![]() |
Name |
Linalyl isobutyrate
|
Molecular Formula | C14H24O2 | |
IUPAC Name* |
3,7-dimethylocta-1,6-dien-3-yl 2-methylpropanoate
|
|
SMILES |
CC(C)C(=O)OC(C)(CCC=C(C)C)C=C
|
|
InChI |
InChI=1S/C14H24O2/c1-7-14(6,10-8-9-11(2)3)16-13(15)12(4)5/h7,9,12H,1,8,10H2,2-6H3
|
|
InChIKey |
JZIARAQCPRDGAC-UHFFFAOYSA-N
|
|
Synonyms |
Linalyl isobutyrate; 78-35-3; Linalool isobutyrate; 3,7-dimethylocta-1,6-dien-3-yl 2-methylpropanoate; Linalyl 2-methylpropanoate; Linalool, isobutyrate; Isobutyric acid, linalyl ester; 1,5-Dimethyl-1-vinyl-4-hexenyl isobutyrate; FEMA No. 2640; 1,6-Octadien-3-ol, 3,7-dimethyl-, isobutyrate; 3,7-Dimethyl-1,6-octadienyl isobutyrate; 1,5-Dimethyl-1-vinylhex-4-enyl isobutyrate; 3,7-Dimethyl-1,6-octadien-3-yl isobutyrate; NSC 46145; ISOBUTYRIC ACID, 1,5-DIMETHYL-1-VINYL-4-HEXENYL ESTER; 3,7-Dimethyl-1,6-octadien-3-ol isobutyrate; 3,7-Dimethyl-1,6-octadien-3-yl isobutanoate; Propanoic acid, 2-methyl-, 1-ethenyl-1,5-dimethyl-4-hexenyl ester; 3,7-Dimethyl-1,6-octadien-3-yl 2-methylpropanoate; 1-Ethenyl-1,5-dimethyl-4-hexenyl 2-methylpropanoate; (1)-1,5-Dimethyl-1-vinylhex-4-enyl isobutyrate; NSC-46145; 8867Y4G46L; Propanoic acid, 2-methyl-, 1-ethenyl-1,5-dimethyl-4-hexen-1-yl ester; 1,5-Dimethyl-1-vinyl-4-hexenyl 2-methylpropanoate; Linalylisobutyrate; EINECS 201-108-2; EINECS 305-132-5; BRN 1726378; linalylisobutyrat; AI3-24264; UNII-8867Y4G46L; Linalol isobutyrate; Linalyl iso-Butyrate; Isobutyric acid, linalyl ester (6CI); 3,6-octadienyl isobutyrate; DSSTox_CID_27490; DSSTox_RID_82378; DSSTox_GSID_47490; 4-02-00-00849 (Beilstein Handbook Reference); SCHEMBL560781; 3,6-octadien-3-yl isobutyrate; CHEMBL3185164; DTXSID6047490; FEMA 2640; 1, 3,7-dimethyl-, isobutyrate; LINALYL ISOBUTYRATE [FCC]; CHEBI:171776; LINALYL ISOBUTYRATE [FHFI]; NSC46145; Tox21_302721; AKOS015837556; CAS-78-35-3; NCGC00256753-01; AS-77518; 3,7-Dimethyl-1, 6-octadienyl isobutyrate; WLN: 1Y1&VOX1&1U1&3UY1&1; DB-056304; FT-0631344; 3,7-Dimethylocta-1,6-dien-3-yl isobutyrate; 3, 7-Dimethyl-1,6-octadien-3-yl isobutyrate; D93228; Isobutyric acid,5-dimethyl-1-vinyl-4-hexenyl ester; Q27269894; Propanoic acid, 1-ethenyl-1,5-dimethyl-4-hexenyl ester
|
|
CAS | 78-35-3 | |
PubChem CID | 6532 | |
ChEMBL ID | CHEMBL3185164 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 224.34 | ALogp: | 4.3 |
HBD: | 0 | HBA: | 2 |
Rotatable Bonds: | 7 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 26.3 | Aromatic Rings: | 0 |
Heavy Atoms: | 16 | QED Weighted: | 0.489 |
Caco-2 Permeability: | -4.442 | MDCK Permeability: | 0.00002460 |
Pgp-inhibitor: | 0.747 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.606 |
30% Bioavailability (F30%): | 0.125 |
Blood-Brain-Barrier Penetration (BBB): | 0.444 | Plasma Protein Binding (PPB): | 89.41% |
Volume Distribution (VD): | 1.805 | Fu: | 13.58% |
CYP1A2-inhibitor: | 0.301 | CYP1A2-substrate: | 0.239 |
CYP2C19-inhibitor: | 0.352 | CYP2C19-substrate: | 0.903 |
CYP2C9-inhibitor: | 0.129 | CYP2C9-substrate: | 0.247 |
CYP2D6-inhibitor: | 0.084 | CYP2D6-substrate: | 0.115 |
CYP3A4-inhibitor: | 0.634 | CYP3A4-substrate: | 0.386 |
Clearance (CL): | 7.544 | Half-life (T1/2): | 0.258 |
hERG Blockers: | 0.025 | Human Hepatotoxicity (H-HT): | 0.534 |
Drug-inuced Liver Injury (DILI): | 0.096 | AMES Toxicity: | 0.006 |
Rat Oral Acute Toxicity: | 0.016 | Maximum Recommended Daily Dose: | 0.011 |
Skin Sensitization: | 0.582 | Carcinogencity: | 0.125 |
Eye Corrosion: | 0.257 | Eye Irritation: | 0.788 |
Respiratory Toxicity: | 0.082 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000287 | ![]() |
0.711 | D0M1PQ | ![]() |
0.340 | ||
ENC000314 | ![]() |
0.407 | D05PLH | ![]() |
0.239 | ||
ENC001606 | ![]() |
0.407 | D04MWJ | ![]() |
0.236 | ||
ENC001812 | ![]() |
0.373 | D09XWD | ![]() |
0.233 | ||
ENC000319 | ![]() |
0.368 | D0ZK8H | ![]() |
0.220 | ||
ENC001720 | ![]() |
0.364 | D0U9QU | ![]() |
0.217 | ||
ENC001719 | ![]() |
0.364 | D0FM2P | ![]() |
0.212 | ||
ENC003366 | ![]() |
0.356 | D02KBD | ![]() |
0.206 | ||
ENC001716 | ![]() |
0.347 | D05XQE | ![]() |
0.202 | ||
ENC000230 | ![]() |
0.346 | D0Q9HF | ![]() |
0.200 |