI): | 0.952 | AMES Toxicity: | 0.075 |
Rat Oral Acute Toxicity: | 0.057 | Maximum Recommended Daily Dose: | 0.793 |
Skin Sensitization: | 0.912 | Carcinogencity: | 0.043 |
Eye Corrosion: | 0.273 | Eye Irritation: | 0.942 |
Respiratory Toxicity: | 0.169 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004389 | ![]() |
0.579 | D04AIT | ![]() |
0.433 | ||
ENC005361 | ![]() |
0.550 | D0K8KX | ![]() |
0.420 | ||
ENC001773 | ![]() |
0.550 | D07EXH | ![]() |
0.378 | ||
ENC001652 | ![]() |
0.525 | D07MGA | ![]() |
0.356 | ||
ENC003471 | ![]() |
0.508 | D06GCK | ![]() |
0.259 | ||
ENC004844 | ![]() |
0.508 | D0V9EN | ![]() |
0.259 | ||
ENC001951 | ![]() |
0.491 | D02UFG | ![]() |
0.258 | ||
ENC004676 | ![]() |
0.490 | D0M8RC | ![]() |
0.250 | ||
ENC001542 | ![]() |
0.490 | D0FA2O | ![]() |
0.250 | ||
ENC005370 | ![]() |
0.490 | D07MOX | ![]() |
0.250 |