|
Name |
2-Linoleoylglycerol
|
| Molecular Formula | C21H38O4 | |
| IUPAC Name* |
1,3-dihydroxypropan-2-yl (9Z,12Z)-octadeca-9,12-dienoate
|
|
| SMILES |
CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC(CO)CO
|
|
| InChI |
InChI=1S/C21H38O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-20(18-22)19-23/h6-7,9-10,20,22-23H,2-5,8,11-19H2,1H3/b7-6-,10-9-
|
|
| InChIKey |
IEPGNWMPIFDNSD-HZJYTTRNSA-N
|
|
| Synonyms |
2-Linoleoylglycerol; 3443-82-1; 2-Monolinolein; 2-Linoleoyl-rac-glycerol; Glyceryl 2-linoleate; Linolein, 2-mono-; 2-Monolinoleoylglycerol; beta-Monolinolein; 2-linoleoyl-glycerol; 2-Linoleoyl Glycerol; 1,3-dihydroxypropan-2-yl (9Z,12Z)-octadeca-9,12-dienoate; 2-Glyceryl 9,12-octadecadienoate; .beta.-Monolinolein; 7OVH75512R; 9,12-Octadecadienoic acid (Z,Z)-, 2-hydroxy-1-(hydroxymethyl)ethyl ester; 9,12-Octadecadienoic acid (9Z,12Z)-, 2-hydroxy-1-(hydroxymethyl)ethyl ester; 9,12-Octadecadienoic acid (9Z,12Z)-, 2-hydroxy-1-(hydroxymethyl)ethylester; UNII-7OVH75512R; 2- glyceryl ester; SCHEMBL145068; 2-LG; ACon1_002339; CHEBI:75457; DTXSID301016998; HMS3649E03; ZINC13540278; (9Z,12Z)-9,12-Octadecadienoic Acid 2-Hydroxy-1-(hydroxymethyl)ethyl Ester; 2-(9Z,12Z-octadecadienoyl)-glycerol; MAG(0:0/18:2n6); MAG(0:0/18:2w6); MG(0:0/18:2n6); MG(0:0/18:2w6); NCGC00169939-01; 2-(9Z,12Z-octadecadienoyl)-rac-glycerol; MAG(0:0/18:2); MG(0:0/18:2); SR-01000946563; J-019604; SR-01000946563-1; BRD-K90410933-001-01-7; MG (0:0/18:2(n-6)/0:0); Q27145325; MG(0:0/18:2(9Z,12Z)/0:0); 2-Hydroxy-1-(hydroxymethyl)ethyl (9Z,12Z)-9,12-octadecadienoate #; VL7
|
|
| CAS | 3443-82-1 | |
| PubChem CID | 5365676 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 354.5 | ALogp: | 5.6 |
| HBD: | 2 | HBA: | 4 |
| Rotatable Bonds: | 18 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 66.8 | Aromatic Rings: | 0 |
| Heavy Atoms: | 25 | QED Weighted: | 0.216 |
| Caco-2 Permeability: | -5.123 | MDCK Permeability: | 0.00011380 |
| Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.001 |
| Human Intestinal Absorption (HIA): | 0.03 | 20% Bioavailability (F20%): | 1 |
| 30% Bioavailability (F30%): | 1 |
| Blood-Brain-Barrier Penetration (BBB): | 0.235 | Plasma Protein Binding (PPB): | 95.19% |
| Volume Distribution (VD): | 0.895 | Fu: | 2.37% |
| CYP1A2-inhibitor: | 0.178 | CYP1A2-substrate: | 0.32 |
| CYP2C19-inhibitor: | 0.104 | CYP2C19-substrate: | 0.056 |
| CYP2C9-inhibitor: | 0.289 | CYP2C9-substrate: | 0.496 |
| CYP2D6-inhibitor: | 0.059 | CYP2D6-substrate: | 0.151 |
| CYP3A4-inhibitor: | 0.729 | CYP3A4-substrate: | 0.158 |
| Clearance (CL): | 6.807 | Half-life (T1/2): | 0.967 |
| hERG Blockers: | 0.096 | Human Hepatotoxicity (H-HT): | 0.153 |
| Drug-inuced Liver Injury (DILI): | 0.025 | AMES Toxicity: | 0.132 |
| Rat Oral Acute Toxicity: | 0.014 | Maximum Recommended Daily Dose: | 0.024 |
| Skin Sensitization: | 0.947 | Carcinogencity: | 0.477 |
| Eye Corrosion: | 0.004 | Eye Irritation: | 0.108 |
| Respiratory Toxicity: | 0.309 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001628 | ![]() |
0.797 | D0O1TC | ![]() |
0.614 | ||
| ENC001605 | ![]() |
0.724 | D0O1PH | ![]() |
0.557 | ||
| ENC001660 | ![]() |
0.724 | D0UE9X | ![]() |
0.542 | ||
| ENC001583 | ![]() |
0.718 | D0OR6A | ![]() |
0.535 | ||
| ENC001711 | ![]() |
0.713 | D0H2YX | ![]() |
0.400 | ||
| ENC001714 | ![]() |
0.713 | D07ILQ | ![]() |
0.379 | ||
| ENC001535 | ![]() |
0.707 | D00MLW | ![]() |
0.372 | ||
| ENC001584 | ![]() |
0.707 | D09SRR | ![]() |
0.352 | ||
| ENC001845 | ![]() |
0.687 | D0XN8C | ![]() |
0.340 | ||
| ENC001920 | ![]() |
0.684 | D0Z5BC | ![]() |
0.321 | ||