|
Name |
Dacamox
|
| Molecular Formula | C9H18N2O2S | |
| IUPAC Name* |
[(E)-(3,3-dimethyl-1-methylsulfanylbutan-2-ylidene)amino] N-methylcarbamate
|
|
| SMILES |
CC(C)(C)/C(=N\OC(=O)NC)/CSC
|
|
| InChI |
InChI=1S/C9H18N2O2S/c1-9(2,3)7(6-14-5)11-13-8(12)10-4/h6H2,1-5H3,(H,10,12)/b11-7-
|
|
| InChIKey |
FZSVSABTBYGOQH-XFFZJAGNSA-N
|
|
| Synonyms |
Thiofanocarb; Dacamox; Benelux; THIOFANOX; 3,3-Dimethyl-1-(methylthio)butanone-O-(N-methylcarbamoyl)oxime; RCRA waste number P045; Diamond shamrock DS-15647; Thiofanox, (E)-; ENT 27851; 1-(2,2-Dimethyl-1-methylthiomethylpropylideneamino-oxy)-N-methylformamide; J67DNB896U; 39196-18-4; Thiophanox; 3,3-Dimethyl-1-(methylthio)-2-butanone O-((methylamino)carbonyl)oxime; Caswell No. 368BB; 3,3-dimethyl-N-(methylcarbamoyloxy)-1-(methylsulfanyl)butan-2-imine; 3,3-Dimethyl-1-(Methylthio)-2-butanone O-[(methylamino)carbonyl]oxime; 2-Butanone, 3,3-dimethyl-1-(methylthio)-, O-((methylamino)carbonyl)oxime, (E)-; 75013-98-8; Thiofanox [ANSI:BSI:ISO]; Pesticide code No. 10920; Pesticide5_Thiofanox_C9H18N2O2S_Benelux; HSDB 6045; EINECS 254-346-4; RCRA waste no. P045; UNII-9ZE4QF28IN; EPA Pesticide Chemical Code 109201; CHEBI:38549; BRN 2329756; AI3-27851; (Z)-thiofanox; 3,3-Dimethyl-1-methylthiobutanone O-methylcarbamoyloxime; 3,3-Dimethyl-1-(methylthio)-2-butanone-O-((methylamino)carbonyl)oxime; 9ZE4QF28IN; UNII-J67DNB896U; SCHEMBL5933828; W-110919; Q27291966
|
|
| CAS | 39196-18-4 | |
| PubChem CID | 5364932 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 218.32 | ALogp: | 2.2 |
| HBD: | 1 | HBA: | 4 |
| Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 76.0 | Aromatic Rings: | 0 |
| Heavy Atoms: | 14 | QED Weighted: | 0.45 |
| Caco-2 Permeability: | -4.618 | MDCK Permeability: | 0.00001840 |
| Pgp-inhibitor: | 0 | Pgp-substrate: | 0.017 |
| Human Intestinal Absorption (HIA): | 0.796 | 20% Bioavailability (F20%): | 0.004 |
| 30% Bioavailability (F30%): | 0.004 |
| Blood-Brain-Barrier Penetration (BBB): | 0.952 | Plasma Protein Binding (PPB): | 63.76% |
| Volume Distribution (VD): | 1.475 | Fu: | 55.15% |
| CYP1A2-inhibitor: | 0.273 | CYP1A2-substrate: | 0.458 |
| CYP2C19-inhibitor: | 0.164 | CYP2C19-substrate: | 0.84 |
| CYP2C9-inhibitor: | 0.024 | CYP2C9-substrate: | 0.293 |
| CYP2D6-inhibitor: | 0.011 | CYP2D6-substrate: | 0.555 |
| CYP3A4-inhibitor: | 0.103 | CYP3A4-substrate: | 0.47 |
| Clearance (CL): | 5.777 | Half-life (T1/2): | 0.869 |
| hERG Blockers: | 0.009 | Human Hepatotoxicity (H-HT): | 0.901 |
| Drug-inuced Liver Injury (DILI): | 0.439 | AMES Toxicity: | 0.701 |
| Rat Oral Acute Toxicity: | 0.99 | Maximum Recommended Daily Dose: | 0.056 |
| Skin Sensitization: | 0.629 | Carcinogencity: | 0.759 |
| Eye Corrosion: | 0.038 | Eye Irritation: | 0.262 |
| Respiratory Toxicity: | 0.919 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001727 | ![]() |
0.277 | D01JFT | ![]() |
0.217 | ||
| ENC001051 | ![]() |
0.235 | D0FM2P | ![]() |
0.208 | ||
| ENC000719 | ![]() |
0.222 | D05PLH | ![]() |
0.203 | ||
| ENC001245 | ![]() |
0.220 | D01FJT | ![]() |
0.193 | ||
| ENC004204 | ![]() |
0.220 | D04MWJ | ![]() |
0.189 | ||
| ENC001743 | ![]() |
0.203 | D07XYV | ![]() |
0.182 | ||
| ENC000145 | ![]() |
0.203 | D0X4ZR | ![]() |
0.182 | ||
| ENC000287 | ![]() |
0.200 | D07SJT | ![]() |
0.175 | ||
| ENC005661 | ![]() |
0.194 | D0T6IP | ![]() |
0.174 | ||
| ENC001781 | ![]() |
0.193 | D0Q9HF | ![]() |
0.173 | ||