|
Name |
Farnesylacetone
|
| Molecular Formula | C18H30O | |
| IUPAC Name* |
(5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trien-2-one
|
|
| SMILES |
CC(=CCC/C(=C/CC/C(=C/CCC(=O)C)/C)/C)C
|
|
| InChI |
InChI=1S/C18H30O/c1-15(2)9-6-10-16(3)11-7-12-17(4)13-8-14-18(5)19/h9,11,13H,6-8,10,12,14H2,1-5H3/b16-11+,17-13+
|
|
| InChIKey |
LTUMRKDLVGQMJU-IUBLYSDUSA-N
|
|
| Synonyms |
1117-52-8; Farnesylacetone; Farnesyl acetone; (5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trien-2-one; E,E-farnesylacetone; (E,E)-farnesylacetone; 5,9,13-Pentadecatrien-2-one, 6,10,14-trimethyl-, (5E,9E)-; 762-29-8; trans,trans-farnesylacetone; Farnesyl acetone, (5E,9E)-; (E,E)-6,10,14-Trimethylpentadeca-5,9,13-trien-2-one; CHEBI:67252; 3S0G4N267H; 5,9,13-Pentadecatrien-2-one, 6,10,14-trimethyl-, (E,E)-; 6,10,14-Trimethyl-5,9,13-pentadecatrien-2-one; 5,9,13-Pentadecatriene-2-one, 6,10,14-trimethyl-; 5,9,13-PENTADECATRIEN-2-ONE, 6,10,14-TRIMETHYL-; (5E,9E)-6,10,14-Trimethyl-5,9,13-pentadecatrien-2-one; farnesylacetol; Famesyl acetone; UNII-3S0G4N267H; MFCD00036517; EINECS 214-246-3; trans, trans-farnesylacetone; (5E,9E)-farnesyl acetone; 2,6,10-Trimethyl-2,6,10-pentadecatrien-14-one; FEMA No. 3442; CHEMBL486207; DTXSID5061087; SCHEMBL17273769; UNII-26A08O86E6; DTXSID50883648; EINECS 212-097-9; ZINC12358879; 26A08O86E6; AS-56645; AS-70344; CS-0031615; FEMA NO. 3442, (5E,9E)-; D70272; EN300-6481226; 117F528; A894696; Q27135719; Pentadeca-5,9,13-triene-2-one, 6,10,14-trimethyl-; (5E,9E)-6,10,14-Trimethyl-5,9,13-pentadecatrien-2-one #; 5,9,13-Pentadecatrien-2-one, 6,10,14-trimethhyl-, [E,E]; (E,E)-6,10,14-TRIMETHYL-5,9,13-PENTADECATRIEN-2-ONE
|
|
| CAS | 1117-52-8 | |
| PubChem CID | 1711945 | |
| ChEMBL ID | CHEMBL486207 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 262.4 | ALogp: | 5.6 |
| HBD: | 0 | HBA: | 1 |
| Rotatable Bonds: | 9 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 17.1 | Aromatic Rings: | 0 |
| Heavy Atoms: | 19 | QED Weighted: | 0.473 |
| Caco-2 Permeability: | -4.676 | MDCK Permeability: | 0.00002280 |
| Pgp-inhibitor: | 0.422 | Pgp-substrate: | 0.066 |
| Human Intestinal Absorption (HIA): | 0.042 | 20% Bioavailability (F20%): | 0.864 |
| 30% Bioavailability (F30%): | 0.81 |
| Blood-Brain-Barrier Penetration (BBB): | 0.566 | Plasma Protein Binding (PPB): | 97.05% |
| Volume Distribution (VD): | 2.096 | Fu: | 2.09% |
| CYP1A2-inhibitor: | 0.674 | CYP1A2-substrate: | 0.351 |
| CYP2C19-inhibitor: | 0.346 | CYP2C19-substrate: | 0.401 |
| CYP2C9-inhibitor: | 0.45 | CYP2C9-substrate: | 0.959 |
| CYP2D6-inhibitor: | 0.303 | CYP2D6-substrate: | 0.514 |
| CYP3A4-inhibitor: | 0.2 | CYP3A4-substrate: | 0.151 |
| Clearance (CL): | 6.106 | Half-life (T1/2): | 0.466 |
| hERG Blockers: | 0.009 | Human Hepatotoxicity (H-HT): | 0.876 |
| Drug-inuced Liver Injury (DILI): | 0.02 | AMES Toxicity: | 0 |
| Rat Oral Acute Toxicity: | 0.001 | Maximum Recommended Daily Dose: | 0.24 |
| Skin Sensitization: | 0.95 | Carcinogencity: | 0.029 |
| Eye Corrosion: | 0.826 | Eye Irritation: | 0.906 |
| Respiratory Toxicity: | 0.009 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001465 | ![]() |
1.000 | D09XWD | ![]() |
0.785 | ||
| ENC001464 | ![]() |
0.729 | D05XQE | ![]() |
0.632 | ||
| ENC001467 | ![]() |
0.725 | D03VFL | ![]() |
0.483 | ||
| ENC001096 | ![]() |
0.679 | D01ZUA | ![]() |
0.266 | ||
| ENC001716 | ![]() |
0.646 | D0M1PQ | ![]() |
0.242 | ||
| ENC001717 | ![]() |
0.621 | D06BLQ | ![]() |
0.202 | ||
| ENC001427 | ![]() |
0.529 | D0Q7ZQ | ![]() |
0.198 | ||
| ENC003133 | ![]() |
0.512 | D0X7XG | ![]() |
0.190 | ||
| ENC006119 | ![]() |
0.500 | D0UE9X | ![]() |
0.174 | ||
| ENC001664 | ![]() |
0.468 | D0Q6DX | ![]() |
0.169 | ||