|
Name |
(E)-2,6-Dimethylocta-5,7-dien-4-one
|
| Molecular Formula | C10H16O | |
| IUPAC Name* |
(5E)-2,6-dimethylocta-5,7-dien-4-one
|
|
| SMILES |
CC(C)CC(=O)/C=C(\C)/C=C
|
|
| InChI |
InChI=1S/C10H16O/c1-5-9(4)7-10(11)6-8(2)3/h5,7-8H,1,6H2,2-4H3/b9-7+
|
|
| InChIKey |
RJXKHBTYHGBOKV-VQHVLOKHSA-N
|
|
| Synonyms |
(E)-Tagetone; trans-Tagetone; (E)-2,6-Dimethylocta-5,7-dien-4-one; 6752-80-3; Tagetone, (E)-; (5E)-2,6-dimethylocta-5,7-dien-4-one; 9V8N4C9UN5; 5,7-Octadien-4-one, 2,6-dimethyl-, (E)-; UNII-9V8N4C9UN5; 2,6-Dimethyl-5,7-octadien-4-one; EINECS 229-813-0; TAGETONE, TRANS-; SCHEMBL11018652; DTXSID501317899; (5E)-2,6-Dimethyl-5,7-octadien-4-one; (5E)-2,6-dimethyl-octa-5,7-dien-4-one; 5,7-Octadien-4-one, 2,6-dimethyl-, (5E)-; Q27273267
|
|
| CAS | 6752-80-3 | |
| PubChem CID | 5368938 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 152.23 | ALogp: | 3.1 |
| HBD: | 0 | HBA: | 1 |
| Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 17.1 | Aromatic Rings: | 0 |
| Heavy Atoms: | 11 | QED Weighted: | 0.445 |
| Caco-2 Permeability: | -4.338 | MDCK Permeability: | 0.00003070 |
| Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.001 |
| Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.002 |
| 30% Bioavailability (F30%): | 0.002 |
| Blood-Brain-Barrier Penetration (BBB): | 0.905 | Plasma Protein Binding (PPB): | 77.34% |
| Volume Distribution (VD): | 1.467 | Fu: | 19.34% |
| CYP1A2-inhibitor: | 0.389 | CYP1A2-substrate: | 0.577 |
| CYP2C19-inhibitor: | 0.349 | CYP2C19-substrate: | 0.905 |
| CYP2C9-inhibitor: | 0.239 | CYP2C9-substrate: | 0.904 |
| CYP2D6-inhibitor: | 0.007 | CYP2D6-substrate: | 0.648 |
| CYP3A4-inhibitor: | 0.034 | CYP3A4-substrate: | 0.329 |
| Clearance (CL): | 9.93 | Half-life (T1/2): | 0.84 |
| hERG Blockers: | 0.013 | Human Hepatotoxicity (H-HT): | 0.399 |
| Drug-inuced Liver Injury (DILI): | 0.185 | AMES Toxicity: | 0.12 |
| Rat Oral Acute Toxicity: | 0.537 | Maximum Recommended Daily Dose: | 0.358 |
| Skin Sensitization: | 0.93 | Carcinogencity: | 0.829 |
| Eye Corrosion: | 0.972 | Eye Irritation: | 0.988 |
| Respiratory Toxicity: | 0.94 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001735 | ![]() |
1.000 | D0ZK8H | ![]() |
0.263 | ||
| ENC000237 | ![]() |
0.452 | D0H6VY | ![]() |
0.255 | ||
| ENC000376 | ![]() |
0.364 | D00WUF | ![]() |
0.244 | ||
| ENC000351 | ![]() |
0.364 | D04MWJ | ![]() |
0.222 | ||
| ENC001568 | ![]() |
0.350 | D0M1PQ | ![]() |
0.200 | ||
| ENC000685 | ![]() |
0.342 | D07ZTO | ![]() |
0.196 | ||
| ENC000241 | ![]() |
0.342 | D0G8SQ | ![]() |
0.196 | ||
| ENC000246 | ![]() |
0.333 | D0R1QE | ![]() |
0.193 | ||
| ENC001203 | ![]() |
0.316 | D05BQK | ![]() |
0.186 | ||
| ENC000603 | ![]() |
0.308 | D0R3QY | ![]() |
0.186 | ||